Index No | chemical name | Notes related to substances | EC No | CAS No | Classification | Labelling | Concentration Limits | Notes related to preparations |
---|
006-005-00-4 | thiramtetramethylthiuram disulphide | | 205-286-2 | 137-26-8 | Xn; R20/22-48/22Xi; R36/38R43N; R50-53 | Xn; NR: 20/22-36/38-43-48/22-50/53S: (2-)26-36/37-60-61 | C ≥ 25 %: Xn, N; R20/22-36/38-43-48/22-50/5320 % ≤ C < 25 %: Xn, N; R36/38-43-48/22-50/5310 % ≤ C < 20 %: Xn, N; R43-48/22-50/532,5 % ≤ C < 10 %: Xi, N; R43-50/531 % ≤ C < 2,5 %: Xi, N; R43-51/530,25 % ≤ C < 1 %: N; R51/530,025 % ≤ C < 0,25 %: R52/53 | |
006-006-01-7 | hydrogen cyanide...%hydrocyanic acid...% | B | 200-821-6 | 74-90-8 | T+; R26/27/28N; R50-53 | T+; NR: 26/27/28-50/53S: (1/2-)7/9-16-36/37-38-45-60-61 | C ≥ 25 %: T+, N; R26/27/28-50-537 % ≤ C < 25 %: T+, N; R26/27/28-51-532,5 % ≤ C < 7 %: T, N; R23/24/25-51-531 % ≤ C < 2,5 %: T, N; R23/24/25-52-530,25 % ≤ C < 1 %: Xn; R20/21/22-52-530,1 % ≤ C< 0,25 %:Xn; R20/21/22 | |
006-012-00-2 | ziram (ISO)zinc bis dimethyldithiocarbamate | | 205-288-3 | 137-30-4 | T+; R26Xn; R22-48/22Xi; R37-41R43N; R50-53 | T+; NR: 22-26-37-41-43-48/22-50/53S: (1/2-)22-26-28-36/37/39-45-60-61 | C ≥ 25 %: T+, N; R22-26-37-41-43-48/22-50-5320 % ≤ C < 25 %: T+, N; R26-37-41-43-48/22-50-5310 % ≤ C < 20 %: T+, N; R26-41-43-48/22-50-537 % ≤ C < 10 %: T+, N; R26-36-43-50-535 % ≤ C < 7 %: T, N; R23-36-43-50-531 % ≤ C < 5 %: T, N; R23-43-50-530,25 % ≤ C < 1 %: Xn, N; R20-50-530,1 % ≤ C < 0,25 %: Xn, N; R20-51-530,025 % ≤ C < 0,1 %: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
006-021-00-1 | linuron (ISO)3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea | E | 206-356-5 | 330-55-2 | Repr. Cat. 2; R61Repr. Cat. 3;R62 Carc. Cat. 3; R40Xn; R22-48/22N; R50-53 | T; NR: 61-22-40-48/22-62-50/53S: 53-45-60-61 | | |
006-044-00-7 | isoproturon3-(4-isopropylphenyl)-1,1-dimethylurea | | 251-835-4 | 34123-59-6 | Carc. Cat. 3; R40N; R50-53 | Xn; NR: 40-50/53S: (2-)36/37-60-61 | C ≥ 2,5 %: Xn, N; R40-50-531 % ≤ C < 2,5 %: Xn, N; R40-51-530,25 % ≤ C < 1 %: N; R51-530,025 % ≤ C < 0,25 %: R52-53 | |
006-072-00-X | S-benzyl N,N-dipropylthiocarbamateprosulfocarb | | 401-730-6 | 52888-80-9 | Xn; R22R43N; R51-53 | Xn; NR: 22-43-51/53S: (2-)24-37-61 | | |
006-089-00-2 | chlorine dioxide | | 233-162-8 | 10049-04-4 | O; R8R6T+; R26C; R34N; R50 | O; T+; NR: 6-8-26-34-50S: (1/2-)23-26-28-36/37/39-38-45-61 | C ≥ 5 %: T+; N; R26-34-501 % ≤ C < 5 %: T+; N; R26-36/37/38-500,5 % ≤ C < 1 %: T; N; R23-36/37/38-500,2 % ≤ C < 0,5 %: T; N; R23-500,02 % ≤ C < 0,2 %: Xn; N; R20-50 | |
006-089-01-X | chlorine dioxide ... % | B | 233-162-8 | 10049-04-4 | T; R25C; R34N; R50 | T; NR: 25-34-50S: (1/2-)23-26-28-36/37/39-45-61 | C ≥ 25 %: T; N; R25-34-5010 % ≤ C <25 %: C, N; R22-34-503 % ≤ C < 10 %: Xn; N; R22-36/37/38-500,3 % ≤ C < 3 %: Xi; R36 | |
007-001-00-5 | ammonia, anhydrous | | 231-635-3 | 7664-41-7 | R10T; R23C; R34N; R50 | T; NR: 10-23-34-50S: (1/2-)9-16-26-36/37/39-45-61 | C ≥ 25 %: T, N; R23-34-505% ≤ C < 25%:T;R23-340,5 % ≤ C < 5 %: Xn; R20-36/37/38 | |
007-008-00-3 | hydrazine | E | 206-114-9 | 302-01-2 | R10Carc. Cat. 2; R45T; R23/24/25C; R34R43N; R50-53 | T; NR: 45-10-23/24/25-34-43-50/53S: 53-45-60-61 | C ≥ 25 %: T, N; R45-23/24/25-34-43-50/5310 % ≤ C < 25 %: T, N; R45-20/21/22-34-43-51/533 % ≤ C < 10 %: T, N; R45-20/21/22-36/38-43-51/532,5 % ≤ C < 3 %: T, N; R45-43-51/531 % ≤ C < 2,5 %: T; R45-43-52/530,25 % ≤ C < 1 %: T; R45-52/530,1 % ≤ C < 0,25 %: T; R45 | |
007-010-00-4 | sodium nitrite | | 231-832-4 | 7758-09-0 | O; R8T; R25N; R50 | O; T; NR: 8-25-50S: (1/2-)45-61 | C ≥ 25 %: T, N; R25-505 % ≤ C < 25 %: T; R251 % ≤ C < 5 %: Xn; R22 | |
007-011-00-X | potassium nitrite | | 231-832-4 | 7758-09-0 | O; R8T; R25N; R50 | O; T; NR: 8-25-50S: (1/2-)45-61 | C ≥ 25 %: T, N; R25-505% ≤ C< 25 %:T; R251 % ≤ C< 5 %:Xn; R22 | |
007-013-00-0 | 1,2-dimethylhydrazine | E | - | 540-73-8 | Carc. Cat. 2; R45T; R23/24/25N; R51-53 | T; NR: 45-23/24/25-51/53S: 53-45-61 | C ≥ 25 %: T, N; R45-23/24/25-51/533 % ≤ C < 25 %: T; R45-20/21/22-52/532,5 % ≤ C < 3 %: T; R45-52/530,01 % ≤ C < 2,5 %: T; R45 | |
007-017-00-2 | isobutyl nitrite | E | 208-819-7 | 542-56-3 | F; R11Xn; R20/22Carc. Cat. 2; R45Muta. Cat. 3; R68 | F; TR: 11-20/22-45-68S: 53-45 | | |
007-027-00-7 | 1,6-bis(3,3-bis((1-methylpentylidenimino)propyl)ureido)hexane | | 420-190-2 | - | Xn; R21/22-48/21C; R34R43N; R50-53 | C; NR: 21/22-34-43-48/21-50/53S: (1/2-)7-26-36/37/39-45-60-61 | | |
008-003-00-9 | hydrogen peroxide solution ... % | B | 231-765-0 | 7722-84-1 | R5O; R8C; R35Xn; R20/22 | O; CR: 5-8-20/22-35S: (1/2-)17-26-28-36/37/39-45 | C ≥ 70 %: C; R20/22-3550 % ≤ C < 70 %: C; R20/22-3435 % ≤ C < 50 %: Xn; R22-37/38-418 % ≤ C < 35 %: Xn; R22-415 % ≤ C< 8 %: Xi; R36Footnote:C ≥ 70 %: R5, O; R850 % ≤ C < 70 %: O; R8 | |
009-015-00-7 | sulphuryl difluoride | | 220-281-5 | 2699-79-8 | T; R23Xn; R48/20N; R50 | T; NR: 23-48/20-50S: (1/2-)45-63-60-61 | | |
015-002-00-7 | red phosphorus | | 231-768-7 | 7723-14-0 | F; R11R16R52-53 | FR: 11-16-52/53S: (2-)7-43-61 | | |
015-014-00-2 | tributyl phosphate | | 204-800-2 | 126-73-8 | Carc. Cat.3; R40Xn; R22Xi; R38 | XnR: 22-38-40S: (2-)36/37-46 | | |
015-015-00-8 | tricresyl phosphatetritolyl phosphateo-o-o, o-o-m, o-o-p, o-m-m, o-m-p, o-p-p | C | 201-103-5 | 78-30-8 | T; R39/23/24/25N; R51-53 | T; NR: 39/23/24/25-51/53S: (1/2-)20/21-28-45-61 | C ≥ 25 %: T, N; R39/23/24/25-51/532,5 % ≤ C < 25 %: T; R39/23/24/25-52/531 % ≤ C < 2,5 %: T; R39/23/24/250,2 % ≤ C < 1 %: Xn; R68/20/21/22 | |
015-016-00-3 | tricresyl phosphatetritolyl phosphatem-m-m, m-m-p, m-p-p, p-p-p | C | 201-105-6 | 78-32-0 | Xn; R21/22N; R51-53 | Xn; NR: 21/22-51/53S: (2-)28-61 | C ≥ 25 %: Xn, N; R21/22-51/535 % ≤ C < 25 %: Xn; R21/22-52/532,5 % ≤ C < 5 %: R52/53 | |
015-020-00-5 | mevinphos (ISO)2-methoxycarbonyl-1-methylvinyl dimethyl phosphate | | 232-095-1 | 7786-34-7 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)23-28-36/37-45-60-61 | C ≥ 7 %: T+, N; R27/28-50-531 % ≤ C < 7 %: T, N; R24/25-50-530,1 % ≤ C<1 %: Xn, N; R21/22-50-530,0025 % ≤ C < 0,1 %: N; R50-530,00025 % ≤ C < 0,0025 %: N; R51-530,000025 % ≤ C < 0,00025 %: R52-53 | |
015-021-00-0 | trichlorfon (ISO)dimethyl 2,2,2-trichloro-1-hydroxyethylphosphonate | | 200-149-3 | 52-68-6 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24-37-60-61 | C ≥ 25 %: Xn, N; R22-43-50-531 % ≤ C < 25 %: Xi, N; R43-50-530,025 % ≤ C < 1 %: N; R50-530,0025 % ≤ C < 0,025 %: N; R51-530,00025 % ≤ C < 0,0025 %: R52-53 | |
015-027-00-3 | sulfotep (ISO)O,O,O,O-tetraethyldithiopyrophosphate | | 222-995-2 | 3689-24-5 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)23-28-36/37-45-60-61 | C ≥ 7 %: T+, N; R27/28-50-531 % ≤ C < 7 %: T, N; R24/25-50-530,1 % ≤ C < 1 %: Xn, N; R21/22-50-530,025 % ≤ C < 0,1 %: N; R50-530,0025 % ≤ C < 0,025 %: N; R51-530,00025 % ≤ C < 0,0025 %: R52-53 | |
015-032-00-0 | prothoate (ISO)O,O-diethylisopropylcarbamoylmethylphosphorodithioate | | 218-893-2 | 2275-18-5 | T+: R27/28R52-53 | T+R: 27/28-52/53S: (1/2-)28-36/37-45-61 | | |
015-033-00-6 | phorate (ISO)O,O-diethyl ethylthiomethylphosphorodithioate | | 206-052-2 | 298-02-2 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)28-36/37-45-60-61 | C ≥ 7 %: T+, N; R27/28-50-531 % ≤ C < 7 %: T, N; R24/25-50-530,1 % ≤ C < 1 %: Xn, N; R21/22-50-530,025 % ≤ C < 0,1 %: N; R50-530,0025 % ≤ C < 0,025 %: N; R51-530,00025 % ≤ C < 0,0025 %: R52-53 | |
015-034-00-1 | parathion (ISO)O,O-diethyl O-4-nitrophenylphosphorothioate | | 200-271-7 | 56-38-2 | T+;R26/28T; 24-48/25N; R50-53 | T+; NR: 24-26/28-48/25-50/53S: (1/2-)28-36/37-45-60-61 | C ≥ 25 %: T+, N; R24-26/28-48/25-50-5310 % ≤ C < 25 %: T+, N; R21-26/28-48/25-50-537 % ≤ C < 10%: T+, N; R21-26/28-48/22-50-533 % ≤ C< 7 %:T, N; R21-23/25-48/22-50-531 % ≤ C < 3 %: T, N; R23/25-48/22-50-530,25 % ≤ C < 1 %: Xn, N; R20/22-50-530,1 % ≤ C < 0,25 %: Xn, N; R20/22-51-530,025 % ≤ C < 0,1 %: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
015-035-00-7 | parathion - methyl (ISO)O,O-dimethyl O-4-nitrophenylphosphorothioate | | 206-050-1 | 298-00-0 | R5R10T+; R26/28T; R24Xn; R48/22N; R50-53 | T+; NR: 5-10-24-26/28-48/22-50/53S: (1/2-)28-36/37-45-60-61 | C ≥ 25 %: T+, N; R24-26/28-48/22-50-5310 % ≤ C < 25 %: T+, N; R21-26/28-48/22-50-537 % ≤ C < 10 %: T+, N; R21-26/28-50-533 % ≤ C < 7 %:T, N; R21-23/25-50-531 % ≤ C < 3 %: T, N; R23/25-50-530,25 % ≤ C < 1 %: Xn, N; R20/22-50-530,1 % ≤ C < 0,25 %: Xn, N; R20/22-51-530,025 % ≤ C < 0,1 %: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
015-041-00-X | malathion (ISO)1,2-bis (ethoxycarbonyl) ethylO,O-dimethyl phosphorodithioate | | 204-497-7 | 121-75-5 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)24-60-61 | C ≥ 25 %: Xn, N; R22-50-530,25 % ≤ C < 25 %: N; R50-530,025 % ≤ C < 0,25 %: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
015-042-00-5 | chlorthion (common name not adopted by ISO)O-(3-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate | | 207-902-5 | 500-28-7 | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S:(2-)13-60-61 | C ≥ 25 %: Xn, N; R20/21/22-50-530,25 % ≤ C < 25 %: N; R50-530,025 % ≤ C < 0,25: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
015-047-00-2 | ethion (ISO)O,O,O',O'-tetraethyl S,S'-methylenedi (phosphorodithioate) diethion | | 209-242-3 | 563-12-2 | T; R25Xn; R21N; R50-53 | T; NR: 21-25-50/53S: (1/2-)25-36/37-45-60-61 | C ≥ 25 %: T, N; R21-25-50-533 % ≤C < 25 %: Xn, N; R22-50-530,0025 % ≤ C < 3 %: N; R50-530,00025 % ≤ C < 0,0025 %: N; R51-530,000025 % ≤ C < 0,00025 %: R52-53 | |
015-052-00-X | fenchlorphos (ISO)O,O-dimethyl O-2,4,5-trichlorophenyl phosphorothioate | | 206-082-6 | 299-84-3 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)25-36/37-60-61 | | |
015-055-00-6 | naled (ISO)1,2-dibromo-2,2-dichloroethyl dimethyl phosphate | | 206-098-3 | 300-76-5 | Xn; R21/22Xi; R36/38N; R50 | Xn; NR: 21/22-36/38-50S: (2-)36/37-61 | C ≥ 25 %: Xn, N; R21/22-36/38-5020 % ≤ C < 25 %: Xi, N; R36/38-500,025 % ≤ C < 20 %: N; R50 | |
015-063-00-X | dioxathion (ISO)1,4-dioxan-2,3-diyl-O,O,O',O'-tetraethyl di(phosphorodithioate) | | 201-107-7 | 78-34-2 | T+; R26/28T; R24N; R50-53 | T+; NR: 24-26/28-50/53S: (1/2-)28-36/37-45-60-61 | C ≥ 25 %: T+, N; R24-26/28-50-537 % ≤ C < 25 %:T+,N; R21-26/28-50-533 % ≤ C < 7 %:T, N; R21-23/25-50-531 % ≤ C < 3 %: T, N; R23/25-50-530,1 % ≤ C < 1 %: Xn, N; R20/22-50-530,025 % ≤ C < 0,1 %: N; R50-530,00025 % ≤ C < 0,0025 %: N; R51-530,00025 % ≤ C < 0,0025 %: R52-53 | |
015-065-00-0 | S-[2-(ethylsulphinyl)ethyl] O,O-dimethyl phosphorodithioate | | - | 2703-37-9 | T+; R26/27/28N; R51-53 | T+; NR: 26/27/28-51/53S: (1/2-)13-28-45-61 | | |
015-076-00-0 | potasanO,O-diethyl O-(4-methylcoumarin-7-yl) phosphorothioate | | - | 299-45-6 | T+; R26/27/28N; R50-53 | T+; NR: 26/27/28-50/53S: (1/2-)13-28-45-60-61 | C ≥ 7 %: T+, N; R26/27/28-50-531 % ≤ C < 7 %: T, N; R23/24/25-50-530,1 % ≤ C < 1 %: Xn, N; R20/21/22-50-530,025 % ≤ C < 0,1 %: N; R50-530,0025 % ≤ C < 0,025 %: N; R51-530,00025 % ≤ C < 0,0025 %: R52-53 | |
015-078-00-1 | demeton-S-methylsulphonS-2-ethylsulphonylethyl dimethyl phosphorothioate | | 241-109-5 | 17040-19-6 | T; R25Xn; R21N; R51-53 | T; NR: 21-25-51/53S: (1/2-)22-28-36/37-45-61 | | |
015-083-00-9 | bensulide (ISO)O,O-diisopropyl 2-phenylsulphonylaminoethyl phosphorodithioate | | 212-010-4 | 741-58-2 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)24-36-60-61 | | |
015-084-00-4 | chlorpyrifos (ISO)O,O-diethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate | | 220-864-4 | 2921-88-2 | T; R25N; R50-53 | T; NR: 25-50/53S: (1/2-)45-60-61 | C ≥ 25 %: T, N; R25-50-533 % ≤ C < 25 %: Xn, N; R22-50-530,0025 % ≤ C < 3 %: N; R50-530,00025 % ≤ C < 0,0025 %: N; R51-530,000025 % ≤ C < 0,00025 %: R52-53 | |
015-095-00-4 | methamidophos (ISO)O,S-dimethyl phosphoramidothioate | | 233-606-0 | 10265-92-6 | T+; R26/28T; R24N; R50 | T+; NR: 24-26/28-50S: (1/2-)28-36/37-45-61 | | |
015-096-00-X | oxydisulfoton; O O-diethyl S-[2-(ethylsulphinyl)ethyl]phosphorodithioate | | 219-679-1 | 2497-07-6 | T+; R28T; R24N; R50-53 | T+; NR: 24-28-50/53S: (1/2-)28-36/37-45-60-61 | C ≥ 25 %: T+, N; R24-28-50-537 % ≤ C < 25 %:T+, N; R21-28-50-533 % ≤ C < 7 %:T, N; R21-25-50-531 % ≤ C < 3 %: T, N; R25-50-530,25 % ≤ C < 1 %: Xn, N; R22-50-530,1 % ≤ C < 0,25 %:Xn, N; R22-51-530,025 % ≤ C < 0,1 %: R52-53 | |
015-097-00-5 | phenthoate (ISO)ethyl 2-(dimethoxyphosphinothioylthio)-2-phenylacetate | | 219-997-0 | 2597-03-7 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)22-36/37-60-61 | C ≥ 25 %: Xn, N; R21/22-50-530,25 % ≤ C < 25 %: N; R50-530,025 % ≤ C < 0,25 %: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
015-100-00-X | phoxim (ISO)α-(diethoxyphosphinothioylimino)phenylacetonitrile | | 238-887-3 | 14816-18-3 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)36-60-61 | C ≥ 25 %: Xn, N; R22-50-530,025 % ≤ C < 25 %: N; R50-530,0025 % ≤ C < 0,025 %: N; R51-530,00025 % ≤ C < 0,0025 %: R52-53 | |
015-101-00-5 | phosmet (ISO)O,O-dimethyl phthalimidomethyl S-phosphorodithioate | | 211-987-4 | 732-11-6 | Xn; R21/22N; R50-53 | Xn; NR: 21/22-50/53S: (2-)22-36/37-60-61 | C ≥ 25 %: Xn, N; R21/22-50-530,25 % ≤ C < 25 %: N; R50-530,025 % ≤ C < 0,25 %: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
015-105-00-7 | triphenyl phosphite | | 202-908-4 | 101-02-0 | Xi; R36/38N; R50-53 | Xi; NR: 36/38-50/53S: (2-)28-60-61 | C ≥ 25 %: Xi, N; R36/38-50/535 % ≤ C < 25 %: Xi, N; R36/38-51/532,5 % ≤ C < 5%:N; R51/530,25 % ≤ C < 2,5 %: R52/53 | |
015-107-00-8 | ethoprophos (ISO)ethyl-S,S-dipropylphosphorodithioate | | 236-152-1 | 13194-48-4 | T+; R26/27T; R25R43N; R50-53 | T+; NR: 25-26/27-43-50/53S:(1/2-)27/28-36/37/39-45-60-61 | | |
015-108-00-3 | bromophos (ISO)O-4-bromo-2,5-dichlorophenylO,O-dimethyl phosphorothioate | | 218-277-3 | 2104-96-3 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)36-60-61 | C ≥ 25 %: Xn, N; R22-50-530,25 % ≤ C < 25 %: N; R50-530,025 % ≤ C < 0,25: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
015-109-00-9 | crotoxyphos (ISO)1-phenylethyl 3-(dimethoxyphosphinyloxy) isocrotonate | | 231-720-5 | 7700-17-6 | T; R24/25N; R50-53 | T; NR: 24/25-50/53S: (1/2-)28-36/37-45-60-61 | C ≥ 25 %: T, N; R24/25-50-533 % ≤ C < 25 %: Xn, N; R21/22-50-532,5 % ≤ C < 3 %: N; R50-530,25 % ≤ C < 2,5 %: N; R51-530,025 % ≤ C < 0,25 %: R52-53 | |
015-110-00-4 | cyanofenphos (ISO)O-4-cyanophenyl O-ethyl phenylphosphonothioate | | - | 13067-93-1 | T; R25-39/25Xn; R21Xi; R36N; R51-53 | T; NR: 21-25-36-39/25-51/53S: (1/2-)36/37-45-61 | | |
015-114-00-6 | chlormephos (ISO)S-chloromethyl O,O-diethyl phosphorodithioate | | 246-538-1 | 24934-91-6 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)28-36/37-45-60-61 | | |
015-115-00-1 | chlorthiophos (ISO) | | 244-663-6 | 21923-23-9 | T+; R28T; R24N; R50-53 | T+; NR: 24-28-50/53S: (1/2-)28-36/37-45-60-61 | | |
015-122-00-X | O-6-ethoxy-2-ethylpyrimidin-4-ylO,O-dimethylphosphorothioateetrimfos | | 253-855-9 | 38260-54-7 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 | C ≥ 25 %: Xn, N; R22-50-532,5 % ≤ C < 25 %: N; R50-530,25 % ≤ C < 2,5 %: N; R51-530,025 % ≤ C < 0,25 %: R52-53 | |
015-123-00-5 | fenamiphos (ISO)ethyl-4-methylthio-m-tolylisopropyl phosphoramidate | | 244-848-1 | 22224-92-6 | T+; R28T; R24N; R50-53 | T+; NR: 24-28-50/53S: (1/2-)23-28-36/37-45-60-61 | C ≥ 25 %: T+, N; R24-28-50-537 % ≤ C < 25 %: T+, N; R21-28-50-533 % ≤ C < 7 %: T, N; R21-25-50-531 % ≤ C < 3 %: T, N; R25-50-530,25 % ≤ C < 1 %: Xn, N; R22-50-530,1 % ≤ C < 0,25 %: Xn, N; R22-51-530,025 % ≤ C < 0,25 %: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
015-126-00-1 | heptenophos (ISO)7-chlorobicyclo(3.2.0)hepta-2,6-dien-6-yl dimethyl phosphate | | 245-737-0 | 23560-59-0 | T; R25N; R50-53 | T; NR: 25-50/53S: (1/2-)23-28-37-45-60-61 | C ≥ 25 %: T, N; R25-50-533 % ≤ C < 25 %: Xn, N; R22-50-530,25 % ≤ C < 3 %: N; R50-530,025 % ≤ C < 0,25 %: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
015-127-00-7 | iprobenfosS-benzyl diisopropylphosphorothioate | | 247-449-0 | 26087-47-8 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 | | |
015-128-00-2 | IPSPS-ethylsulphinylmethyl O,O-diisopropylphosphorodithioate | | - | 5827-05-4 | T+; R27T; R25N; R50-53 | T+; NR: 25-27-50/53S: (1/2-)28-36/37-45-60-61 | C ≥ 25 %: T+, N; R25-27-50-537 % ≤ C < 25 %: T+, N; R22-27-50-533 % ≤ C < 7 %: T, N; R22-24-50-531 % ≤ C < 3 %: T, N; R24-50-530,25 % ≤ C < 1 %: Xn, N; R21-50-530,1 % ≤ C < 0,25 %: Xn, N; R21-51-530,025 % ≤ C < 0,1 %: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
015-129-00-8 | isofenphos (ISO)O-ethyl O-2-isopropoxycarbonylphenyl-isopropylphosphoramidothioate | | 246-814-1 | 25311-71-1 | T; R24/25N; R50-53 | T; NR: 24/25-50/53S: (1/2-)36/37-45-60-61 | C ≥ 25 %: T, N; R24/25-50-533 % ≤ C < 25 %: Xn, N; R21/22-50-530,25 % ≤ C < 3 %: N; R50-530,025 % ≤ C < 0,25: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
015-131-00-9 | isoxathion (ISO)O,O-diethyl O-5-phenylisoxazol-3-ylphosphorothioate | | 242-624-8 | 18854-01-8 | T; R24/25N; R50-53 | T; NR: 24/25-50/53S: (1/2-)28-36/37-45-60-61 | | |
015-132-00-4 | S-(chlorophenylthiomethyl) O,O-dimethylphosphorodithioatemethylcarbophenothione | | - | 953-17-3 | T; R24/25N; R50-53 | T;NR: 24/25-50/53S: (1/2-)28-36/37-45-60-61 | C ≥ 25 %: T, N; R24/25-50-533 % ≤ C < 25 %: Xn, N; R21/22-50-530,025 % ≤ C < 3 %: N; R50-530,0025 % ≤ C < 0,025 %: N; R51-530,00025 % ≤ C < 6,0025 %: R52-53 | |
015-133-00-X | piperophos (ISO)S-2-methylpiperidinocarbonylmethyl-O,O-dipropyl phosphorodithioate | | - | 24151-93-7 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 | C ≥ 25 %: Xn, N; R22-50-532,5 % ≤ C < 25 %: N; R50-530,25 % ≤ C < 2,5 %: N; R51-530,025 % ≤ C < 0,25 %: R52-53 | |
015-134-00-5 | pirimiphos-methyl (ISO)O-(2-diethylamino-6-methylpyrimidin-4-yl) O,O-dimethyl phosphorothioate | | 249-528-5 | 29232-93-7 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 | | |
015-135-00-0 | O-(4-bromo-2-chlorophenyl) O-ethylS-propyl phosphorothioateprofenofos (ISO) | | 255-255-2 | 41198-08-7 | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)36/37-60-61 | C ≥ 25 %: Xn, N; R20/21/22-50-530,025 % ≤ C < 25 %: N; R50-530,0025 % ≤ C < 0,025 %: N; R51-530,00025 % ≤ C < 0,0025 %: R52-53 | |
015-136-00-6 | trans-isopropyl-3-[[(ethylamino)methoxyfosfinothioyl]oxy]crotonate; isopropyl 3-[[(ethylamino)methoxyphosphinothioyl]oxy]isocrotonatepropetamphos (ISO) | | 250-517-2 | 31218-83-4 | T; R25N; R50-53 | T; NR: 25-50/53S: (1/2-)37-45-60-61 | C ≥ 25 %: T, N; R25-50-533 % ≤ C < 25 %: Xn, N; R22-50-530,25 % ≤ C < 3 %: N; R50-530,025 % ≤ C < 0,25 %: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
015-138-00-7 | quinalphos (ISO)O,O-diethyl-O-quinoxalin-2-ylphosphorothioate | | 237-031-6 | 13593-03-8 | T; R25Xn; R21N; R50-53 | T; NR: 21-25-50/53S: (1/2-)22-36/37-45-60-61 | C ≥ 25 %: T, N; R21-25-50-533 % ≤ C < 25 %: Xn, N; R22-50-530,025 % ≤ C < 3 %: N; R50-530,0025 % ≤ C < 0,025 %: N; R51-530,00025 % ≤ C < 0,0025 %: R52-53 | |
015-139-00-2 | S-tert-butylthiomethyl O,O-diethylphosphorodithioateterbufos (ISO) | | 235-963-8 | 13071-79-9 | T+; R27/28N; R50-53 | T+; NR: 27/28-50/53S: (1/2-)36/37-45-60-61 | C ≥ 7 %: T+, N; R27/28-50-531 % ≤ C < 7 %: T, N; R24/25-50-530,1 % ≤ C < 1 %: Xn, N; R21/22-50-530,025 % ≤ C < 0,1 %: N; R50-530,0025 % ≤ C < 0,025 %: N; R51-530,00025 % ≤ C < 0,0025 %: R52-53 | |
015-154-00-4 | 2-chloroethylphosphonic acid ethephon | | 240-718-3 | 16672-87-0 | Xn; R20/21C; R34R52-53 | CR: 20/21-34-52/53S: (1/2-)26-28-36/37/39-45-61 | C ≥ 25 %: C; R20/21-34-52/5310 % ≤ C < 25 %: C; R345 % ≤ C < 10 %: Xi; R36/37/38 | |
015-179-00-0 | UVCB condensation product of:tetrakishydroxymethylphosphonium chloride, urea and distilled hydrogenated C16-18 tallow alkylamine | | 422-720-8 | 166242-53-1 | Carc. Cat. 3; R40Xn; R22-48/22C; R34R43N; R50-53 | C; NR: 22-34-40-43-48/22-50/53S: (1/2-)26-36/37/39-45-60-61 | | |
016-001-00-4 | hydrogen sulphide | | 231-977-3 | 7783-06-4 | F+; R12T+; R26N; R50 | F+; T+; NR: 12-26-50S: (1/2-)9-16-36-38- 45-61 | | |
016-008-00-2 | ammonium polysulphides | | 232-989-1 | 9080-17-5 | R31C; R34N; R50 | C; NR: 31-34-50S: (1/2-)26-45-61 | C ≥ 25 %: C, N; R31-34-505 % ≤ C < 25 %: C; R31-341 % ≤ C < 5 %: Xi; R31-36/38 | |
016-012-00-4 | disulphur dichloridesulfur monochloride | | 233-036-2 | 10025-67-9 | R14T; R25Xn; R20R29C; R35N; R50 | T; C; NR: 14-20-25-29-35-50S: (1/2-)26-36/37/39-45-61 | C ≥ 25 %: T, C, N; R20-25-35-5010 % ≤ C < 25 %: C; R22-355 % ≤ C < 10 %: C; R22-343 % ≤ C < 5 %: Xn; R22-36/37/381 % ≤ C < 3 %: Xi; R36/37/38 | |
016-013-00-X | sulphur dichloride | | 234-129-0 | 10545-99-0 | R14C; R34Xi; R37N; R50 | C; NR: 14-34-37-50S: (1/2-)26-45-61 | C ≥ 25 %: C, N; R34-5010 % ≤ C < 25 %: C; R345 % ≤ C < 10 %: Xi; R36/37/38 | |
016-014-00-5 | sulphur tetrachloride | | - | 13451-08-6 | R14C; R34N; R50 | C; NR: 14-34-50S: (1/2-)26-45-61 | C ≥ 25 %: C, N; R34-5010 ≤ C < 25 %: C; R345 ≤ C < 10 %: Xi; R36/37/38 | |
016-021-00-3 | methanethiolmethyl mercaptan | | 200-822-1 | 74-93-1 | F+; R12T; R23N; R50-53 | F+; T; NR: 12-23-50/53S: (2-)16-25-60-61 | | |
016-023-00-4 | dimethyl sulphate | E | 201-058-1 | 77-78-1 | Carc. Cat. 2; R45Muta. Cat. 3; R68T+; R26T; R25C; R34R43 | T+R: 45-25-26-34-43-68S: 53-45 | C ≥ 25 %: T+; R45-R25-R26-R34-R43-R6810 % ≤ C < 25 %: T+; R45-R22-R26-R34-R43-R687 % ≤ C < 10 %: T+; R45-R22-R26-R36/37/38-R43-R685 % ≤ C < 7 %: T; R45-R22-R23-R36/37/38-R43-R683 % ≤ C < 5 %: T; R45-R22-R23-R43-R681 % ≤ C < 3 %: T; R45-R23-R43-R680,1 % ≤ C < 1 %: T; R45-R20-R680,01 % ≤ C < 0,1 %: T; R45-R68 | |
016-059-00-0 | N,N,N',N'-tetramethyldithiobis(ethylene)dia mine dihydrochloride | | 405-300-9 | 17339-60-5 | Xn; R22Xi; R36R43N; R50-53 | Xn; NR: 22-36-43-50/53S: (2-)26-36/37-60-61 | | |
017-003-00-8 | barium chlorate | | 236-760-7 | 13477-00-4 | O; R9Xn; R20/22N; R51-53 | O; Xn; NR: 9-20/22-51/53S: (2-) 13-27-61 | | |
017-004-00-3 | potassium chlorate | | 223-289-7 | 3811-04-9 | O; R9Xn; R20/22N; R51-53 | O; Xn; NR: 9-20/22-51/53S: (2-)13-16-27-61 | | |
017-005-00-9 | sodium chlorate | | 231-887-4 | 7775-09-9 | O; R9Xn; R22N; R51-53 | O; Xn; NR: 9-22-51/53S: (2-) 13-17-46-61 | | |
017-011-00-1 | sodium hypochlorite, solution ... % Cl active | B | 231-668-3 | 7681-52-9 | C; R34R31N; R50 | C; NR: 31-34-50S: (1/2-)28-45-50-61 | C ≥ 25 %: C, N; R31-34-5010 % ≤ C < 25 %: C; R31-345 % ≤ C < 10 %: Xi; R31-36/38 | |
017-012-00-7 | calcium hypochlorite | | 231-908-7 | 7778-54-3 | O; R8Xn; R22R31C; R34N; R50 | O; C; NR: 8-22-31-34-50S: (1/2-)26-36/37/39-45-61 | C ≥ 25 %: C, N; R22-34-5010 % ≤ C < 25 %: C; R343 % ≤ C < 10 %: Xi; R37/38-410,5 % ≤ C < 3 %: Xi; R36 | |
024-001-00-0 | chromium (VI) trioxide | E | 215-607-8 | 1333-82-0 | O; R9Carc. Cat. 1; R45Muta. Cat. 2; R46Repr. Cat. 3; R62T+; R26T; R24/25-48/23C; R35R42/43N; R50-53 | O; T+; NR: 45-46-9-24/25-26-35-42/43-48/23-62-50/53S: 53-45-60-61 | C ≥ 25 %: T+, N; R24/25-26-35-42/43-45-46-48/23-50/53-6210 % ≤ C < 25 %: T+, N; R21/22-26-35-42/43-45-46-48/23-51/53-627 % ≤ C< 10 %: T+, N; R21/22-26-34-42/43-45-46-48/20-51/53-625 % ≤ C < 7 %: T, N; R21/22-23-34-42/43-45-46-48/20-51/53-623 % ≤ C < 5 %: T,N; R21/22-23-36/37/38-42/43-45-46-48/20-51/532,5 % ≤ C < 3 %: T, N; R23-36/37/38-42/43-45-46-48/20-51/531 % ≤ C < 2,5 %: T; R23-36/37/38-42/43-45-46-48/20-52/530,25 % ≤ C < 1 %: T; R20-45-46-52/530,1 % ≤ C < 0,25 %: T; R20-45-46 | |
024-002-00-6 | potassium dichromate | E | 231-906-6 | 7778-50-9 | O; R8Carc. Cat. 2: R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23Xn; R21C; R34 R42/43N; 50-53 | T+; N; OR: 45-46-60-61-8-21-25-26-34-42/43-48/23-50/53S: 53-45-60-61 | C ≥ 25 %: T+, N; R45-46-60-61-21-25-26-34-42/43-48/23-50/5310 % ≤ C < 25 %: T+, N; R45-46-60-61-22-26-34-42/43-48/23-51/537 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-36/37/38-42/43-48/20-51/535 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-36/37/38-42/43-48/20-51/533 % ≤ C < 5 %: T, N; R45-46-60-61-22-23-42/43-48/20-51/532,5 % ≤ C < 3 %: T, N; R45-46-60-61-23-42/43-48/20-51/531 % ≤ C < 2,5 %: T; R45-46-60-61-23-42/43-48/20-52/530,5 % ≤ C < 1 %: T; R45-46- 60-61-20-42/43-52/530,25 % ≤ C < 0,5 %: T; R45-46-20-42/43-52/530,2 % ≤ C < 0,25 %: T; R45-46-20-42/430,1 % ≤ C < 0,2 %: T; R45-46-20 | 3 |
024-003-00-1 | ammonium dichromate | E | 232-143-1 | 7789-09-5 | E; R2O; R8Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23Xn; R21C; R34 R42/43N; R50-53 | E; T+; NR: 45-46-60-61-2-8-21-25-26-34-42/43-48/23-50/53S: 53-45-60-61 | C ≥ 25 %: T+, N; R45-46-60-61-21-25-26-34-42/43-48/23-50/5310 % ≤ C < 25 %: T+, N; R45-46-60-61-22-26-34-42/43-48/23-50/537 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-36/37/38-42/43-48/20-50/535 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-36/37/38-42/43-48/20-51/533 % ≤ C < 5 %: T, N; R45-46-60-61-22-23-42/43-48/20-51/532,5 % ≤ C < 3 %: T, N; R45-46-60-61-23-42/43-48/20-51/531 % ≤ C < 2,5 %: T; R45-46-60-61-23-42/43-48/20-52/530,5 % ≤ C < 1 %: T; R45-46-60-61-20-42/43-52/530,25 % ≤ C < 0,5 %: T; R45-46-20-42/43-52/530,2 % ≤ C < 0,25 %: T; R45-46-20-42/430,1 % ≤ C < 0,2 %: T; R45-46-20 | 3 |
024-004-00-7 | sodium dichromate anhydrate | E | 234-190-3 | 10588-01-9 | O; R8Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23Xn; R21C; R34R42/43N; 50-53 | T+; N; OR: 45-46-60-61-8-21-25-26-34-42/43-48/23-50/53S: 53-45-60-61 | C ≥ 25 %: T+, N; R45-46-60-61-21-25-26-34-42/43-48/23-50/5310 % ≤ C < 25 %: T+, N; R45-46-60-61-22-26-34-42/43-48/23-51/537 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-36/37/38-42/43-48/20-51/535 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-36/37/38-42/43-48/20-51/533 % ≤ C < 5 %: T, N; R45-46-60-61-22-23-42/43-48/20-51/532,5 % ≤ C < 3 %: T, N; R45-46-60-61-23-42/43-48/20-51/531 % ≤ C < 2,5 %: T; R45-46-60-61-23-42/43-48/20-52/530,5 % ≤ C < 1 %: T; R45-46-60-61-20-42/43-52/530,25 % ≤ C < 0,5 %: T; R45-46-20-42/43-52/530,2 % ≤ C < 0,25 %: T; R45-46-20-42/430,1 % ≤ C < 0,2 %: T; R45-46-20 | 3 |
024-004-01-4 | sodium dichromate, dihydrate | E | 234-190-3 | 7789-12-0 | O; R8Carc. Cat.2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23Xn; R21C; R34R42/43N; R50-53 | T+; N; OR: 45-46-60-61-8-21-25-26-34-42/43-48/23-50/53S: 53-45-60-61 | C ≥ 25 %: T+, N; R45-46-60-61-21-25-26-34-42/43-48/23-50/5310 % ≤ C < 25 %: T+, N; R45-46-60-61-22-26-34-42/43-48/23-51/537 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-36/37/38-42/43-48/20-51/535 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-36/37/38-42/43-48/20-51/533 % ≤ C < 5 %: T, N; R45-46-60-61-22-23-42/43-48/20-51/532,5 % ≤ C < 3 %: T, N; R45-46-60-61-23-42/43-48/20-51/531 % ≤ C < 2,5 %: T; R45-46-60-61-23-42/43-48/20-52/530,5 % ≤ C < 1 %: T; R45-46-60-61-20-42/43-52/530,25 % ≤ C < 0,5 %: T; R45-46-20-42/43-52/530,2 % ≤ C < 0,25 %: T; R45-46-20-42/430,1 % ≤ C < 0,2 %: T; R45-46-20 | 3 |
024-011-00-5 | ammonium bis(1-(3,5-dinitro-2-oxidophenylazo)-3-(N-phenylcarbamoyl)-2-naphtholato)chromate(1-) | | 400-110-2 | - | F; R11N; R50-53 | F; NR: 11-50/53S: (2-)33-60-61 | | |
024-018-00-3 | sodium chromate | E | 231-889-5 | 7775-11-3 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat.2; R60-61T+; R26T; R25-48/23Xn; R21 C; R34R42/43N; R50-53 | T+; NR: 45-46-60-61-21-25-26-34-42/43-48/23-50/53S: 53-45-60-61 | C ≥ 25 %: T+, N; R45-46-60-61-21-25-26-34-42/43-48/23-50/5310 % ≤ C < 25 %: T+, N; R45-46-60-61-22-26-34-42/43-48/23-51/537 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-36/37/38-42/43-48/20-51/535 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-36/37/38-42/43-48/20-51/533 % ≤ C < 5 %: T, N; R45-46-60-61-22-23-42/43-48/20-51/532,5 % ≤ C < 3 %: T, N; R45-46-60-61-23-42/43-48/20-51/531 % ≤ C < 2,5 %: T; R45-46-60-61-23-42/43-48/20-52/530,5 % ≤ C < 1 %: T; R45-46-60-61-20-42/43-52/530,25 % ≤ C < 0,5 %: T; R45-46-20-42/43-52/530,2 % ≤ C < 0,25 %: T; R45-46-20-42/430,1 % ≤ C < 0,2 %: T; R45-46-20 | 3 |
027-004-00-5 | cobalt dichloride | E | 231-589-4 | 7646-79-9 | Carc. Cat. 2; R49Xn; R22R42/43N; R50-53 | T; NR: 49-22-42/43-50/53S: (2-)22-53-45-60-61 | C ≥ 25 %: T, N; R49-22-42/43-50/532,5 % ≤ C < 25 %: T, N; R49-22-42/43-51/531 % ≤ C < 2,5 %: T; R49-42/43-52/530,25 % ≤ C < 1 %: T; R49-52/530,01 % ≤ C < 0,25 %: T; R49 | 1 |
027-005-00-0 | cobalt sulphate | E | 233-334-2 | 10124-43-3 | Carc. Cat. 2; R49Xn; R22R42/43N; R50-53 | T; NR: 49-22-42/43-50/53S: (2-)22-53-45-60-61 | C ≥ 25 %: T, N; R49-22-42/43-50/532,5 % ≤ C < 25 %: T, N; R49-42/43-51/531 % ≤ C < 2,5 %: T; R49-42/43-52/530,25 % ≤ C < 1 %: T; R49-52/530,01 % ≤ C < 0,25 %: T; R49 | 1 |
029-002-00-X | dicopper oxidecopper (I) oxide | | 215-270-7 | 1317-39-1 | Xn; R22N; 50-53 | Xn; NR: 22-50/53S: (2-)22-60-61 | | |
030-001-00-1 | zinc powder - zinc dust (pyrophoric) | | 231-175-3 | 7440-66-6 | F; R15-17N; R50-53 | F; NR: 15-17-50/53S: (2-)43-46-60-61 | | |
030-002-00-7 | zinc powder - zinc dust (stabilized) | | 231-175-3 | 7440-66-6 | N; R50-53 | NR: 50/53S: 60-61 | | |
030-003-00-2 | zinc chloride | | 231-592-0 | 7646-85-7 | Xn; R22C; R34N; R50-53 | C; NR: 22-34-50/53S: (1/2-)26-36/37/39-45-60-61 | C ≥ 25 %: C, N; R22-34-50/5310 % ≤ C < 25 %: C, N; R34-51/535 % ≤ C < 10 %: Xn, N; R36/37/38-51/532.5 % ≤ C < 5 %: N; R51/530.25 % ≤ C < 2.5 %: R52/53 | |
030-006-00-9 | zinc sulphate (hydrous) (mono-, hexa- and hepta hydrate)[1]zinc sulphate (anhydrous)[2] | | 231-793-3[1]231-793-3[2] | 7446-19-7 [1]7733-02-0 [2] | Xn; R22R41N; R50-53 | Xn; NR: 22-41-50/53S: (2-)22-26-39-46-60-61 | | |
033-001-00-X | arsenic | | 231-148-6 | 7440-38-2 | T; R23/25N; R50-53 | T; NR: 23/25-50/53S: (1/2-)20/21-28-45-60-61 | | |
033-002-00-5 | arsenic compounds, with the exception of those specified elsewhere in this Annex | A | - | - | T; R23/25N; R50-53 | T; NR: 23/25-50/53S: (1/2-)20/21-28-45-60-61 | C ≥ 25 %: T, N; R23/25-50/532,5 % ≤ C < 25 %: T, N; R23/25-51/530,25 % ≤ C < 2,5 %: T; R23/25-52/530,2 % ≤ C < 0,25 %: T; R23/250,1 % ≤ C < 0,2 %: Xn; R20/22 | 1 |
042-002-00-4 | tetrakis(dimethylditetradecylamm onium) hexa-µ-oxotetra-µ3-oxodi-µ5-oxotetradecaoxooctamolybdate(4-) | | 404-760-8 | 117342-25-3 | T; R23Xi; R41R53 | TR: 23-41-53S: (1/2-)26-37/39-45-61 | | |
048-001-00-5 | cadmium compounds, with the exception of cadmium sulphoselenide (xCdS.yCdSe), mixture of cadmium sulphide with zinc sulphide (xCdS.yZnS), mixture of cadmium sulphide with mercury sulphide (xCdS.yHgS), and those specified elsewhere in this Annex | A | - | - | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)60-61 | C ≥ 25 %: Xn, N; R20/21/22-50/532,5 % ≤ C < 25 %: Xn, N; R20/21/22-51/530,25 % ≤ C < 2,5 %: Xn; R20/21/22-52/530,1 % ≤ C < 0,25 %: Xn; R20/21/22 | 1 |
048-003-00-6 | cadmium diformatecadmiumformate | | 224-729-0 | 4464-23-7 | T; R23/25R33Xn; R68N; R50-53 | T; NR: 23/25-33-68-50/53S: (1/2-)22-45-60-61 | C ≥ 25 %: T, N; R23/25-33-50/53-6810 % ≤ C < 25 %: T, N; R23/25-33-51/53-682,5 % ≤ C < 10 %: Xn, N; R20/22-33-51/53-681 % ≤ C < 2,5 %: Xn; R20/22-33-52/53-680,1 % ≤ C < 1 %: Xn; R20/22-33-52/530,25 % ≤ C < 0,1 %: Xn; R20/22-33-52/53 | |
048-004-00-1 | cadmium cyanide | | 208-829-1 | 542-83-6 | T+; R26/27/28R32R33Xn; R68N; R50-53 | T+; NR: 26/27/28-32-33-68-50/53S: (1/2-)7-28-29-45-60-61 | C ≥ 25 %: T+, N; R26/27/28-32-33-50/53-687 % ≤ C < 25 %: T+, N; R26/27/28-32-33-51/53-682,5 % ≤ C < 7 %: T, N; R23/24/25-32-33-51/53-681 % ≤ C < 2,5 %: T; R23/24/25-32-33-52/53-680,25 % ≤ C < 1 %: Xn; R20/21/22-33-52/530,1 % ≤ C < 0,25 %: Xn; R20/21/22-33 | |
048-005-00-7 | cadmiumhexafluorosilicate(2-)cadmium fluorosilica | | 241-084-0 | 17010-21-8 | T; R23/25R33Xn; R68N; R50-53 | T; NR: 23/25-33-68-50/53S: (1/2-)22-45-60-61 | C ≥ 25 %: T, N; R23/25-33-50/53-6810 % ≤ C < 25 %: T, N; R23/25-33-51/53-682,5 % ≤ C< 10 %: Xn, N; R20/22-33-51/53-681 % ≤ C < 2,5 %: Xn; R20/22-33-52/53-680,25 % ≤ C < 1 %: Xn; R20/22-33-52/530,1 % ≤ C < 0,25 %: Xn; R20/22-33 | |
048-006-00-2 | cadmium fluoride | E | 232-222-0 | 7790-79-6 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23/25N; R50-53 | T+; NR: 45-46-60-61-25-26-48/23/25-50/53S: 53-45-60-61 | C ≥ 25 %:: T+, N; R45-46-60-61-25-26-48/23/25-50/5310 % ≤ C < 25 %: T+, N; R45-46-60-61-25-26-48/23/25-51/537 % ≤ C < 10 %: T+, N; R45-46-60-61-22-26-48/23/25-51/532,5 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-48/20/22-51/531 % ≤ C < 2,5 %: T; R45-46-60-61-22-23-48/20/22-52/530,5 % ≤ C < 1 %: T; R45-46-60-61-20/22-48/20/22-52/530,25 % ≤ C < 0,5 %: T; R45-46-20/22-48/20/22-52/530,1 % ≤ C < 0,25 %: T; R45-46-20/22-48/20/220,01 % ≤ C < 0,1 %: T; R45 | |
048-007-00-8 | cadmium iodide | | 232-223-6 | 7790-80-9 | T; R23/25R33Xn; R68N; R50-53 | T; NR: 23/25-33-68-50/53S: (1/2-)22-45-60-61 | C ≥ 25 %: T, N; R23/25-33-50/53-6810 % ≤ C < 25 %:T, N; R23/25-33-51/53-682,5 % ≤ C< 10 %: Xn, N; R20/22-33-51/53-681 % ≤ C < 2,5 %: Xn; R20/22-33-52/53-680,25 % ≤ C < 1 %: Xn; R20/22-33-52/530,1 % ≤ C < 0,25 %: Xn; R20/22-33 | |
048-008-00-3 | cadmium chloride | E | 233-296-7 | 10108-64-2 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T+; R26T; R25-48/23/25N; R50-53 | T+; NR: 45-46-60-61-25-26-48/23/25-50/53S: 53-45-60-61 | C ≥ 25 %: T+, N; R45-46-60-61-25-26-48/23/25-50/5310 % ≤ C < 25 %: T+,N; R45-46-60-61-25-26-48/23/25-51/537 % ≤ C < 10 %: T+,N; R45-46-60-61-22-26-48/23/25-51/532,5 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-48/20/22-51/531 % ≤ C < 2,5 %: T; R45-46-60-61-22-23-48/20/22-52/530,5 % ≤ C < 1 %: T; R45-46-60-61-20/22-48/20/22-52/530,25 % ≤ C < 0,5 %: T; R45-46-20/22-48/20/22-52/530,1 % ≤ C < 0,25 %: T; R45-46-20/22-48/20/220,01 % ≤ C < 0,1 %: T; R45 | |
048-009-00-9 | cadmium sulphate | E | 233-331-6 | 10124-36-4 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61T; R48/23/25T+; R26T; R25N; R50-53 | T+; NR: 45-46-60-61-25-26-48/23/25-50/53S: 53-45-60-61 | C ≥ 25 %: T+, N; R45-46-60-61-25-26-48/23/25-50/5310 % ≤ C < 25 %: T+, N; R45-46-60-61-25-26-48/23/25-51/537 % ≤ C< 10%:T+,N; R45-46-60-61-22-26-48/23/25-51/532,5 % ≤ C < 7 %: T, N; R45-46-60-61-22-23-48/20/22-51/531 % ≤ C < 2,5 %: T; R45-46-60-61-22-23-48/20/22-52/530,5 % ≤ C < 1 %: T; R45-46-60-61-20/22-48/20/22-52/530,25 % ≤ C < 0,5 %: T; R45-46-20/22-48/20/22-52/530,1 % ≤ C < 0,25 %: T; R45-46-20/22-48/20/220,01 % ≤ C < 0,1 %: T; R45 | |
048-010-00-4 | cadmium sulphide | E | 215-147-8 | 1306-23-6 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repp. Cat. 3; R62-63T; R48/23/25Xn; R22R53 | T; NR: 45-22-48/23/25-62-63-68-53S: 53-45-61 | C ≥ 25 %: T; R45-22-48/23/25-62-63-68-5310 % ≤ C < 25 %: T; R45-22-48/23/25-62-63-685 % ≤ C < 10 %: T; R45-48/20/22-62-63-681 % ≤ C < 5 %: T; R45-48/20/22-680,1 % ≤ C < 1 %: T; R45-48/20/22 | 1 |
050-001-00-5 | tin tetrachloridestannic chloride | | 231-588-9 | 7646-78-8 | C; R34R52-53 | CR: 34-52/53S: (1/2-)7/8-26-45-61 | C ≥ 25 %: C; R34-52/5310 % ≤ C < 25 %: C; R345 % ≤ C < 10 %: Xi; R36/37/38 | |
050-005-00-7 | trimethyltin compounds, with the exception of those specified elsewhere in this Annex | A | - | - | T+; R26/27/28N; R50-53 | T+; NR: 26/27/28-50/53S: (1/2-)26-27-28-45-60-61 | C ≥ 25 %: T+, N; R26/27/28-50/532,5 % ≤ C < 25 %: T+, N; R26/27/28-51/530,5 % ≤ C < 2,5 %: T+; R26/27/28-52/530,25 % ≤ C < 0,5 %: T; R23/24/25-52/530,1 % ≤ C < 0,25 %: T; R23/24/250,05 % ≤ C < 0,1 %: Xn; R20/21/22 | 1 |
050-006-00-2 | triethyltin compounds, with the exception of those specified elsewhere in this Annex | A | - | - | T+; R26/27/28N; R50-53 | T+; NR: 26/27/28-50/53S: (1/2-)26-27-28-45-60-61 | C ≥ 25 %: T+, N; R26/27/28-50/532,5 % ≤ C < 25 %: T+, N; R26/27/28-51/530,5 % ≤ C < 2,5 %: T+; R26/27/28-52/530,25 % ≤ C < 0,5 %: T; R23/24/25-52/530,1 % ≤ C < 0,25 %: T; R23/24/250,05 % ≤ C < 0,1 %: Xn; R20/21/22 | 1 |
050-007-00-8 | tripropyltin compounds, with the exception of those specified elsewhere in this Annex | A | - | - | T; R23/24/25N; R50-53 | T; NR: 23/24/25-50/53S: (1/2-)26-27-28-45-60-61 | C ≥ 25 %: T, N; R23/24/25-50/532,5 % ≤ C < 25 %: T, N; R23/24/25-51/530,5 % ≤ C < 2,5 %: T; R23/24/25-52/530,25 % ≤ C < 0,5 %: Xn; R20/21/22-52/530,1 % ≤C < 0,25 %: Xn; R20/21/22 | 1 |
050-008-00-3 | tributyltin compounds, with the exception of those specified elsewhere in this Annex | A | - | - | T; R25-48/23/25Xn; R21Xi; R36/38N; R50-53 | T; NR: 21-25-36/38-48/23/25-50/53S: (1/2-)35-36/37/39-45-60-61 | C ≥ 25 %: T, N; R21-25-36/38-48/23/25-50/532,5 % ≤ C < 25 %: T, N; R21-25-36/38-48/23/25-51/531 % ≤ C < 2,5 %: T; R21-25-36/38-48/23/25-52/530,25 % ≤ C < 1 %: Xn; R22-48/20/22-52/53 | 1 |
050-009-00-9 | fluorotripentylstannane[1]hexapentyldistannoxane[2] | | 243-546-7[1]247-143-7[2] | 20153-49-5[1]25637-27-8[2] | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)26-28-60-61 | C ≥ 25 %: Xn, N; R20/21/22-50/532,5 % ≤ C < 25 %: Xn, N; R20/21/22-51/531 % ≤ C < 2,5 %: Xn; R20/21/22-52/530,25 %≤ C < 1 %: R52/53 | 1 |
050-010-00-4 | fluorotrihexylstannane | | 243-547-2 | 20153-50-8 | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)26-28-60-61 | C ≥ 25 %: Xn, N; R20/21/22-50/532,5 % ≤ C < 25 %: Xn, N; R20/21/22-51/531 % ≤ C < 2,5 %: Xn; R20/21/22-52/530,25 % ≤ C < 1 %: R52/53 | 1 |
050-011-00-X | triphenyltin compounds, with the exception of those specified elsewhere in this Annex | A | - | - | T; R23/24/25N; R50-53 | T; NR: 23/24/25-50/53S: (1/2-)26-27-28-45-60-61 | C ≥ 25 %: T, N; R23/24/25-50/532,5 % ≤ C < 25 %: T, N; R23/24/25-51/531 % ≤ C < 2,5 %:T; R23/24/25-52/530,25 % ≤ C < 1 %: Xn; R20/21/22-52/53 | 1 |
050-012-00-5 | tetracyclohexylstannane[1]chlorotricyclohexylstannane[2]butyltricyclohexylstannane[3] | A | 215-910-5[1]221-437-5[2]230-358-5[3] | 1449-55-4 [1]3091-32-5 [2]7067-44-9 [3] | Xn; R20/21/22N; R50-53 | Xn; NR: 20/21/22-50/53S: (2-)26-28-60-61 | C ≥ 25 %: Xn, N; R20/21/22-50/532,5 % ≤ C < 25 %: Xn, N; R20/21/22-51/531 % ≤ C < 2,5 %: Xn; R20/21/22-52/530,25 % ≤ C < 1 %: R52/53 | 1 |
050-013-00-0 | trioctyltin compounds, with the exception of those specified elsewhere in this Annex | A | - | - | Xi; R36/37/38R53 | XiR: 36/37/38-53S: (2-)61 | C ≥ 25 %: Xi; R36/37/38-531 % ≤ C < 25 %: Xi; R36/37/38 | 1 |
051-002-00-3 | antimony pentachloride | | 231-601-8 | 7647-18-9 | C; R34N; R51-53 | C; NR: 34-51/53S: (1/2-)26-45-61 | C ≥ 25 %: C, N; R34-51/5310 % ≤ C < 25 %: C; R34-52/535 % ≤ C < 10 %: Xi; R36/37/38-52/532,5 % ≤ C < 5 %: R52/53 | |
051-003-00-9 | antimony compounds, with the exception of the tetroxide (Sb2O4), pentoxide (Sb2O5), trisulphide (Sb2S3), pentasulphide (Sb2S5) and those specified elsewhere in this Annex | A | - | - | Xn; R20/22N; R51-53 | Xn; NR: 20/22-51/53S: (2-)61 | C ≥ 25 %: Xn, N; R20/22-51/532,5 % ≤ C < 25 %: Xn; R20/22-52/530,25 % ≤ C < 2,5 %: Xn; R20/22 | 1 |
080-002-00-6 | inorganic compounds of mercury with the exception of mercuric sulphide and those specified elsewhere in this Annex | A | - | - | T+; R26/27/28R33N; R50-53 | T+; NR: 26/27/28-33-50/53S: (1/2-)13-28-45-60-61 | C ≥ 25 %: T+, N; R26/27/28-33-50/532,5 % ≤ C < 25 %: T+, N; R26/27/28-33-51/532 % ≤ C < 2,5 %: T+; R26/27/28-33-52/530,5 % ≤ C < 2 %: T; R23/24/25-33-52/530,25 % ≤ C < 0,5 %: Xn; R20/21/22-33-52/530,1 %≤ C < 0,25 %: Xn; R20/21/22-33 | 1 |
080-004-00-7 | organic compounds of mercury with the exception of those specified elsewhere in this Annex | A | - | - | T+; R26/27/28R33N; R50-53 | T+; NR: 26/27/28-33-50/53S: (1/2-)13-28-36-45-60-61 | C ≥ 25 %: T+, N; R26/27/28-33-50/532,5 % ≤ C < 25 %: T+, N; R26/27/28-33-51/531 % ≤ C < 2,5 %: T+; R26/27/28-33-52/530,5 % ≤ C < 1 %: T; R23/24/25-33-52/530,25 % ≤ C < 0,5 %: Xn; R20/21/22-33-52/530,05 % ≤ C < 0,25 %: Xn;: R20/21/22-33 | 1 |
080-007-00-3 | dimethylmercury[1]diethylmercury[2] | | 209-805-3[1]211-000-7[2] | 593-74-8 [1]627-44-1 [2] | T+; R26/27/28R33N; R50-53 | T+; NR: 26/27/28-33-50/53S: (1/2-)13-28-36-45-60-61 | C ≥ 25 %: T+, N; R26/27/28-33-50/532,5 % ≤ C < 25 %: T+, N; R26/27/28-33-51/530,5 % ≤ C < 2,5 %: T+; R26/27/28-33-52/530,25 % ≤ C < 0,5 %: T; R23/24/25-33-52/530,1 % ≤ C < 0,25 %: T; R23/24/25-330,05 % ≤ C < 0,1 %: Xn; R20/21/22-33 | 1 |
082-001-00-6 | lead compounds with the exception of those specified elsewhere in this Annex | AE | - | - | Repr. Cat. 1; R61Repr. Cat. 3; R62Xn; R20/22R33N; R50-53 | T; NR: 61-20/22-33-62-50/53S: 53-45-60-61 | C ≥ 25 %: T, N; R61-20/22-33-62-50/535 % ≤ C < 25 %:T, N; R61-20/22-33-62-51/532,5 % ≤ C < 5 %:T, N; R61-20/22-33-62-51/531 % ≤ C < 2,5 %:T; R61-20/22-33-52/530,5 % ≤ C < 1 %:T; R61-33-52/530,25 % ≤ C < 0,5 %: R52/53 | 1 |
082-002-00-1 | lead alkyls | AE | - | - | Repr. Cat. 1; R61Repr. Cat. 3; R62T+; R26/27/28R33N; R50-53 | T+; NR: 61-26/27/28-33-62-50/53S: 53-45-60-61 | C ≥ 25 %: T+,N; R61-26/27/28-33-62-50/535 % ≤ C < 25 %:T+, N; R61-26/27/28-33-62-51/532,5 % ≤ C < 5 %: T+, N; R61-26/27/28-33-51/530,5 % ≤ C < 2,5 %: T+; R61-26/27/28-33-52/530,25 % ≤ C < 0,5 %: T; R61-26/27/28-33-52/530,1 % ≤ C < 0,25 %: T; R61-23/24/25-330,05 % ≤ C < 0,1 %: Xn; R20/21/22-33 | 1 |
601-010-00-3 | ethylene | | 200-815-3 | 74-85-1 | F+; R12R67 | F+R: 12-67S: (2-)9-16-33-46 | | |
601-014-00-5 | isoprene (stabilized)2-methyl-1,3 -butadiene | D | 201-143-3 | 78-79-5 | F+; R12Car. Cat. 2; R45Muta. Cat. 3; R68R52-53 | F+; TR: 45-12-68-52/53S: 53-45-61 | | |
601-017-00-1 | cyclohexane | | 203-806-2 | 110-82-7 | F; R11Xn; R65Xi; R38R67N; R50-53 | F; Xn; NR: 11-38-65-67-50/53S: (2-)9-16-25-33-60-61-62 | | 4 6 |
601-020-00-8 | benzene | E | 200-753-7 | 71-43-2 | F; R11Carc Cat. 1; R45Muta. Cat. 2; R46T; R48/23/24/25Xn; R65Xi; R36/38 | F; TR: 45-46-11-36/38-48/23/24/25-65S: 53-45 | | |
601-021-00-3 | toluene | | 203-625-9 | 108-88-3 | F; R11Repr. Cat.3; R63Xn; R48/20-65Xi; R38R67 | F; XnR: 11-38-48/20-63-65-67S: (2-)36/37-62-46 | | 4,6 |
601-025-00-5 | mesitylene1,3,5-trimethylbenzene | | 203-604-4 | 108-67-8 | R 10Xi; R37N; R51-53 | Xi; NR: 10-37-51/53S: (2-)61 | C ≥ 25 %: Xi, N; R37-51/532,5 % ≤ C < 25 %: R52/53 | |
601-027-00-6 | 2-phenylpropeneα-methylstryene | | 202-705-0 | 98-83-9 | R10Xi; R36/37N; R51-53 | Xi; NR: 10-36/37-51/53S: (2-)61 | C ≥ 25 %: Xi, N; R36/37-51/532,5 % ≤ C < 25 %: R52/53 | |
601-028-00-1 | 2-methylstyrene2-vinyltoluene | | 210-256-7 | 611-15-4 | Xn; R20N; R51-53 | Xn; NR: 20-51/53S: (2-)24-61 | C ≥ 25%:Xn, N; R20-51/532,5 % ≤ C < 25 %: R52/53 | |
601-032-00-3 | benzo[a]pyrenebenzo[def ]chrysene | | 200-028-5 | 50-32-8 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 2; R60-61R43N; R50-53 | T; NR: 45-46-60-61-43-50/53S: 53-45-60-61 | C ≥ 25 %: T, N; R43-45-46-50-53-60-612,5 % ≤ C ≤ 25 %: T, N; R43-45-46-51-53-60-611 % ≤ C ≤ 2,5 %: T; R43-45-46-52-53-60-610,5 % ≤ C < 1 %: T; R45-46-52-53-60-610,25 % ≤ C < 0,5 %: T; R45-46-52-530,1 % ≤ C < 0,25 %: T; R45-460,01 % ≤ C < 0,1 %: T; R45 | |
601-037-00-0 | n-hexane | | 203-777-6 | 110-54-3 | F; R11Repr. Cat. 3; R62Xn; R65-48/20Xi; R38R67N; R51-53 | F; Xn; NR: 11-38-48/20-62-65-67-51/53S: (2-)9-16-29-33-36/37-61-62 | C ≥ 25 %: Xn, N; R38-48/20-62-51/5320 % ≤ C < 25 %: Xn; R38-48/20-62-52/535 % ≤ C < 20 %: Xn; R48/20-62-52/532,5 % ≤ C < 5 %: R52/53 | 4 6 |
601-041-00-2 | dibenz[a,h]anthracene | | 200-181-8 | 53-70-3 | Carc. Cat. 2; R45N; R50-53 | T; NR: 45-50/53S: 53-45-60-61 | C ≥ 25 %: T, N; R45-50/532,5 % ≤ C < 25 %; T, N; R45-51/530,25 % ≤ C < 2,5 %: T; R45-52/530,01 % ≤ C < 0,25 %: T; R45 | |
601-048-00-0 | chrysene | | 205-923-4 | 218-01-9 | Carc. Cat. 2; R45Muta. Cat. 3; R68N; R50-53 | T; NR: 45-68-50/53S: 53-45-60-61 | | |
601-052-00-2 | naphthalene | | 202-049-5 | 91-20-3 | Carc. Cat.3; R40Xn; R22N; R50-53 | Xn; NR: 22-40-50/53S: (2-)36/37-46-60-61 | | |
601-053-00-8 | nonylphenol[1]4-nonylphenol, branched[2] | | 246-672-0[1]284-325-5[2] | 25154-52-3[1]84852-15-3[2] | Repr. Cat.3; R62Repr. Cat.3; R63Xn; R22C; R34N; R50-53 | C; NR: 22-34-62-63-50/53S: (1/2-)26-36/37/39-45-46-60-61 | | |
602-003-00-8 | dibromomethane | | 200-824-2 | 74-95-3 | Xn; R20R52-53 | XnR: 20-52/53S: (2-)24-61 | C ≥ 25 %: Xn; R20-52/5312,5 % ≤C < 25 %: Xn; R20 | |
602-008-00-5 | carbon tetrachloridetetrachloromethane | | 200-262-8 | 56-23-5 | Carc. Cat. 3; R40T; R23/24/25-48/23R52-53N; R59 | T; NR: 23/24/25-40-48/23-59-52/53S: (1/2-)23-36/37-45-59-61 | C ≥ 25 %: T, N; R23/24/25-40-48/23-52/53-591 % ≤ C < 25 %: T, N; R23/24/25-40-48/23-590,2 % ≤ C < 1 %: Xn, N; R20/21/22-48/20-590,1 % ≤ C < 0,2 %: N; R59 | |
602-010-00-6 | 1,2-dibromoethane | E | 203-444-5 | 106-93-4 | Carc. Cat. 2; R45T; R23/24/25Xi; R36/37/38N; R51-53 | T; NR: 45-23/24/25-36/37/38-51/53S: 53-45-61 | C ≥ 25 %: T, N; R45-23/24/25-36/37/38-51/5320 % ≤ C < 25 %: T, N; R45-23/24/25-36/37/38-52/532,5 % ≤ C < 20 %: T, N; R45-23/24/25-52/531 % ≤ C < 2,5 %: T; R45-23/24/250,1 % ≤ C < 1 %: T; R45-20/21/22 | |
602-011-00-1 | 1,1-dichloroethane | | 200-863-5 | 75-34-3 | F; R11Xn; R22Xi; R36/37R52-53 | F; XnR: 11-22-36/37-52/53S: (2-)16-23-61 | C ≥ 25 %: Xn; R22-36/37-52/5320 % ≤ C < 25 %: Xn; R22-36/3712,5 % ≤ C < 20 %: Xn; R22 | |
602-014-00-8 | 1,1,2-trichloroethane | | 201-166-9 | 79-00-5 | Carc. Cat.3; R40Xn; R20/21/22R66 | XnR: 20/21/22-40-66S: (2-)9-36/37-46 | C ≥ 5 %: Xn; R20/21/22 | |
602-015-00-3 | 1,1,2,2-tetrachloroethane | | 201-197-8 | 79-34-5 | T+; R26/27N; R51-53 | T+; NR: 26/27-51/53S: (1/2-)38-45-61 | C ≥ 25 %: T+, N; R26/27-51/537 % ≤ C < 25 %: T+; R26/27-52/532,5 % ≤ C < 7 %: T; R23/24-52/531 % ≤ C < 2,5 %: T; R23/240,1 % ≤ C < 1 %: Xn; R20/21 | |
602-016-00-9 | 1,1,2,2-tetrabromoethane | | 201-191-5 | 79-27-6 | T+; R26Xi; R36R52-53 | T+R: 26-36-52/53S: (1/2-)24-27-45-61 | C ≥ 25 %: T+; R26-36-52/5320 % ≤ C < 25 %: T+; R26-367 % ≤ C < 20 %: T+; R261 % ≤ C < < 7 %: T; R230,1 % ≤ C < 1 %: Xn; R20 | |
602-017-00-4 | pentachloroethane | | 200-925-1 | 76-01-7 | Carc. Cat. 3; R40T; R48/23N; R51-53 | T; NR: 40-48/23-51/53S: (1/2-)23-36/37-45-61 | C ≥ 25 %: T, N; R40-48/23-51/532,5 % ≤ C < 25 %: T; R40-48/23-52/531 % ≤ C < 2,5 %: T; R40-48/230,2 % ≤ C < 1 %: Xn; R48/20 | |
602-019-00-5 | 1-bromopropanen-propyl bromide | | 203-445-0 | 106-94-5 | F; R11Rep. Cat. 2; R60Rep. Cat. 3; R63Xn; R48/20Xi; R36/37/38R67 | T; FR: 60-11-36/37/3 8-48/20-63-67S: 53-45 | | |
602-025-00-8 | 1,1 -dichloroethylenevinylidene chloride | D | 200-864-0 | 75-35-4 | F; R12Carc. Cat.3; R40Xn; R20 | F+; XnR: 12-20-40S: (2-)7-16-29-36/37-46 | C ≥ 12,5%: Xn; R20-401 % ≤ C < 12,5%: Xn; R40 | |
602-026-00-3 | 1,2-dichloroethylene[1]cis-dichloroethylene[2]trans-dichloroethylene[3] | C | 208-750-2[1]205-859-7[2]205-860-2[3] | 540-59-0 [1]156-59-2 [2]156-60-5 [3] | F; R11Xn; R20R52-53 | F; XnR: 11-20-52/53S: (2-)7-16-29-61 | C ≥ 25 %: Xn; R20-52/5312,5 % ≤ C < 25 %: Xn; R20 | |
602-029-00-X | 3-chloropropeneallyl chloride | D | 203-457-6 | 107-05-1 | F; R11Carc. Cat.3; R40Muta. Cat.3; R68Xn; R20/21/2248/20Xi; R36/37/38N; R50 | F; Xn; NR: 11-20/21/22-36/37/38-40-48/20-68-50S: (2-)16-25-26-36/37-46-61 | | |
602-033-00-1 | chlorobenzene | | 203-628-5 | 108-90-7 | R10Xn; R20N; R51-53 | Xn; NR: 10-20-51/53S: (2-)24/25-61 | C ≥ 25%:Xn,N;R20-51/535 % ≤ C < 25 %: Xn, N; R20-52/532,5 % ≤ C < 5 %: R52/53 | |
602-034-00-7 | 1,2-dichlorobenzeneo-dichlorobenzene | | 202-425-9 | 95-50-1 | Xn; R22Xi; R36/37/38N; R50-53 | Xn; NR: 22-36/37/38-50/53S: (2-)23-60-61 | C ≥ 25 %: Xn, N; R22-36/37/38-50/5320 % ≤ C < 25 %: Xn, N; R22-36/37/38-51/535 % ≤ C < 20 %: Xn, N; R22-51/532,5 % ≤ C < 5 %:N; R51/530,25 % ≤ C < 2,5 %: R52/53 | |
602-035-00-2 | 1,4-dichlorobenzenep-dichlorobenzene | | 203-400-5 | 106-46-7 | Xi; R36Carc. Cat. 3; R40N; R50-53 | Xn; NR: 36-40-50/53S: (2-)36/37-46-60-61 | | |
602-036-00-8 | chloroprene (stabilized)2-chlorobuta-1,3-diene | D E | 204-818-0 | 126-99-8 | F; R11Carc. Cat. 2; R45Xn; R20/22-48/20Xi; R36/37/38 | F; TR: 45-11-20/22-36/37/38-48/20S: 53-45 | | |
602-039-00-4 | polychlorobiphenylsPCB | C | 215-648-1 | 1336-36-3 | R33N; R50-53 | Xn; NR: 33-50/53S: (2-)35-60-61 | C ≥ 25 %: Xn, N; R33-50/532,5 % ≤ C < 25 %: Xn, N; R33-51/530,25 % ≤ C < 2,5 %: Xn, N; R33-52/530,005 % ≤ C < 0,25 %: Xn; R33 | |
602-043-00-6 | γ-HCH or γ-BHCγ-1,2,3,4,5,6-hexachlorocyclohexanelindane | | 200-401-2 | 58-89-9 | T; R25Xn; R20/21-48/22R64N; R50-53 | T; NR: 20/21-25-48/22-64-50/53S: (1/2-)36/37-45-60-61 | C ≥ 25 %: T,N;R20/21-25-48/22-64-50-5310 % ≤ C < 25 %: Xn, N; R22-48/22-64-50-533 % ≤ C < 10 %: Xn, N; R22-64-50-532,5 % ≤ C < 3 %: N; R64-50-531 % ≤ C < 2,5 %: N; R64-51-530,25 % ≤ C < 1 %:N;R51-530,025 % ≤ C < 0,25 %: R52-53 | |
602-062-00-X | 1,2,3-trichloropropane | D | 202-486-1 | 96-18-4 | Carc. Cat, 2; R45Repr. Cat. 2; R60Xn; R20/21/22 | TR: 45-60-20/21/22S: 53-45 | | |
602-073-00-X | 1,4-dichlorobut-2-ene | E | 212-121-8 | 764-41-0 | Carc. Cat. 2; R45T+; R26T; R24/25C; R34N; R50-53 | T+; NR: 45-24/25-26-34-50/53S: 53-45-60-61 | C ≥ 25 %: T+, N; R45-24/25-26-34-50/5310 % ≤ C < 25 %: T+, N; R45-21/22-26-34-51/537 % ≤ C < 10 %: T+, N; R45-21/22-26-36/37/38-51/535 % ≤ C < 7 %:T, N; R45-21/22-23-36/37/38-51/533 % ≤ C < 5 %:T, N; R45-21/22-23-51/532,5 % ≤ C < 3 %: T, N; R45-23-51/531 % ≤ C < 2,5 %: T; R45-23-52/530,25 % ≤ C < 1 %: T; R45-20-52/530,1 % ≤ C < 0,25 %: T; R45-200,01 % ≤ C < 0,1 %: T; R45 | |
603-006-00-7 | pentanol isomers, with the exception fo those specified elsewhere in this Annex | C | 250-378-8 | 30899-19-5 | R10Xn; R20Xi; R37R66 | XnR: 10-20-37-66S: (2-)46 | | |
603-007-00-2 | 2-methylbutan-2-ol tert-pentanol | | 200-908-9 | 75-85-4 | F; R11Xn; R20Xi; R37/38 | F; XnR: 11-20-37/38S: (2-)46 | | |
603-029-00-2 | bis(2-chloroethyl) ether | | 203-870-1 | 111-44-4 | R10Carc. Cat.3; R40T+; R26/27/28 | T+R: 10-26/27/28-40S: (1/2-)7/9-27-28-36/37-45 | C ≥ 7 %: T+; R26/27/28-401 % ≤ C < 7 %: T; R23/24/25-400,1 % ≤ C < 1 %: Xn; R20/21/22 | |
603-030-00-8 | 2-aminoethanolethanolamine | | 205-483-3 | 141-43-5 | Xn; R20/21/22C; R34 | CR: 20/21/22-34S: (1/2-)26-36/37/39-45 | C ≥ 25 %: C; R20/21/22-3410 % ≤ C < 25 %: C; R345 % ≤ C < 10 %: Xi; R36/37/38 | |
603-031-00-3 | 1,2-dimethoxyethaneethylene glycol dimethyl etherEGDME | | 203-794-9 | 110-71-4 | Repr. Cat.2; R60Repr. Cat.2; R61F; R11R19Xn; R20 | F; TR: 60-61-11-19-20S: 53-45 | | |
603-054-00-9 | di-n-butyl etherdibutyl ether | | 205-575-3 | 142-96-1 | R10Xi; R36/37/38R52-53 | XiR: 10-36/37/38-52/53S: (2-)61 | C ≥ 10 %:Xi; R36/37/38 | |
603-063-00-8 | 2,3-epoxypropan-1-olglycidoloxiranemethanol | E | 209-128-3 | 556-52-5 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 2; R60T; R23Xn; R21/22Xi; R36/37/38 | TR: 45-60-21/22-23-36/37/38-68S: 53-45 | | |
603-066-00-4 | 1,2-epoxy-4-epoxyethylcyclohexanevinylcyclohexane diepoxide | | 203-437-7 | 106-87-6 | T; R23/24/25Xn; R68 | TR: 23/24/25-68S: (1/2-)23-24-45 | C ≥ 1 %: T; R23/24/25-680,1 % ≤ C < 1 %: Xn; R20/21/22 | |
603-067-00-X | phenyl glycidyl ether2,3-epoxypropyl phenyl ether1,2-epoxy-3-phenoxypropane | E | 204-557-2 | 122-60-1 | Carc. Cat. 2; R45Muta. Cat. 3; R68Xn; R20Xi; R37/38R43R52-53 | TR: 45-20-37/38-43-68-52/53S: 53-45-61 | | |
603-070-00-6 | 2-amino-2-methylpropanol | | 204-709-8 | 124-68-5 | Xi; R36/38R52-53 | XiR: 36/38-52/53S: (2-)61 | C ≥ 25 %: Xi; R36/38-52/5310 % ≤ C < 25 %: Xi; R36/38 | |
603-074-00-8 | reaction product: bisphenol-A-(epichlorhydrin)epoxy resin (number average molecular weight ≤ 700) | | 500-033-5 | 25068-38-6 | Xi; R36/38R43N; R51-53 | Xi; NR: 36/38-43-51/53S: (2-)28-37/39-61 | C ≥ 25 %: Xi, N; R36/38-43-51/535 % ≤ C < 25 %: Xi; R36/38-43-52/532,5%≤C < 5%:Xi;R43-52/531 % ≤ C < 2,5 %: Xi; R43 | |
603-076-00-9 | but-2-yne-1,4-diol2-butyne-1,4-diol | D | 203-788-6 | 110-65-6 | C; R34T; R23/25Xn; R21-48/22R43 | C; TR: 21-23/25-34-43-48/22S: (1/2-)25-26-36/37/39-45-46 | C ≥ 50 %: T, C; R21-23/25-34-48/22-4325%≤C < 50%:T;R21-23/25-36/38-48/22-4310 % ≤ C < 25 %: Xn; R20/22-48/22-433 % ≤ C < 10 %: Xn; R20/22-431 % ≤ C < 3 %: Xi; R43 | |
603-095-00-2 | 2-(propyloxy)ethanolEGPE | | 220-548-6 | 2807-30-9 | Xn; R21Xi; R36 | XnR: 21-36S: (2-)26-36/37-46 | | |
603-105-00-5 | furan | E | 203-727-3 | 110-00-9 | F+; R12R19Carc. Cat. 2; R45Muta. Cat. 3; R68Xn; R20/22-48/22Xi; R38R52-53 | F+; TR: 45-12-19-20/22-38-48/22-68-52/53S: 53-45-61 | | |
604-001-00-2 | phenolcarbolic acidmonohydroxybenzenephenylalcohol | | 203-632-7 | 108-95-2 | Muta. Cat.3; R68T; R23/24/25Xn; R48/20/21/22C; R34 | T; CR: 23/24/25-34-48/20/21/22-68S: (1/2-)24/25-26-28-36/37/39-45 | C ≥ 10 %: T; R23/24/25-48/20/21/22-34-683 % ≤ C < 10 %: C; Xn; R20/21/22-34-681 % ≤ C < 3 %: Xn; R36/38-68 | |
604-009-00-6 | pyrogallol1,2,3-trihydroxybenzene | | 201-762-9 | 87-66-1 | Muta. Cat. 3; R68Xn; R20/21/22R52-53 | XnR: 20/21/22-68-52/53S: (2-)36/37-61 | C ≥ 25 %: Xn; R20/21/22-68-52/5310 % ≤ C < 25 %: Xn; R20/21/22-681 % ≤ C < 10 %: Xn; R68 | |
604-010-00-1 | resorcinol1,3-benzenediol | | 203-585-2 | 108-46-3 | Xn; R22Xi; R36/38N; R50 | Xn; NR: 22-36/38-50S: (2-)26-61 | C ≥ 25 %: Xn, N; R22-36/38-5020 % ≤ C < 25 %: Xn; R22-36/3810 % ≤ C < 20 %: Xn; R22 | |
604-012-00-2 | 4-chloro-o-cresol4-chloro-2-methyl phenol | | 216-381-3 | 1570-64-5 | T; R23C; R35N; R50 | T; C; NR: 23-35-50S: (1/2-)26-36/37/39-45-61 | C ≥ 25 %: T, C, N; R23-35-5010 % ≤ C < 25 %: C; R20-355 % ≤ C < 10 %: C; R20-343 % ≤ C < 5 %: Xn; R20-36/37/381 % ≤ C < 3 %: Xi; R36/37/38 | |
604-013-00-8 | 2,3,4,6-tetrachlorophenol | | 200-402-8 | 58-90-2 | T; R25Xi; R36/38N; R50-53 | T; NR: 25-36/38-50/53S: (1/2-)26-28-37-45-60-61 | C ≥ 25 %: T, N; R25-36/38-50/5320 % ≤ C < 25 %: T, N; R25-51/535 % ≤ C < 20 %: T, N; R25-36/38-51/532,5 % ≤ C < 5 %: Xn, N; R22-51/530,5 % ≤ C < 2,5 %: Xn; R22-52/530,25 % ≤ C < 0,5 %: R52/53 | |
604-014-00-3 | chlorocresol4-chloro-m-cresol4-chloro-3-methylphenol | | 200-431-6 | 59-50-7 | Xn; R21/22Xi; R41R43N; R50 | Xn; NR: 21/22-41-43-50S: (2-)26-36/37/39-61 | C ≥ 25 %: Xn, N; R21/22-41-43-5010 % ≤ C < 25 %: Xn; R21/22-41-435 % ≤ C < 10 %: Xn; R21/22-36-431 % ≤ C < 5 %: Xi;R43 | |
604-015-00-9 | 2,2'-methylenebis-(3,4,6-trichlorophenol)hexachlorophene | | 200-733-8 | 70-30-4 | T; R24/25N; R50-53 | T; NR: 24/25-50/53S:(1/2-)20-37-45-60-61 | C ≥ 25 %: T, N; R24/25-50/532,5 % ≤ C < 25 %: T, N; R24/25-51/532 % ≤ C < 2,5 %: T; R24/25-52/530,25 % ≤ C < 2 %: Xn; R21/22-52/530,2 % ≤ C < 0,25 %: Xn; R21/22 | |
604-017-00-X | 2,4,5-trichlorophenol | | 202-467-8 | 95-95-4 | Xn; R22Xi; R36/38N; R50-53 | Xn; NR: 22-36/38-50/53S: (2-)26-28-60-61 | C ≥ 25 %: Xn, N; R22-36/38-50/5320 % ≤ C < 25 %: Xn, N; R22-36/38-51/535% ≤ C < 20 %: Xn, N; R36/38-51/532,5% ≤ C < 5 %: N;R51/530,25 % ≤ C < 2,5 %: R52/53 | |
| | | | | | | | |
604-030-00-0 | bisphenol A4,4'-isopropylidenediphenol | | 201-245-8 | 80-05-7 | Repr. Cat. 3; R62Xi; R37-41R43 | XnR: 37-41-43-62S: (2-)26-36/37-39-46 | | |
605-002-00-0 | 1,3,5-trioxantrioxymethylene | | 203-812-5 | 110-88-3 | F;R11Repr.Cat.3; R63Xi; R37 | F; XnR: 11-37-63S: (2-)36/37-46 | | |
605-016-00-7 | glyoxal...%ethandial...% | B | 203-474-9 | 107-22-2 | Muta. Cat. 3; R68Xn; R20Xi; R36/38R43 | XnR: 20-36/38-43-68S: (2-)36/37 | C ≥ 10 %: Xn; R20-36/38-43-681 % ≤ C < 10 %: Xn; R43-68 | |
605-020-00-9 | safrole5-allyl-1,3-benzodioxole | E | 202-345-4 | 94-59-7 | Carc. Cat. 2; R45Muta. Cat. 3; R68Xn; R22 | TR: 45-22-68S: 53-45 | | |
605-022-00-X | glutaralglutaraldehyde1,5-pentanedial | | 203-856-5 | 111-30-8 | T; R23/25C; R34R42/43N; R50 | T; NR: 23/25-34-42/43-50S: (1/2-)26-36/37/39-45-61 | C ≥ 50 %: T, N; R23/25-34-42/43-5025 % ≤ C < 50 %: T; R22-23-34-42/4310 % ≤ C < 25 %: C; R20/22-34-42/432 % ≤ C < 10 %: Xn; R20/22-37/38-41-42/431 % ≤ C < 2 %: Xn; R36/37/38-42/430,5 % ≤ C < 1 %: Xi; R36/37/38-43 | |
605-025-00-6 | chloroacetaldehyde | | 203-472-8 | 107-20-0 | Carc. Cat. 3; R40T+; R26T; R24/25C; R34N; R50 | T+; NR: 24/25-26-34-40-50S: (1/2-)26-28-36/37/39-45-61 | C ≥ 25 %: T+, N; R24/25-26-34-40-5010 % ≤ C < 25 %: T+; R21/22-26-34-407 % ≤ C < 10 %: T+; R21/22-26-36/37/38-405 % ≤ C < 7 %: T; R21/22-23-36/37/38-403 % ≤ C < 5 %: T; R21/22-23-401 % ≤ C < 3 %: T; R23-400,1 % ≤ C < 1 %: Xn; R20 | |
606-037-00-4 | triadimefon (ISO)1-(4-chlorophenoxy)-3,3-dimethyl-1 -(1,2,4-triazol-1-yl)butanone | | 256-103-8 | 43121-43-3 | Xn; R22R43N; R51-53 | Xn; NR: 22-43-51/53S: (2-)24-37-61 | | |
606-048-00-4 | 2'-anilino-3'-methyl-6'-dipentylaminospiro(isobenzofuran-1(1H),9'-xanthen)-3-one | | 406-480-1 | - | R53 | R: 53S: 61 | | |
607-004-00-7 | trichloroacetic acid | | 200-927-2 | 76-03-9 | C; R35N; R50-53 | C; NR: 35-50/53S:(1/2-)26-36/37/39-45-60-61 | C ≥ 25 %: C, N; R35-50/5310 % ≤ C < 25 %: C, N; R35-51/535 % ≤ C < 10 %: C, N; R34-51/532,5 % ≤ C < 5 %: Xi, N; R36/37/38-51/531 % ≤ C < 2,5 %: Xi; R36/37/3 8-52/530,25 % ≤ C < 1 %: R52/53 | |
607-019-00-9 | methyl chloroformate | | 201-187-3 | 79-22-1 | F; R11T+; R26Xn; R21/22C; R34 | F; T+R: 11-21/22-26-34S: (1/2-)26-14-28-36/37-39-36/37/39-45-46-63 | | |
607-049-00-2 | mecoprop (ISO) [1] and its salts 2-(4-chloro-o-tolyloxy) propionic acid(RS)-2-(4-chloro-o-tolyloxy) propionic acid[1]2-(4-chloro-2-methylphenoxy)propionic acid[2] | | 230-386-8[1]202-264-4[2] | 7085-19-0 [1]93-65-2 [2] | Xn; R22Xi; R38-41N; R50-53 | Xn; NR: 22-38-41-50/53S: (2-) 13-26-37/39-60-61 | C ≥ 25 %: Xn, N; R22-38-41-50-5320 % ≤ C < 25 %: Xi, N; R38-41-50-5310 % ≤ C < 20 %: Xi, N; R41-50-535% ≤ C < 10 %: Xi,N;R36-50-530,25 % ≤ C < 5 %: N; R5O-530,025 %. ≤ C < 0,25 %: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
607-053-00-4 | MCPB (ISO)4-(4-chloro-o-tolyloxy) butyric acid | | 202-365-3 | 94-81-5 | N; R50-53 | NR: 50/53S: 60-61 | | |
607-061-00-8 | acrylic acidprop-2-enoic acid | D | 201-177-9 | 79-10-7 | R10Xn; R20/21/22C; R35N; R50 | C; NR: 10-20/21/22-35-50S: (1/2-)26-36/37/39-45-61 | C ≥ 25 %: C, N; R20/21/22-35-5010 % ≤ C < 25 %: C; R355 % ≤ C < 10 %: C; R341 % ≤ C < 5 %: Xi; R36/37/38 | |
607-064-00-4 | benzyl chloroformate | | 207-925-0 | 501-53-1 | C; R34N; R50-53 | C; NR: 34-50/53S: (1/2-)26-45-60-61 | C ≥ 25 %: C, N; R34-50/5310 % ≤ C < 25 %: C, N; R34-51/535 % ≤ C < 10 %: Xi, N; R36/37/38-51/532,5% ≤ C < 5 %: N; R51/530,25 % ≤ C < 2,5 %: R52/53 | |
607-072-00-8 | 2-hydroxyethyl acrylate | D | 212-454-9 | 818-61-1 | T; R24C; R34R43N; R50 | T; NR: 24-34-43-50S: (1/2-)26-36/39-45-61 | C ≥ 25 %: T; R24-34-43-5010 % ≤ C < 25 %: T; R24-34-435 % ≤ C < 10 %: T; R24-36/38-432 % ≤ C < 5 %: T; R24-430,2 % ≤ C < 2 %: Xn; R21-43 | |
607-086-00-4 | diallyl phthalate | | 205-016-3 | 131-17-9 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)24/25-60-61 | C ≥ 25 %: Xn, N; R22-50/532,5 % ≤ C < 25 %: N; R 51/530,25 % ≤ C < 2,5 %: R52/53 | |
607-091-00-1 | trifluoroacetic acid ... % | B | 200-929-3 | 76-05-1 | Xn; R20C; R35R52-53 | CR: 20-35-52/53S: (1/2-)9-26-27-28-45-61 | C ≥ 25 %: C; R20-35-52/5310 % ≤ C < 25 %: C; R20-355 % ≤ C < 10 %: C; R341 % ≤ C < 5 %: Xi; R36/38 | |
607-094-00-8 | peracetic acid ... % | | 201-186-8 | 79-21-0 | R10O; R7Xn; R20/21/22C; R35N; R50 | O; C; NR: 7-10-20/21/22-35-50S: (1/2-)3/7-14-36/37/39-45-61 | C ≥ 25 %: C, N; R20/21/22-35-5010 % ≤ C < 25 %: C; R20/21/22-355 % ≤ C < 10 %: C; R341 % ≤ C < 5 %: Xi, R36/37/38 | |
607-107-00-7 | 2-ethylhexyl acrylate | D | 203-080-7 | 103-11-7 | Xi; R37/38R43 | XiR: 37/38-43S: (2-)36/37-46 | | |
607-113-00-X | isobutyl methacrylate | D | 202-613-0 | 97-86-9 | R10Xi; R36/37/38R43N; R50 | Xi; NR: 10-36/37/38-43-50S: (2-)24-37-61 | C ≥ 25 %: Xi, N; R36/37/38-43-5020 % ≤ C < 25 %: Xi; R36/37/38-431 % ≤ C < 20 %: Xi; R43 | |
607-116-00-6 | cyclohexyl acrylate | D | 221-319-3 | 3066-71-5 | Xi; R37/38N; R51-53 | Xi; NR:37/38-51/53S: (2-)61 | C ≥ 25 %: Xi, N; R37/38-51/5310 % ≤ C < 25 %: Xi; R37/38-52/532,5 % ≥ C < 10 %: R52/53 | |
607-133-00-9 | monoalkyl or monoaryl or monoalkylaryl esters of acrylic acid with the exception of those specified elsewhere in this Annex | A | - | - | Xi; R36/37/38N; R51-53 | Xi; NR: 36/37/38-51/53S: (2-)26-28-61 | C ≥ 25 %: Xi, N; R36/37/38-51/5310 % ≤ C < 25 %: Xi; R36/37/38-52/532,5 % ≤ C < 10 %: R52/53 | |
607-151-00-7 | propargite (ISO)2-(4-tert-butylphenoxy) cyclohexyl prop-2-ynyl sulphite | | 219-006-1 | 2312-35-8 | Carc.Cat.3; R40T; R23Xi; R38-41N; R50-53 | T; NR: 23-38-40-41-50/53S: (1/2-)26-36/37/39-45-60-61 | C ≥ 25 %: T, N; R23-38-40-41-50-5320 % ≤ C < 25 %: Xn, N; R20-38-40-41-50-5310 % ≤ C < 20 %: Xn, N; R20-40-41-50-535 % ≤ C < 10 %: Xn, N; R20-40-36-50-533 % ≤ C < 5 %: Xn, N; R20-40-50-532,5 % ≤ C < 3 %: Xn, N; R40-50-531 % ≤ C < 2,5 %: Xn, N; R40-51-530,25 % ≤ C < 1 %: N;R51-530,025 % ≤ C < 0,25 %: R52-53 | |
607-189-00-4 | trimethylenediaminetetraacetic acid | | 400-400-9 | 1939-36-2 | Xn; R22Xi; R41N; R50-53 | Xn; NR: 22-41-50/53S: (2-)22-26-39-60-61 | | |
607-244-00-2 | isooctyl acrylate | | 249-707-8 | 29590-42-9 | Xi; R36/37/38N; R50-53 | Xi; NR: 36/37/38-50/53S: (2-)26-28-60-61 | C ≥ 25 %: Xi, N; R36/37/38-50/5310 % ≤ C < 25 %: Xi, N; R36/37/3 8-51/532,5 % ≤ C < 10 %: N; R51/530,25 % ≤ C < 2,5 %: R52/53 | |
607-245-00-8 | tert-butyl acrylate | D | 216-768-7 | 1663-39-4 | F; R11Xn; R20/21/22Xi; R37/38R43N; R52-53 | F; XnR: 11-20/21/22-37/38-43-52/53S: (2-)16-25-37-61 | C ≥ 25 %: Xn; R20/21/22-37/38-43-52-5320 % ≤ C < 25 %: Xi; R37/38-431 % ≤ C < 20 %: Xi; R43 | |
607-247-00-9 | dodecyl methacrylate | | 205-570-6 | 142-90-5 | Xi; 36/37/38N; R50-53 | Xi; NR: 36/37/38-50/53S: (2-)26-28-60-61 | C ≥ 25 %: Xi, N; R36/37/38-50/5310 % ≤ C < 25 %: Xi, N; R36/37/38-51/532,5 % ≤ C < 10 %: N;R51/530,25 % ≤ C < 2,50 %: R52/53 | |
607-249-00-X | (1-methyl-1,2-ethanediyl)bis[oxy(methyl-2,1-ethanediyl)] diacrylate | | 256-032-2 | 42978-66-5 | Xi; R36/37/38R43N; R51-53 | Xi; NR: 36/37/38-43-51/53S: (2-)24-37-61 | C ≥ 25 %: Xi, N; R36/37/38-43-51/5310 % ≤ C < 25 %: Xi; R36/37/38-43-52/532,5 % ≤ C < 10 %:Xi; R43-52/531 % ≤ C < 2,5 %: Xi; R43 | |
608-003-00-4 | acrylonitrile | D E | 203-466-5 | 107-13-1 | F; R11Carc. Cat. 2; R45T; R23/24/25Xi; R37/38-41R43N; R51-53 | F; T; NR: 45-11-23/24/25-37/38-41-43-51/53S: 9-16-53-45-61 | C ≥ 25 %: T, N; R45-23/24/25-37/38-41-43-51/5320 % ≤ C < 25 %: T; R45-23/24/25-37/38-41-43-52/5310 % ≤ C < 20 %: T; R45-23/24/25-41-43-52/535 % ≤ C < 10 %:T; R45-23/24/25-36-43-52/532,5 % ≤ C < 5 %: T; R45-23/24/25-43-52/531 % ≤ C < 2,5 %: T; R45-23/24/25-430,2 % < C < 1 %: T; R45-20/21/220,1 % ≤ C < 0,2%: T; R45 | |
608-006-00-0 | bromoxynil (ISO) and its salts3,5-dibromo-4-hydroxybenzonitrile bromoxynil phenol | | 216-882-7 | 1689-84-5 | Repr. Cat. 3; R63T+; R26T; R25R43N; R50-53 | T+; NR: 25-26-43-63-50/53S: (1/2-)27/28-36/37-45-63-60-61 | C ≥ 25 %: T+, N; R25-26-43-63-50-537 % ≤ C < 25 %: T+, N; R22-26-43-63-50-535 % ≤ C < 7 %: T, N; R22-23-43-63-50-533 % ≤ C < 5 %: T, N; R22-23-43-50-532,5 % ≤ C < 3 %: T, N; R23-43-50-531 % ≤ C < 2,5 %: T, N; R23-43-51-530,25 % ≤ C < 1 %: Xn, N; R20-51-530,1 % ≤ C < 0,25 %: Xn; R20-52-530,025 % ≤ C < 0,1 %: R52-53 | |
608-007-00-6 | ioxynil (ISO) and its salts4-hydroxy-3,5-diiodobenzonitrile | | 216-881-1 | 1689-83-4 | Repr. Cat. 3; R63T; R23/25Xn; R21-48/22Xi; R36N; R50-53 | T; NR: 21-23/25-36-48/22-63-50/53S: (1/2-)36/37-45-60-61-63 | C ≥ 25 %: T, N; R21-23/25-36-48/22-63-50-5320 % ≤ C < 25 %: Xn, N; R20/22-36-48/22-63-50-5310 % ≤ C < 20 %: Xn, N; R20/22-48/22-63-50-535 % ≤ C < 10 %: Xn, N; R20/22-63-50-533 % ≤ C < 5 %: Xn, N; R20/22-50-532,5 % ≤ C < 3 %: N; R50-530,25 % ≤ C < 2,5 %: N; R51-530,025 % ≤ C < 0,25 %: R52-53 | |
608-010-00-2 | methacrylonitrile2-methyl-2-propene nitrile | D | 204-817-5 | 126-98-7 | F; R11T; R23/24/25R43 | F; TR: 11-23/24/25-43S: (1/2-)9-16-18-29-45 | C ≥ 1 %: T; R23/24/25-430,2 % ≤ C < 1 %: Xn; R20/21/22-43 | |
608-014-00-4 | chlorothalonil (ISO)tetrachloroisophthalonitrile | | 217-588-1 | 1897-45-6 | Carc. Cat. 3; R40T+; R26Xi; R41Xi; R37R43N; R50-53 | T+; NR: 26-37-40-41-43-50/53S: (2-)28-36/37/39-45-60-61 | C ≥ 20 %: T+, N; R26-37-40-41-43-50-5310 % ≤ C < 20 %: T+, N; R26-40-41-43-50-537 % ≤ C < 10 %: T+, N; R26-40-36-43-50-535 % ≤ C < 7 %: T, N; R23-40-36-43-50-532,5 % ≤ C < 5 %: T, N; R23-40-43-50-531 % ≤ C < 2,5 %: T, N; R23-40-43-51-530,25 % ≤ C < 1: Xn, N; R20-51-530,1 % ≤ C < 0,25 %: Xn; R20-52-530,025 % ≤ C < 0,1 %: R52-53 | |
608-017-00-0 | bromoxynil octanoate (ISO)2,6-dibromo-4-cyanophenyl octanoate | | 216-885-3 | 1689-99-2 | Repr. Cat. 3; R63T; R23Xn; R22R43N; R50-53 | T; NR: 22-23-43-63-50/53S: (1/2-)36/37-45-63-60-61 | C ≥ 25 %: T, N; R 22-23-43-63-50-535 % ≤ C < 25 %: Xn, N; R20-43-63-50-533 % ≤ C < 5 %: Xn, N; R20-43-50-532,5 % ≤ C < 3 %: Xi, N; R43-50-531 % ≤ C < 2,5 %: Xi, N; R43-51-530,25 % ≤ C< 1 %: N; R51-530,025 % ≤ C < 0,25 %: R52-53 | |
608-018-00-6 | ioxynil octanoate (ISO)4-cyano-2,6-diiodophenyloctanoate | | 223-375-4 | 3861-47-0 | Repr. Cat. 3; R63T; R25Xi; R36R43N; R50-53 | T; NR: 25-36-43-63-50/53S: (1/2-)26-36/37-45-60-61 | C ≥ 25 %: T, N; R25-36-43-63-50-5320 % ≤ C < 25 %: Xn, N; R22-36-43-63-50-535 % ≤ C < 20 %: Xn, N; R22-43-63-50-533 % ≤ C < 5 %: Xn, N; R22-43-50-532,5 % ≤ C < 3 %: N; R43-50-531 % ≤ C < 2,5 %: N; R43-51-530,25 % ≤ C < 1 %: N; R51-530,025 % ≤ C < 0,25 %: R52-53 | |
608-021-00-2 | 3-(2-(diaminomethyleneamino)thiazol-4-ylmethylthio)propionitrile | | 403-710-2 | 76823-93-3 | Xn; R22R43 | XnR: 22-43S: (2-)22-24-37 | | |
609-007-00-9 | 2,4-dinitrotoluenedinitrotoluene, technical grade[1]dinitrotoluene[2] | E | 204-450-0[1]246-836-1[2] | 121-14-2 [1]25321-14-6[2] | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62T; R23/24/25Xn; R48/22N; R51-53 | T; NR: 45-23/24/25-48/22-62-68-51/53S: 53-45-61 | | |
609-023-00-6 | dinocap (ISO) | E | 254-408-0 | 39300-45-3 | Repr. Cat. 2; R61Xn; R20-48/22Xi; R38R43N; R50-53 | T; NR: 61-20-22-38-43-48/22-50/53S: 53-45-60-61 | | |
609-043-00-5 | quintozene (ISO)pentachloronitrobenzene | | 201-435-0 | 82-68-8 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)13-24-37-60-61 | | |
609-049-00-8 | 2,6-dinitrotoluene | E | 210-106-0 | 606-20-2 | Carc. Cat. 2; R45Muta. Cat. 3;R68Repr. Cat. 3; R62T; R23/24/25Xn; R48/22R52-53 | TR: 45-23/24/25-48/22-62-68-52/53S: 53-45-61 | | |
609-050-00-3 | 2,3-dinitrotoluene | E | 210-013-5 | 602-01-7 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62T; R23/24/25Xn; R48/22N; R50-53 | T; NR: 45-23/24/25-48/22-62-68-50/53S: 53-45-60-61 | | |
609-051-00-9 | 3,4-dinitrotoluene | E | 210-222-1 | 610-39-9 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62T; R23/24/25Xn; R48/22N; R51-53 | T; NR: 45-23/24/25-48/22-62-68-51/53S: 53-45-61 | | |
609-052-00-4 | 3,5-dinitrotoluene | E | 210-566-2 | 618-85-9 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62T; R23/24/25Xn; R48/22R52-53 | TR: 45-23/24/25-48/22-62-68-52/53S: 53-45-61 | | |
609-055-00-0 | 2,5-dinitrotoluene | E | 210-581-4 | 619-15-8 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62T; R23/24/25Xn; R48/22N; R51-53 | T; NR: 45-23/24/25-48/22-62-68-51/53S:53-45-61 | | |
609-056-00-6 | 2,2-dibromo-2-nitroethanol | | 412-380-9 | 69094-18-4 | E; R2Carc. Cat. 3; R40Xn; R22-48/22C; R35R43N; R50-53 | E; C; NR: 2-22-35-40-43-48/22-50/53S: (1/2-)23-26-35-36/37/39-45-60-61 | C ≥ 25 %: C, N; R22-35-40-43-48/22-50/5310 % ≤ C < 25 %: C, N; R22-35-40-43-48/22-51/535 % ≤ C < 10 %: C, N; R34-40-43-51/532,5 % ≤ C < 5 %: Xn, N; R36/37/3 8-40-43-51/531 % ≤ C < 2,5 %: Xn; R36/37/3 8-40-43-52/530,25 % ≤ C < 1 %: R52/53 | |
610-005-00-5 | 1-chloro-4-nitrobenzene | | 202-809-6 | 100-00-5 | Carc. Cat. 3; R40Mut. Cat. 3; R68T; R23/24/25Xn; R48/20/21/22N; R51-53 | T; NR: 23/24/25-40-48/20/21/22-68-51/53S: (1/2-)28-36/37-45-61 | | |
611-001-00-6 | azobenzene | E | 203-102-5 | 103-33-3 | Carc. Cat. 2; R45Muta. Cat. 3; R68Xn; R20/22-48/22N; R50-53 | T; NR: 45-20/22-48/22-68-50/53S: 53-45-60-61 | | |
611-060-00-8 | A mixture of: sodium 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yl]-6-hydroxy-1,3,5-triazin-2-ylamino]-1-hydroxy-3,6-disulfonatonaphthalen-2-ylazo]-isophthalate; ammonium 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1 -ylamino]-6-hydroxy-1,3,5-triazin-2-yll-2,5-dimethylpiperazin-1-yll-6-hydroxy-1,3,5-triazin-2-ylamino] -1 -hydroxy- 3,6-disulfonatonaphthalen-2-ylazo] -isophthalate; 5-[8-[4-[4-[4-[7-(3,5-dicarboxylatophenylazo)-8-hydroxy-3,6-disulfonatonaphthalen-1-ylamino]-6-hydroxy-1,3,5-triazin-2-yl]-2,5-dimethylpiperazin-1-yll-6-hydroxy-1,3,5-triazin-2-ylamino]-1 -hydroxy-3,6-disulfonaphthalen-2-ylazo] -isophthalic acid | | 413-180-4 | - | Xi; R41 | XiR:41S: (2-)22-26-39 | | |
611-063-00-4 | trisodium [4'-(8-acetylamino-3,6-disulfonato-2-naphthylazo)-4'-(6-benzoylamino-3-sulfonato-2-naphthylazo)-biphenyl-1,3',3',1'''-tetraolato-O,O',O'',O''']copper(II) | | 413-590-3 | 164058-22-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | | |
612-008-00-7 | aniline | | 200-539-3 | 62-53-3 | Carc. Cat. 3; R40Muta. Cat. 3; R68T; R23/24/25-48/23/24/25Xi; R41R43N; R50 | T; NR: 23/24/25-40-41-43-48/23/24/25-68-50S: (1/2-)26-27-36/37/39-45-46-61-63 | C ≥ 25 %: T, N; R23/24/25-40-41-43-48/23/24/25-50-6810 % ≤ C < 25 %: T; R20/21/22-40-41-43-48/23/24/25-681 % ≤ C < 10 %: T; R20/21/22-40-43-48/23/24/25-680,2 % ≤ C < 1 %: Xn; R48/20/21/22 | |
612-009-00-2 | salts of aniline | A | - | - | Carc. Cat. 3;R40Muta. Cat. 3; R68T; R23/24/25Xi; R41R43N; R50 | T; NR: 23/24/25-40-41-43-48/23/24/25-68-50S: (1/2-)26-27-36/37/39-45-61-63 | C ≥ 25 %: T, N; R23/24/25-40-41-43-48/23/24/25-50-6810 % ≤ C < 25 %: T; R20/21/22-40-41-43-48/23/24/25-681 % ≤ C < 10 %: T; R20/21/22-40-43-48/23/24/25-680,2 % ≤ C < 1 %: Xn; R48/20/21/22 | |
612-010-00-8 | chloroanilines (with exception of those specified elsewhere in this Annex) | C | - | - | T; R23/24/25R33N; R50-53 | T; NR: 23/24/25-33-50/53S: (1/2-)28-36/37-45-60-61 | | |
612-022-00-3 | 2-naphthylamine | E | 202-080-4 | 91-59-8 | Carc. Cat. 1; R45Xn; R22N; R51-53 | T; NR: 45-22-51/53S: 53-45-61 | C ≥ 25 %: T, N; R45-22-51/532,5 % ≤ C < 25 %: T; R45-52/530,01 % ≤ C < 2,5 %: T; R45 | |
612-023-00-9 | phenylhydrazine[1]phenylhydrazinium chloride[2]phenylhydrazine hydrochloride[3]phenylhydrazinium sulphate (2:1)[4] | E | 202-873-5[1]200-444-7[2]248-259-0[3]257-622-2[4] | 100-63-0 [1]59-88-1 [2]27140-08-5 [3]52033-74-6 [4] | Carc. Cat. 2; R45Muta. Cat. 3; R68T; R23/24/25-48/23/24/25Xi; R36/3R438N; R50 | T; NR: 45-23/24/25-36/38-43-48/23/24/25-68-50S: 53-45-61 | | |
612-025-00-X | nitrotoluidines, with the exception of those specified elsewhere in this Annex | C | - | - | T; R23/24/25R33N; R51-53 | T; NR: 23/24/25-33-51/53S: (1/2-)28-36/37-45-61 | | |
612-035-00-4 | 2-methoxyanilineo-anisidine | E | 201-963-1 | 90-04-0 | Carc. Cat. 2; R45Muta Cat. 3; R68T; R23/24/25 | TR: 45-23/24/25-68S: 53-45 | | |
612-042-00-2 | benzidine1,1'-biphenyl-4,4'-diamine4,4'-diaminobiphenylbiphenyl-4,4'-ylenediamine | E | 202-199-1 | 92-87-5 | Carc. Cat. 1; R45Xn; R22N; R50-53 | T; NR: 45-22-50/53S: 53-45-60-61 | C ≥ 25 %: T, N; R45-22-50/532,5 % ≤ C < 25 %: T, N; R45-51/530,01 % ≤ C < 2,5 %: T; R45 | |
612-051-00-1 | 4,4'-diaminodiphenylmethane4,4'-methylenedianiline | E | 202-974-4 | 101-77-9 | Carc. Cat. 2; R45Muta. Cat. 3; R68T; R39/23/24/25Xn; R48/20/21/22R43N; R51-53 | T; NR: 45-39/23/24/25-43-48/20/21/22-68-51/53S: 53-45-61 | | |
612-054-00-8 | N,N-diethylaniline | | 202-088-8 | 91-66-7 | T; R23/24/25R33N; R51-53 | T; NR: 23/24/25-33-51/53S: (1/2-)28-37-45-61 | C ≥ 25 %: T, N; R23/24/25-33-51/535 % ≤ C < 25 %: T; R23/24/25-33-52/532,5 % ≤ C < 5 %: Xn; R20/21/22-33-52/531 % ≤ C < 2,5 %: Xn; R20/21/22-33 | |
612-056-00-9 | N,N-dimethyl-p-toluidine[1]N,N-dimethyl-m-toluidine[2]N,N-dimethyl-o-toluidine[3] | C | 202-805-4[1]204-495-6[2]210-199-8[3] | 99-97-8 [1]121-72-2 [2]609-72-3 [3] | T; R23/24/25R33R52-53 | TR: 23/24/25-33-52/53S: (1/2-)28-36/37-45-61 | C ≥ 25 %: T; R23/24/25-33-52-535 % ≤ C < 25 %: T; R23/24/25-331 % ≤ C < 5 %: Xn; R20/21/22-33 | |
612-059-00-5 | 3,6-diazaoctanethylenediamintriethylenetetramine | | 203-950-6 | 112-24-3 | Xn; R21C; R34R43R52-53 | CR: 21-34-43-52/53S: (1/2-)26-36/37/39-45-61 | C ≥ 25 %: C; R21-34-43-52/5310 % ≤ C < 25 %: C; R34-435 % ≤ C < 10 %: Xi; R36/38-431 % ≤ C < 5 %: Xi; R43 | |
612-060-00-0 | 3,6,9-triazaundecamethylenediaminetetraethylenepentamine | | 203-986-2 | 112-57-2 | Xn; R21/22C; R34R43N; R51-53 | C; NR: 21/22-34-43-51/53S: (1/2-)26-36/37/39-45-61 | C ≥ 25 %: C, N; R21/22-34-43-51/5310 % ≤ C < 25 %: C; R34-43-52/535 % ≤ C < 10 %: Xi; R36/38-43-52/532,5 % ≤ C < 5 %: Xi; R43-52/531 % ≤ C < 2,5 %: Xi; R43 | |
| | | | | | | | |
612-064-00-2 | 3,6,9,12-tetra-azatetradecamethylenediaminepentacthylenehexamine | | 223-775-9 | 4067-16-7 | C; R34R43N; R50-53 | C; NR: 34-43-50/53S: (1/2-)26-36/37/39-45-60-61 | C ≥ 25 %: C, N; R34-43-50/5310 % ≤ C < 25 %: C, N; R34-43-51/535 % ≤ C < 10 %: Xi,N; R36/38-43-51/532,5 % ≤ C < 5 %: Xi, N; R43-51/531 % ≤ C < 2,5 %: Xi; R43-52/530,25 % ≤ C < 1 %: R52/53 | |
612-065-00-8 | polyethlyenepolyamines with the exception of those specified elsewhere in this Annex | | - | - | Xn; R21/22C; R34R43N; R50-53 | C; NR: 21/22-34-43-50/53S: (1/2-)26-36/37/39-45-60-61 | C ≥ 25 %: C, N; R21/22-34-43-50/5310 % ≤ C < 25 %: C, N; R34-43-51/535 % ≤ C < 10 %: Xi,N; R36/38-43-51/531 % ≤ C < 2,5 %: Xi; R43-52/530,25 % ≤ C < 1 %: R52/53 | |
612-066-00-3 | dicyclohexylamine | | 202-980-7 | 101-83-7 | Xn; R22C; R34N; R50-53 | C; NR: 22-34-50/53S: (1/2-)26-36/37/39-45-60-61 | C ≥ 25 %: C, N; R22-34-50/5310 % ≤ C < 25 %: C, N; R34-51/532,5 % ≤ C < 10 %: Xi, N; R36/38-51/532 % ≤ C < 2,5 %: Xi; R36/38-52/530,25 % ≤ C < 2 %: R52/53 | |
612-067-00-9 | 3-aminomethyl-3,5,5-trimethylcyclohexylamine | | 220-666-8 | 2855-13-2 | Xn; R21/22C; R34R43R52-53 | CR: 21/22-34-43-52/53S: (1/2-)26-36/37/39-45-61 | C ≥ 25 %: C;R21/22-34-43-52/5310 % ≤ C < 25 %: C; R34-435 % ≤ C < 10 %: Xi; R36/38-431 % ≤ C < 5 %: Xi; R43 | |
612-077-00-3 | dimethylnitrosoamineN-nitrosodimethylamine | E | 200-549-8 | 62-75-9 | Carc. Cat. 2; R45T+; R26T; R25-48/25N; R51-53 | T+; NR: 45-25-26-48/25-51/53S: 53-45-61 | C ≥ 25 %: T+, N; R45-25-26-48/25-51/5310 % ≤ C < 25 %: T+; R45-22-26-48/25-52/537 % ≤ C < 10 %: T+; R45-22-26-48/22-52/533 % ≤ C < 7 %: T; R45-22-23-48/22-52/532,5 % ≤ C < 3 %: T; R45-23-48/22-52/531 % ≤ C < 2,5 %: T; R45-23-48/220,1 % ≤ C < 1 %: T; R45-200,001 % ≤ C < 0,1 %: T; R45 | |
612-086-00-2 | amitraz (ISO)N,N-bis(2,4-xylyliminomethyl)methylamine | | 251-375-4 | 33089-61-1 | Xn; R22-48/22R43N; R50-53 | Xn; NR: 22-43-48/22-50/53S: (2-)22-60-24-61-36/37 | C ≥ 25 %: Xn, N; R22-43-48/22-50-5310 % ≤ C < 25 %: Xn, N; R43-48/22-50-532,5 % ≤ C < 10 %:N; R43-50-531 % ≤ C < 2,5 %: N; R43-51-530,25 % ≤ C < 1 %: N; R51-530,025 % ≤ C < 0,25 %: R52-53 | |
612-087-00-8 | guazatine | | 236-855-3 | 13516-27-3 | T+; R26Xn; R21/22Xi; R37/38-41N; R50-53 | T+; NR: 21/22-26-37/38-41-50/53S: (1/2-)26-28-36/37/39-38-45-46-60-61-63 | | |
612-094-00-6 | 4-(2-chloro-4-trifluoromethyl)phenoxy-2-fluoroaniline hydrochloride | | 402-190-4 | - | T; R48/25Xn; R22-48/20Xi; R41R43N; R50-53 | T; NR: 22-41-43-48/20-48/25-50/53S: (1/2-)26-36/37/39-45-60-61 | | |
612-121-00-1 | amines, polyethylenepoly-HEPA | | 268-626-9 | 68131-73-7 | Xn; R21/22C; R34R43N; R50-53 | C; NR: 21/22-34-43-50/53S: (1/2-)26-36/37/39-45-60-61 | C ≥ 25 %: C, N; R21/22-34-43-50/5310 % ≤ C < 25 %: C, N; R34-43-51/535 % ≤ C < 10 %: Xi, N; R36/38-43-51/532,5 % ≤ C < 5 %: Xi, N; R43-51/531 % ≤ C < 2,5 %: Xi; R43-52/530,25 % ≤ C < 1 %: R52/53 | |
612-136-00-3 | N-isopropyl-N'-phenyl-p-phenylenediamine | | 202-969-7 | 101-72-4 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24-37-60-61 | C ≥ 25 %: Xn, N; R22-43-50/532,5 % ≤ C < 25 %: Xi, N; R43-51/530,25 % ≤ C < 2,5 %: Xi; R43-52/530,1 % ≤ C < 0,25 %: Xi; R43 | |
612-151-00-5 | diaminotoluene, technical product - mixture of [2] and [3]methyl-phenylenediamine[1]4-methyl-m-phenylene diamine[2]2-methyl-m-phenylene diamine[3] | E | 246-910-3[1]202-453-1[2]212-513-9[3] | 25376-45-8 [1]95-80-7 [2]823-40-5 [3] | Carc. Cat. 2; R45T; R25Xn; R20/21Xi; R36R43N; R51-53 | T; NR: 45-20/21-25-36-43-51/53S: 53-45-61 | | |
613-009-00-5 | 2,4,6-trichloro-1,3,5-triazinecyanuric chloride | | 203-614-9 | 108-77-0 | T+; R26Xn; R22C; R34R43R14 | T+; CR: 14-22-26-34-43S:(1/2-)26-28-36/37/39-45-46-63 | C ≥ 25 %: T+; R22-26-34-4310 % ≤ C < 25 %: T+; R26-34-437 % ≤ C < 10 %:T+;R26-36/37/38-435 % ≤ C < 7 %: T; R23-36/37/38-431 % ≤ C < 5 %: T; R23-430,1 % ≤ C < 1 %: Xn; R20 | |
613-011-00-6 | amitrole (ISO)1,2,4-triazol-3-ylamine | | 200-521-5 | 61-82-5 | Repr.Cat.3; R63Xn; R48/22N; R51-53 | Xn; NR: 48/22-63-51/53S: (2-)13-36/37-61 | | |
613-033-00-6 | 2-methylaziridinepropyleneimine | E | 200-878-7 | 75-55-8 | F; R11Carc. Cat. 2; R45T+; R26/27/28Xi; R41N; R51-53 | F; T+; NR: 45-11-26/27/28-41-51/53S: 53-45-61 | C ≥ 25 %: T+, N; R45-26/27/28-41-51/5310 % ≤ C < 25 %: T+; R45-26/27/28-41-52/537 % ≤ C < 10 %: T+; R45-26/27/28-36-52/535 % ≤ C < 7 %: T; R45-23/24/25-36-52/532,5 % ≤ C < 5 %: T; R45-23/24/25-52/531 % ≤ C < 2,5 %: T; R45-23/24/250,1 % ≤ C < 1 %: T; R45-20/21/220,01 % ≤ C < 0,1 %: T; R45 | |
613-040-00-4 | azaconazole (ISO)1-([2-(2,4-dichlorophenyl)-1,3-dioxolan-2-yl]methyl)-1H-1,2,4-triazole | | 262-102-3 | 60207-31-0 | Xn; R22 | XnR: 22S: (2-)46 | | |
613-043-00-0 | imazalil sulphate (ISO) powder1-[2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate[1](±)-1-[2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate[2] | | 261-351-5[1]281-291-3[2] | 58594-72-2[1]83918-57-4[2] | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)24/25-37-46-60-61 | | |
613-048-00-8 | carbendazim (ISO)methyl benzimidazol-2-ylcarbamate | | 234-232-0 | 10605-21-7 | Muta. Cat. 2; R46Repr. Cat. 2; R60-61N; R50-53 | T; NR: 46-60-61-50/53S: 53-45-60-61 | | |
613-049-00-3 | benomyl (ISO)methyl 1-(butylcarbamoyl)benzimidazol-2-ylcarbamate | | 241-775-7 | 17804-35-2 | Muta. Cat. 2; R46Repr.Cat.2; R60-61Xi; R37/38R43N; R50-53 | T; NR: 46-60-61-37/38-43-50/53S: 53-45-60-61 | C ≥ 20 %: T, N; R46-60-61-37/38-43-50-532,5 % ≤ C < 20 %: T, N; R46-60-61-43-50-531 % ≤ C < 2,5 %: T, N; R46-60-61-43-51-530,5 % ≤ C < 1 %: T, N; R46-60-61-51-530,25 % ≤ C < 0,5 %: T, N; R46-51-530,1 % ≤ C < 0,25 %: T; R46-52-530,025 % ≤ C < 0,1 %: R52-53 | |
613-051-00-4 | molinate (ISO)S-ethyl 1-perhydroazepinecarbothioateS-ethyl perhydroazepine-1-carbothioate | | 218-661-0 | 2212-67-1 | Carc. Cat 3; R40Repr. Cat 3; R62Xn; R20/22Xn; R48/22R43N; R50-53 | T; NR: 20/22-40-43-48/22-63-50/53S: (2-)36/37-46-60-61 | C ≥ 25 %: Xn, N; R20/22-40-43-48/22-62-50-5310 % ≤ C < 25 %: Xn, N; R40-43-48/22-62-50-535 % ≤ C < 10 %: Xn, N; R40-43-62-50-531 % ≤ C < 5 %: Xn, N; R40-43-50-530,25 % ≤ C < 1 %: N; R50-530,025 % ≤ C < 0,25 %: N; R51-530,0025 % ≤ C < 0,025 %: R52-51 | |
613-058-00-2 | permethrin (ISO)m-phenoxybenzyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | | 258-067-9 | 52645-53-1 | Xn; R20/22R43N; R50-53 | Xn; NR: 20/22-43-50/53S: (2-) 13-24-36/37/39-60-61 | C ≥ 25 %: Xn, N; R20/22-43-50-531 % ≤ C < 25 %: N; R43-50-530,025 % ≤ C < 1 %: N; R50-530,0025 % ≤ C < 0,025 %: N; R51-530,00025 % ≤ C < 0,0025 %: R52-53 | |
613-075-00-5 | 1,3-dichloro-5-ethyl-5-methylimidazolidine-2,4-dione | | 401-570-7 | 89415-87-2 | O; R8T; R23C; R34Xn; R22R43N; R50 | O; T; NR: 8-22-23-34-43-50S: (1/2-)8-26-36/37/39-45-61 | | |
613-088-00-6 | 1,2-benzisothiazol-3(2H)-one1,2-benzisothiazolin-3-one | | 220-120-9 | 2634-33-5 | Xn; R22Xi; R38-41R43N; R50 | Xn; NR: 22-38-41-43-50S: (2-)24-26-37/39-61 | C ≥ 25 %: Xn, N; R22-38-41-4320 % ≤ C < 25 %: Xi; R38-41-4310 % ≤ C < 20 %: Xi; R41-435 % ≤ C < 10 %: Xi; R36-430,05 % ≤ C < 5 %: Xi; R43 | |
613-112-00-5 | 2-octyl-2H-isothiazol-3-one | | 247-761-7 | 26530-20-1 | T; R23/24Xn; R22C; R34R43N; R50-53 | T; NR: 22-23/24-34-43-50/53S: (1/2-)26-36/37/39-45-60-61 | C ≥ 25 %: T, N; R22-23/24-34-43-50/5310 % ≤ C < 25 %: C, N; R20/21-34-43-51/535 % ≤ C < 10 %:Xn, N; R20/21-36/38-43-51/533 % ≤ C < 5 %: Xn, N; R20/21-43-51/532,5 % ≤ C < 3 %: Xi, N; R43-51/530,25 % ≤ C < 2,5 %: Xi; R43-52/530,05 % ≤ C < 0,25 %: Xi; R43 | |
613-124-00-0 | fenpropimorphcis-4-[3-(p-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine | | 266-719-9 | 67564-91-4 | Repr. Cat. 3; R63Xn; R22Xi; R38N; R51-53 | Xn; NR: 22-38-63-51/53S: (2-)36/37-46-61 | | |
613-129-00-8 | metamitron4-amino-3-methyl-6-phenyl-1,2,4-triazin-5-one | | 255-349-3 | 41394-05-2 | Xn; R22N; R50 | Xn; NR: 22-50S: (2-)61 | | |
613-167-00-5 | mixture of: 5-chloro-2-methyl-4-isothiazolin-3-one [EC no. 247-500-7]and 2-methyl-2H isothiazol-3-one [EC no. 220-239-6] (3:1) mixture of: 5-chloro-2-methyl-4-isothiazolin-3-one [EC no. 247-500-7]and 2-methyl-4-isothiazolin-3-one [EC no. 220-239-6] (3:1) | | - | 55965-84-9 | T; R23/24/25C; R34R43N; R50-53 | T; NR: 23/24/25-34-43-50/53S: (2-)26-28-36/37/39-45-60-61 | C ≥ 25 %: T, N; R23/24/25-34-43-50/533 % ≤ C < 25 %: C, N; R20/21/22-34-43-51/532,5 % ≤ C < 3 %: C, N; R34-43-51/530,6 % ≤ C < 2,5 %: Xi; R34-43-52/530,25 % ≤ C < 0,6 %: Xi; R33/38-43-52/530,06 % ≤ C < 0,25 %: Xi; R36/38-430,0015 % ≤ C < 0,06 %: Xi; R43 | |
613-175-00-9 | Epoxiconazole(2RS,3SR)-3-(2-chlorophenyl)-2-(4-fluorophenyl)- [(1H- 1,2,4-triazol-1 -yl)methyl] oxirane | | 406-850-2 | 133855-98-8 | Carc. Cat. 3; R40Repr. Cat. 3; R62Repr. Cat. 3; R63N; R51-53 | Xn; NR: 40-62-63-51/53S: (2-)36/37-46-61 | | |
615-001-00-7 | methyl isocyanate | | 210-866-3 | 624-83-9 | F+; R12Repr. Cat. 3; R63T+; R26T; R24/25R42/43Xi; R37/38-41 | F+; T+R: 12-24/25-26-37/38-41-42/43-63S: (1/2-)26-27/28-36/37/39-45-63 | | |
615-004-00-3 | salts of thiocyanic acid | A | - | - | Xn; R20/21/22R32R52-53 | XnR: 20/21/22-32-52/53S: (2-)13-61 | | |
615-006-00-4 | 2-methyl-m-phenylene diisocyanatetoluene-2,4-di-isocyanate[1]4-methyl-m-phenylene diisocyanatetoluene-2,6-di-isocyanate[2]m-tolylidene diisocyanatetoluene-diisocyanate[3] | | 202-039-0[1]209-544-5[2]247-722-4[3] | 91-08-7 [1]584-84-9 [2]26471-62-5 [3] | Carc. Cat. 3; R40T+; R26Xi; R36/37/38R42/43R52-53 | T+R: 26-36/37/38-40-42/43-52/53S: (1/2-)23-36/37-45-61 | C ≥ 25 %: T+; R26-36/37/38-40-42/43-52/5320 % ≤ C < 25 %: T+; R26-36/37/38-40-42/437 % ≤ C < 20 %: T+; R26-40-42/431 % ≤ C < 7 %: T; R23-40-42/430,1% ≤ C < 1 %:Xn;R20-42 | |
615-008-00-5 | 3-isocyanatomethyl-3,5,5-trimethylcyclohexyl isocyanate isophorone di-isocyanate | | 223-861-6 | 4098-71-9 | T; R23Xi; R36/37/38R42/43N; R51-53 | T; NR: 23-36/37/38-42/43-51/53S: (1/2-)26-28-38-45-61 | C ≥ 25 %: T, N; R23-36/37/38-42/43-51/5320 % ≤ C < 25 %: T; R23-36/37/38-42/43-52/532,5 % ≤ C < 20 %: T; R23-42/43-52/532 % ≤ C < 2,5 %: T; R23-42/430,5 % ≤ C < 2 %: Xn; R20-42/43 | 2 |
615-015-00-3 | 1,7,7-trimethylbicyclo(2,2,1)hept-2-yl thiocyanatoacetateisobornyl thiocyanoacetate | | 204-081-5 | 115-31-1 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)24/25-60-61 | | |
616-015-00-6 | alachlor (ISO)2-chloro-2',6'-diethyl-N-(methoxymethyl)acetanilide | | 240-110-8 | 15972-60-8 | Carc. Cat. 3; R40Xn; R22R43N; R50-53 | Xn; NR: 22-40-43-50/53S: (2-)36/37-46-60-61 | C ≥ 25 %: Xn, N; R22-40-43- 50-531 % ≤ C < 25 %: Xn, N; R40-43-50-530,25 % ≤ C < 1 %: N; R5O-530,025 % ≤ C < 0,25 %: N; R51-530,0025 % ≤ C < 0,025 %: R52-53 | |
616-024-00-5 | 2-(4,4-dimethyl-2,5-dioxooxazolidin-1 -yl)-2-chloro-5-(2-(2,4-di-tert-pentylphenoxy)butyramido)-4,4-dimethyl-3-oxovaleranilide | | 402-260-4 | - | R53 | R: 53S: 61 | | |
617-002-00-8 | α,α-dimethylbenzylhydroperoxidecumene hydroperoxide | | 201-254-7 | 80-15-9 | O; R7T; R23Xn; R21/22-48/20/22C; R34N; R51-53 | O; T; NR: 7-21/22-23-34-48/20/22-51/53S: (1/2-)3/7-14-36/37/39-45-50-61 | C ≥ 25 %: T, N; R21/22-23-34-48/20/22-51/5310 % ≤ C < 25 %: C; R20-34-48/20/22-52/533 % ≤ C < 10 %: Xn; R20-37/38-41-52/532,5 % ≤ C < 3 %: Xi; R36/37-52/531 % ≤ C < 2,5 %: Xi; R36/37 | |
617-004-00-9 | 1,2,3,4-tetrahydro-1-naphthyl hydroperoxide | | 212-230-0 | 771-29-9 | O; R7Xn; R22C; R34N; R50-53 | O; C; NR: 7-22-34-50/53S: (1/2-)3/7-14-26-36/37/39-45-60-61 | C ≥ 25 %: C, N; R22-34-50/5310 % ≤ C < 25 %: C, N; R34-51/535 % ≤ C < 10 %: Xi, N; R36/37/38-51/532,5 % ≤ C < 5 %: N;R51/530,25 % ≤ C < 2,5 %: R52/53 | |
648-043-00-X | Creosote oil, acenaphthene fraction, acenaphthene-freeWash Oil Redistillate[The oil remaining after removal by a crystallization process of acenaphthene from acenaphthene oil from coal tar. Composed primarily of naphthalene and alkylnaphthalenes.] | H | 292-606-9 | 90640-85-0 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | | |
648-080-00-1 | Residues (coal tar), creosote oil distn.Wash Oil Redistillate[The residue from the fractional distillation of wash oil boiling in the approximate range of 270oC to 330oC (518oF to 626oF). It consists predominantly of dinuclear aromatic and heterocyclic hydrocarbons.] | H | 295-506-3 | 92061-93-3 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | | |
648-098-00-X | Creosote oil, acenaphthene fractionWash Oil[A complex combination of hydrocarbons produced by the distillation of coal tar and boiling in the range of approximately 240oC to 280oC (464oF to 536oF). Composed primarily of acenaphthene, naphthalene and alkyl naphthalene.] | H | 292-605-3 | 90640-84-9 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | | |
648-099-00-5 | Creosote oil[A complex combination of hydrocarbons obtained by the distillation of coal tar. It consists primarily of aromatic hydrocarbons and may contain appreciable quantities of tar acids and tar bases. It distills at the approximate range of 200oC to 325oC (392oF to 617oF).J | H | 263-047-8 | 61789-28-4 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | | |
648-100-00-9 | Creosote oil, high-boiling distillateWash Oil[The high-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal which is further refined to remove excess crystalline salts. It consists primarily of creosote oil with some of the normal polynuclear aromatic salts, which are components of coal tar distillates, removed. It is crystal free at approximately 5oC (41oF).] | H | 274-565-9 | 70321-79-8 | Carc. Cat. 2; R45 | TR:45S: 53-45 | | |
648-101-00-4 | Creosote[The distillate of coal tar produced by the high temperature carbonization of bituminous coal. It consists primarily of aromatic hydrocarbons, tar acids and tar bases.] | H | 232-287-5 | 8001-58-9 | Carc. Cat. 2; R45 | TR:45S: 53-45 | | |
648-102-00-X | Extract residues (coal), creosote oil acidWash Oil Extract Residue[A complex combination of hydrocarbons from the base-freed fraction from the distillation of coal tar, boiling in the range of approximately 250oC to 280oC (482oF to 536oF). It consists predominantly of biphenyl and isomeric diphenylnaphthalenes.] | H | 310-189-4 | 122384-77-4 | Carc. Cat. 2; R45 | TR:45S:53-45 | | |
648-138-00-6 | Creosote oil, low-boiling distillateWash Oil[The low-boiling distillation fraction obtained from the high temperature carbonization of bituminous coal, which is further refined to remove excess crystalline salts. It consists primarily of creosote oil with some of the normal polynuclear aromatic salts, which are components of coal tar distillate, removed. It is crystal free at approximately 38oC (100oF).] | H | 274-566-4 | 70321-80-1 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | | |
649-001-00-3 | Extracts (petroleum), light naphthenic distillate solvent | H | 265-102-1 | 64742-03-6 | Carc. Cat. 2; R45 | TR:45S: 53-45 | | |
649-002-00-9 | Extracts (petroleum) heavy paraffinic distillate solvent | H | 265-103-7 | 64742-04-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | | |
649-003-00-4 | Extracts (petroleum), light paraffinic distillate solvent | H | 265-104-2 | 64742-05-8 | Carc. Cat. 2; R45 | TR:45S: 53-45 | | |
649-004-00-X | Extracts (petroleum), heavy naphthenic distillate solvent | H | 265-111-0 | 64742-11-6 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | | |
649-005-00-5 | Extracts (petroleum), light vacuum gas oil solvent | H | 295-341-7 | 91995-78-7 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | | |
649-006-00-0 | hydrocarbons C26-55, arom-rich | H | 307-753-7 | 97722-04-8 | Carc. Cat. 2; R45 | TR: 45S: 53-45 | | |
649-062-00-6 | Gases (petroleum), catalytic cracked naphtha depropanizer overhead, C3-rich acid-freePetroleum gas[A complex combination of hydrocarbons obtained from fractionation of catalytic cracked hydrocarbons and treated to remove acidic impurities. It consists of hydrocarbons having carbon numbers in the range of C2 through C4, predominantly C3.] | H K | 270-755-0 | 68477-73-6 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-063-00-1 | Gases (petroleum), catalytic crackerPetroleum gas[A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 270-756-6 | 68477-74-7 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-064-00-7 | Gases (petroleum), catalytic cracker, C1-5-richPetroleum gas[A complex combination of hydrocarbons produced by the distillation of products from a catalytic cracking rocess. It consists of aliphatic hydrocarbons having carbon numbers in the range of C1 through C6, predominantly C1 through C5.] | H K | 270-757-1 | 68477-75-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-065-00-2 | Gases (petroleum), catalytic polymd. naphtha stabilizer overhead, C2-4-richPetroleum gas[A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic polymerized naphtha. It consists of aliphatic hydrocarbons having carbon numbers in the range of C2 through C6, predominantly C2 through C4.] | H K | 270-758-7 | 68477-76-9 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-066-00-8 | Gases (petroleum), catalytic reformer, C1-4-richPetroleum gas[A complex combination of hydrocarbons produced by distillation of products from a catalytic reforming process. It consists of hydrocarbons having carbon numbers in the range of C1 through C6, predominantly C1 through C4.] | H K | 270-760-8 | 68477-79-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-067-00-3 | Gases (petroleum), C3-5 olefinic-paraffinic alkylation feedPetroleum gas[A complex combination of olefinic and paraffinic hydrocarbons having carbon numbers in the range of C3 through C5 which are used as alkylation feed. Ambient temperatures normally exceed the critical temperature of these combinations.] | H K | 270-765-5 | 68477-83-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-068-00-9 | Gases (petroleum), C4-richPetroleum gas[A complex combination of hydrocarbons produced by distillation of products from a catalytic fractionation process. It consists of aliphatic hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C4.] | H K | 270-767-6 | 68477-85-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-069-00-4 | Gases (petroleum), deethanizer overheadsPetroleum gas[A complex combination of hydrocarbons produced from distillation of the gas and gasoline fractions from the catalytic cracking process. It contains predominantly ethane and ethylene.] | H K | 270-768-1 | 68477-86-1 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-070-00-X | Gases (petroleum), deisobutanizer tower overheadsPetroleum gas[A complex combination of hydrocarbons produced by the atmospheric distillation of a butane-butylene stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] | H K | 270-769-7 | 68477-87-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-071-00-5 | Gases (petroleum), depropanizer dry, propene-richPetroleum gas[A complex combination of hydrocarbons produced by the distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists predominantly of propylene with some ethane and propane.] | H K | 270-772-3 | 68477-90-7 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-072-00-0 | Gases (petroleum), depropanizer overheadsPetroleum gas[A complex combination of hydrocarbons produced by distillation of products from the gas and gasoline fractions of a catalytic cracking process. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | H K | 270-773-9 | 68477-91-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-073-00-6 | Gases (petroleum), gas recovery plant depropanizer overheadsPetroleum gas[A complex combination of hydrocarbons obtained by fractionation of miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4, predominantly propane.] | H K | 270-777-0 | 68477-94-1 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-074-00-1 | Gases (petroleum), Girbatol unit feedPetroleum gas[A complex combination of hydrocarbons that is used as the feed into the Girbatol unit to remove hydrogen sulfide. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | H K | 270-778-6 | 68477-95-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-075-00-7 | Gases (petroleum), isomerized naphtha fractionator, C4-rich, hydrogen sulfide-freePetroleum gas | H K | 270-782-8 | 68477-99-6 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-076-00-2 | Tail gas (petroleum), catalytic cracked clarified oil and thermal cracked vacuum residue fractionation reflux drumPetroleum gas[A complex combination of hydrocarbons obtained from fractionation of catalytic cracked clarified oil and thermal cracked vacuum residue. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 270-802-5 | 68478-21-7 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-077-00-8 | Tail gas (petroleum), catalytic cracked naphtha stabilization absorberPetroleum gas[A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 270-803-0 | 68478-22-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-078-00-3 | Tail gas (petroleum), catalytic cracker, catalytic reformer and hydrodesulfurizer combined fractionaterPetroleum gas[A complex combination of hydrocarbons obtained from the fractionation of products from catalytic cracking, catalytic reforming and hydrodesulfurizing processes treated to remove acidic impurities. It consists predominantly of hydrocarbons having cabon numbers predominantly in the range of C1 through C5.] | H K | 270-804-6 | 68478-24-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-079-00-9 | Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizerPetroleum gas[A complex combination of hydrocarbons obtained from the fractionation stabilization of catalytic reformed naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | H K | 270-806-7 | 68478-26-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-080-00-4 | Tail gas (petroleum), saturate gas plant mixed stream, C4-richPetroleum gas[A complex combination of hydrocarbons obtained from the fractionation stabilization of straight-run naphtha, distillation tail gas and catalytic reformed naphtha stabilizer tail gas. It consists of hydrocarbons having carbon numbers in the range of C3 through C6, predominantly butane and isobutane.] | H K | 270-813-5 | 68478-32-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-081-00-X | Tail gas (petroleum), saturate gas recovery plant, C1-2-richPetroleum gas[A complex combination of hydrocarbons obtained from fractionation of distillate tail gas, straight-run naphtha, catalytic reformed naphtha stabilizer tail gas. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C5, predominantly methane and ethane.] | H K | 270-814-0 | 68478-33-1 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-082-00-5 | Tail gas (petroleum), vacuum residues thermal crackerPetroleum gas[A complex combination of hydrocarbons obtained from the thermal cracking of vacuum residues. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 270-815-6 | 68478-34-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-083-00-0 | Hydrocarbons, C3-4-rich,petroleum distillatePetroleum gas[A complex combination of hydrocarbons produced by distillation and condensation of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C3 through C4.] | H K | 270-990-9 | 68512-91-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-084-00-6 | Gases (petroleum), full-range straight-run naphtha dehexanizer offpetroleum gas[A complex combination of hydrocarbons obtained by the fractionation of the full-range straight-run naphtha. It consists of hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | H K | 271-000-8 | 68513-15-5 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-085-00-1 | Gases (petroleum), hydrocracking depropanizer off, hydrocarbon-richPetroleum gas[A complex combination of hydrocarbon produced by the distillation of products from a hydrocracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4. It may also contain small amounts of hydrogen and hydrogen sulfide.] | H K | 271-001-3 | 68513-16-6 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-086-00-7 | Gases (petroleum), light straight-run naphtha stabilizer offPetroleum gas[A complex combination of hydrocarbons obtained by the stabilization of light straight-run naphtha. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C6.] | H K | 271-002-9 | 68513-17-7 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-087-00-2 | Residues (petroleum), alkylation splitter, C4-richPetroleum gas[A complex residuum from the distillation of streams various refinery operations. It consists of hydrocarbons having carbon numbers in the range of C4 through C5, predominantly butane and boiling in the range of approximately -11.7oC to 27.8oC (11oF to 82oF).] | H K | 271-010-2 | 68513-66-6 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-088-00-8 | Hydrocarbons, C1-4Petroleum gas[A complex combination of hydrocarbons provided by thermal cracking and absorber operations and by distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately minus 164oC to minus 0.5oC (-263oF to 31oF).] | H K | 271-032-2 | 68514-31-8 | Carc. Cat 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-089-00-3 | Hydrocarbons, C1-4, sweetenedPetroleum gas[A complex combination of hydrocarbons obtained by subjecting hydrocarbon gases to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately -164oC to -0.5oC (-263oF to 31oF).] | H K | 271-038-5 | 68514-36-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-090-00-9 | Hydrocarbons, C1-3Petroleum gas[A complex combination of hydrocarbons having carbon numbers predominantly in the range of C1 through C3 and boiling in the range of approximately minus 164oC to minus 42oC (-263oF to -44oF).] | H K | 271-259-7 | 68527-16-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-091-00-4 | Hydrocarbons, C1-4 debutanizer fractionPetroleum gas | H K | 271-261-8 | 68527-19-5 | Carc. Cat. 1: R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-092-00-X | Gases (petroleum), C1-5, wetPetroleum gas[A complex combination of hydrocarbons produced by the distillation of crude oil and/or the cracking of tower gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 271-624-0 | 68602-83-5 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-093-00-5 | Hydrocarbons, C2-4Petroleum gas | H K | 271-734-9 | 68606-25-7 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-094-00-0 | Hydrocarbons, C3Petroleum gas | H K | 271-735-4 | 68606-26-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-095-00-6 | Gases (petroleum), alkylation feedPetroleum gas[A complex combination of hydrocarbons produced by the catalytic cracking of gas oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] | H K | 271-737-5 | 68606-27-9 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-096-00-1 | Gases (petroleum), depropanizer bottoms fractionation offPetroleum gas[A complex combination of hydrocarbons obtained from the fractionation of depropanizer bottoms. It consists predominantly of butane, isobutane and butadiene.] | H K | 271-742-2 | 68606-34-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-097-00-7 | Gases (petroleum), refinery blendPetroleum gas[A complex combination obtained from various processes. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 272-183-7 | 68783-07-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-098-00-2 | Gases (petroleum), catalytic crackingPetroleum gas[A complex combination of hydrocarbons produced by the distillation of the products from a catalytic cracking process. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C3 through C5.] | H K | 272-203-4 | 68783-64-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-099-00-8 | Gases (petroleum), C2-4, sweetenedPetroleum gas[A complex combination of hydrocarbons obtained by subjecting a petroleum distillate to a sweetening process to convert mercaptans or to remove acidic impurities. It consists predominantly of saturated and unsaturated hydrocarbons having carbon numbers predominantly in the range of C2 through C4 and boiling in the range of approximately -51oC to -34oC (-60oF to -30oF).] | H K | 272-205-5 | 68783-65-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-100-00-1 | Gases (petroleum), crude oil fractionation offPetroleum gas[A complex combination of hydrocarbons produced by the fractionation of crude oil. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 272-871-7 | 68918-99-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-101-00-7 | Gases (petroleum), dehexanizer offPetroleum gas[A complex combination of hydrocarbons obtained by the fractionation of combined naphtha streams. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 272-872-2 | 68919-00-6 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
| | | | | | | | |
649-102-00-2 | Gases (petroleum), light straight run gasoline fractionation stabilizer offPetroleum gas[A complex combination of hydrocarbons obtained by the fractionation of light straight-run gasoline. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 272-878-5 | 68919-05-1 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-103-00-8 | Gases (petroleum), naphtha unifiner desulfurization stripper offPetroleum gas[A complex combination of hydrocarbons produced by a naphtha unifiner desulfurization process and stripped from the naphtha product. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | H K | 272-879-0 | 68919-06-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-104-00-3 | Gases (petroleum), straight-run naphtha catalytic reforming offPetroleum gas[A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and fractionation of the total effluent. It consists of methane, ethane, and propane.] | H K | 272-882-7 | 68919-09-5 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-105-00-9 | Gases (petroleum), fluidized catalytic cracker splitter overheadsPetroleum gas[A complex combination of hydrocarbons produced by the fractionation of the charge to the C3 -C4 splitter. It consists predominantly of C3 hydrocarbons.] | H K | 272-893-7 | 68919-20-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-106-00-4 | Gases (petroleum), straight-run stabilizer offPetroleum gas[A complex combination of hydrocarbons obtained from the fractionation of the liquid from the first tower used in the distillation of crude oil. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | H K | 272-883-2 | 68919-10-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45S: 53-45 | | |
649-107-00-X | Gases (petroleum), catalytic cracked naphtha debutanizerPetroleum gas[A complex combination of hydrocarbons obtained from fractionation of catalytic cracked naphtha. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | H K | 273-169-3 | 68952-76-1 | Carc. Cat. 1;R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-108-00-5 | Tail gas (petroleum), catalytic cracked distillate and naphtha stabilizerPetroleum gas[A complex combination of hydrocarbons obtained by the fractionation of catalytic cracked naphtha and distillate. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | H K | 273-170-9 | 68952-77-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-109-00-0 | Tail gas (petroleum), thermal-cracked distillate, gas oil and naphtha absorberpetroleum gas[A complex combination of hydrocarbons obtained from the separation of thermal-cracked distillates, naphtha and gas oil. It consists pedrominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 273-175-6 | 68952-81-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-110-00-6 | Tail gas (petroleum) thermal cracked hydrocarbon fractionation stabilizer, petroleum cokingPetroleum gas[A complex combination of hydrocarbons obtained from the fractionation stabilization of thermal cracked hydrocarbons from petroleum coking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 273-176-1 | 68952-82-9 | Carc. Cat. 1: R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-111-00-1 | Gases (petroleum, light steam-cracked, butadiene conc.Petroleum gas[A complex combination of hydrocarbons produced by the distillation of products from a thermal cracking process, It consists of hydrocarbons having a. carbon number predominantly of C4] | H K | 273-265-5 | 68955-28-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-112-00-7 | Gases (petroleum), straight-run naphtha catalytic reformer stabilizer overheadPetroleum gas[A complex combination of hydrocarbons obtained by the catalytic reforming of straight-run naphtha and the fractionation of the total effluent. It consists of saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | H K | 273-270-2 | 68955-34-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-113-00-2 | Hydrocarbons, C4Petroleum gas | H K | 289-339-5 | 87741-01-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-114-00-8 | Alkanes, C1-4, C3-richPetroleum gas | H K | 292-456-4 | 90622-55-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-115-00-3 | Gases (petroleum), steam-cracker C3-richPetroleum gas[A complex combination of hydrocarbons produced by the distillation of products from a steam cracking process. It consists predominantly of propylene with some propane and boils in the range of approximately -70oC to 0oC (-94oF to 32oF).] | H K | 295-404-9 | 92045-22-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-116-00-9 | Hydrocarbons, C4, steam-cracker distillatePetroleum gas[A complex combination of hydrocarbons produced by the distillation of the products of a steam cracking process. It consists predominantly of hydrocarbons having a carbon number of C4, predominantly 1-butene and 2-butene, containing also butane and isobutene and boiling in the range of approximately minus 12oC to 5oC (10.4oF to 41 oF).] | H K | 295-405-4 | 92045-23-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-117-00-4 | Petroleum gases, liquefied, sweetened, C4 fractionPetroleum gas[A complex combination of hydrocarbons obtained by subjecting a liquified petroleum gas mix to a sweetening process to oxidize mercaptans or to remove acidic impurities. It consists predominantly of C4 saturated and unsaturated hydrocarbons.] | HKS | 295-463-0 | 92045-80-2 | F+; R12Carc. Cat. 1; R45Muta. Cat. 2; R46 | F+; TR: 12-45-46S: 53-45 | | |
649-119-00-5 | Raffinates (petroleum), steam-cracked C4 fraction cuprous ammonium acetate extn., C3-5 and C3-5 unsatd., butadiene-freePetroleum gas | H K | 307-769-4 | 97722-19-5 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-120-00-0 | Gases (petroleum), amine system feedRefinery gas[The feed gas to the amine system for removal of hydrogen sulfide. It consists of hydrogen. Carbon monoxide, carbon dioxide, hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5 may also be present.] | H K | 270-746-1 | 68477-65-6 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-121-00-6 | Gases (petroleum), benzene unit hydrodesulfurizer offRefinery gas[Off gases produced by the benzene unit. It consists primarily of hydrogen. Carbon monoxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6, including benzene, may also be present.] | H K | 270-747-7 | 68477-66-7 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-122-00-1 | Gases (petroleum), benzene unit recycle, hydrogen-richRefinery gas[A complex combination of hydrocarbons obtained by recycling the gases of the benzene unit. It consists primarily of hydrogen with various small amounts of carbon monoxide and hydrocarbons having carbon numbers in the range of C1 through C6.] | H K | 270-748-2 | 68477-67-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-123-00-7 | Gases (petroleum), blend oil, hydrogen-nitrogen-richRefinery gas[A complex combination of hydrocarbons obtained by distillation of a blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, carbon dioxide, and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 270-749-8 | 68477-68-9 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-124-00-2 | Gases (petroleum), catalytic reformed naphtha stripper overheadsRefinery gas[A complex combination of hydrocarbons obtained from stabilization of catalytic reformed naphtha. Its consists of hydrogen and saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | H K | 270-759-2 | 68477-77-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-125-00-8 | Gases (petroleum), C6-8 catalytic reformer recycleRefinery gas[A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8 feed and recycled to conserve hydrogen. It consists primarily of hydrogen. It may also contain various small amounts of carbon monoxide, carbon dioxide, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 270-761-3 | 68477-80-5 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-126-00-3 | Gases (petroleum), C6-8 catalytic reformerRefinery gas[A complex combination of hydrocarbons produced by distillation of products from catalytic reforming of C6-C8 feed. It consists of hydrocarbons having carbon numbers in the range of C1 through C5 and hydrogen.] | H K | 270-762-9 | 68477-81-6 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-127-00-9 | Gases (petroleum), C6-8 catalytic reformer recycle, hydrogen-richRefinery gas | H K | 270-763-4 | 68477-82-7 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-128-00-4 | Gases (petroleum), C2-return streamRefinery gas[A complex combination of hydrocarbons obtained by the extraction of hydrogen from a gas stream which consists primarily of hydrogen with small amounts of nitrogen, carbon monoxide, methane, ethane, and ethylene. It contains predominantly hydrocarbons such as methane, ethane, and ethylene with small amounts of hydrogen, nitrogen and carbon monoxide.] | H K | 270-766-0 | 68477-84-9 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-129-00-X | Gases (petroleum), dry sour, gas-concn.-unit-offRefinery gas[The complex combination of dry gases from a gas concentration unit. It consists of hydrogen, hydrogen sulfide and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | H K | 270-774-4 | 68477-92-9 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-130-00-5 | Gases (petroleum), gas concn. reabsorber distn.Refinery gas[A complex combination of hydrocarbons produced by distillation of products from combined gas streams in a gas concentration reabsorber. It consists predominantly of hydrogen, carbon monoxide, carbon dioxide, nitrogen, hydrogen sulfide and hydrocarbons having carbon numbers in the range of C1 through C3.] | H K | 270-776-5 | 68477-93-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-131-00-0 | Gases (petroleum), hydrogen absorber offRefinery gas[A complex combination obtained - by absorbing hydrogen from a hydrogen rich stream. It consists of hydrogen, carbon monoxide, nitrogen, and methane with small amounts of C2 hydrocarbons.] | H K | 270-779-1 | 68477-96-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-132-00-6 | Gases (petroleum), hydrogen-richRefinery gas[A complex combination separated as a gas from hydrocarbon gases by chilling. It consists primarily of hydrogen with various small amounts of carbon monoxide, nitrogen, methane, and C2 hydrocarbons.] | H K | 270-780-7 | 68477-97-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-133-00-1 | Gases (petroleum), hydrotreater blend oil recycle, hydrogen-nitrogen-richRefinery gas[A complex combination obtained from recycled hydrotreated blend oil. It consists primarily of hydrogen and nitrogen with various small amounts of carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 270-781-2 | 68477-98-5 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-134-00-7 | Gases (petroleum), recycle, hydrogen-richRefinery gas[A complex combination obtained from recycled reactor gases. It consists primarily of hydrogen with various small amounts of carbon monoxide, carbon dioxide, nitrogen, hydrogen sulfide, and saturated aliphatic hydrocarbons having carbon numbers in the range of C1 through C5.] | H K | 270-783-3 | 68478-00-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-135-00-2 | Gases (petroleum), reformer make-up, hydrogen-richRefinery gas[A complex combination obtained from the reformers. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 270-784-9 | 68478-01-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-136-00-8 | Gases (petroleum), reforming hydrotreaterRefinery gas[A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen, methane, and ethane hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 thorugh C5.] | H K | 270-785-4 | 68478-02-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-137-00-3 | Gases (petroleum), reforming hydrotreater, hydrogen-methane-richRefinery gas[A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen and methane with various small amounts of carbon monoxide, carbon dioxide, nitrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C5.] | H K | 270-787-5 | 68478-03-5 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-138-00-9 | Gases (petroleum), reforming hydrotreater make-up, hydrogen-richRefinery gas[A complex combination obtained from the reforming hydrotreating process. It consists primarily of hydrogen with various small amounts of carbon monoxide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 270-788-0 | 68478-04-6 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-139-00-4 | Gases (petroleum), thermal cracking distn.Refinery gas[A complex combination produced by distillation of products from a thermal cracking process. It consists of hydrogen, hydrogen sulfide, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 270-789-6 | 68478-05-7 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-140-00-X | Tail gas (petroleum), catalytic cracker refractionation absorberRefinery gas[A complex combination of hydrocarbons obtained from refractionation of products from a catalytic cracking process. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | H K | 270-805-1 | 68478-25-1 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-141-00-5 | Tail gas (petroleum), catalytic reformed naphtha separatorRefinery gas[A complex combination of hydrocarbons obtained from the catalytic reforming of straight run naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 270-807-2 | 68478-27-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-142-00-0 | Tail gas (petroleum), catalytic reformed naphtha stabilizerRefinery gas[A complex combination of hydrocarbons obtained from the stabilization of catalytic reformed naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 270-808-8 | 68478-28-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-143-00-6 | Tail gas (petroleum), cracked distillate hydrotreater separatorRefinery gas[A complex combination of hydrocarbons obtained by treating cracked distillates with hydrogen in the presence of a catalyst. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 270-809-3 | 68478-29-5 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-144-00-1 | Tail gas (petroleum), hydrodesulfurized straight-run naphtha separatorRefinery gas[A complex combination of hydrocarbons obtained from hydrodesulfurization of straight-run naphtha. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 270-810-9 | 68478-30-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-145-00-7 | Gases (petroleum), catalytic reformed straight-run naphtha stabilizer overheadsRefinery gas[A complex combination of hydrocarbons obtained from the catalytic reforming of straight-run naphtha followed by fractionation of the total effluent. It consists of hydrogen, methane, ethane and propane.] | H K | 270-999-8 | 68513-14-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-146-00-2 | Gases (petroleum), reformer effluent high-pressure flash drum offRefinery gas[A complex combination produced by the high-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] | H K | 271-003-4 | 68513-18-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-147-00-8 | Gases (petroleum), reformer effluent low-pressure flash drum offRefinery gas[A complex combination produced by low-pressure flashing of the effluent from the reforming reactor. It consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] | H K | 271-005-5 | 68513-19-9 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-148-00-3 | Gases (petroleum), oil refinery gas distn. offRefinery gas[A complex combination separated by distillation of a gas stream containing hydrogen, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers in the range of C1 through C6 or obtained by cracking ethane and propane. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C2, hydrogen, nitrogen, and carbon monoxide.] | H K | 271-258-1 | 68527-15-1 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-149-00-9 | Gases (petroleum), benzene unit hydrotreater depentanizer overheadsRefinery gas[A complex combination produced by treating the feed from the benzene unit with hydrogen in the presence of a catalyst followed by depentanizing. It consists primarily of hydrogen, ethane and propane with various small amounts of nitrogen, carbon monoxide, carbon dioxide and hydrocarbons having carbon numbers predominantly in the range of C1 through C6. It may contain trace amounts of benzene.] | H K | 271-623-5 | 68602-82-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-150-00-4 | Gases (petroleum), secondary absorber off, fluidized catalytic cracker overheads fractionatorRefinery gas[A complex combination produced by the fractionation of the overhead products from the catalytic cracking process in the fluidized catalytic cracker. It consists of hydrogen, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | H K | 271-625-6 | 68602-84-6 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-151-00-X | Petroleum products, refinery gasesRefinery gas[A complex combination which consists primarily of hydrogen with various small amounts of methane, ethane, and propane.] | H K | 271-750-6 | 68607-11-4 | Car. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
| | | | | | | | |
649-152-00-5 | Gases (petroleum), hydrocracking low-pressure separatorRefinery gas[A complex combination obtained by the liquid-vapor separation of the hydrocracking process reactor effluent. It consists predominantly of hydrogen and saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | H K | 272-182-1 | 68783-06-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-153-00-0 | Gases (petroleum), refineryRefinery gas[A complex combination obtained from various petroleum refining operations. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | H K | 272-338-9 | 68814-67-5 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-154-00-6 | Gases (petroleum), platformer products separator offRefinery gas[A complex combination obtained from the chemical reforming of naphthenes to aromatics. It consists of hydrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C2 through C4.] | H K | 272-343-6 | 68814-90-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-155-00-1 | Gases (petroleum), hydrotreated sour kerosine depentanizer stabilizer offRefinery gas[The complex combination obtained from the depentanizer stabilization of hydrotreated kerosine. It consists primarily of hydrogen, methane, ethane, and propane with various small amounts of nitrogen, hydrogen sulfide, carbon monoxide and hydrocarbons having carbon numbers predominantly in the range of C4 through C5.] | H K | 272-775-5 | 68911-58-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
| | | | | | | | |
649-156-00-7 | Gases (petroleum), hydrotreated sour kerosine flash drumRefinery gas[A complex combination obtained from the flash drum of the unit treating sour kerosine with hydrogen in the presence of a catalyst. It consists primarily of hydrogen and methane with various small amounts of nitrogen, carbon monoxide, and hydro-carbons having carbon numbers predominantly in the range of C2 through C5.] | H K | 272-776-0 | 68911-59-1 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-157-00-2 | Gases (petroleum), distillate unifiner desulfurization stripper offRefinery gas[A complex combination stripped from the liquid product of the unifiner desulfurization process. It consists of hydrogen sulfide, methane, ethane, and propane.] | H K | 272-873-8 | 68919-01-7 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-158-00-8 | Gases (petroleum), fluidized catalytic cracker fractionation offRefinery gas[A complex combination produced by the fractionation of the overhead product of the fluidized catalytic cracking process. It consists of hydrogen, hydrogen sulfide, nitrogen, and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 272-874-3 | 68919-02-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-159-00-3 | Gases (petroleum), fluidized catalytic cracker scrubbing secondary absorber offRefinery gas[A complex combination produced by scrubbing the overhead gas from the fluidized catalytic cracker. It consists of hydrogen, nitrogen, methane, ethane and propane.] | H K | 272-875-9 | 68919-03-9 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-160-00-9 | Gases (petroleum), heavy distillate hydrotreater desulfurization stripper offRefinery gas[A complex combination stripped from the liquid product of the heavy distillate hydrotreater desulfurization process. It consists of hydrogen, hydrogen sulfide, and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 272-876-4 | 68919-04-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-161-00-4 | Gases (petroleum), platformer stabilizer off, light ends fractionationRefinery gas[A complex combination obtained by the fractionation of the light ends of the platinum reactors of the plattformer unit. It consists of hydrogen, methane, ethane and propane.] | H K | 272-880-6 | 68919-07-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-162-00-X | Gases (petroleum), preflash tower off, crude distn.Refinery gas[A complex combination produced from the first tower used in the distillation of crude oil. It consists of nitrogen and saturated aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 272-881-1 | 68919-08-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-163-00-5 | Gases (petroleum), tar stripper offRefinery gas[A complex combination obtained by the fractionation of reduced crude oil. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | H K | 272-884-8 | 68919-11-9 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-164-00-0 | Gases (petroleum), unifiner stripper offRefinery gas[A combination of hydrogen and methane obtained by fractionation of the products from the unifiner unit.] | H K | 272-885-3 | 68919-12-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-165-00-6 | Tail gas (petroleum), catalytic hydrodesulfurized naphtha separatorRefinery gas[A complex combination of hydrocarbons obtained from the hydrodesulfurization of naphtha. It consists of hydrogen, methane, ethane, and propane.] | H K | 273-173-5 | 68952-79-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-166-00-1 | Tail gas (petroleum), straight-run naphtha hydrodesulfurizerRefinery gas[A complex combination obtained from the hydrodesulfurization of straight-run naphtha: It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 273-174-0 | 68952-80-7 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-167-00-7 | Gases (petroleum), sponge absorber off, fluidized catalytic cracker and gas oil desulfurizer overhead fractionationRefinery gas[A complex combination obtained by the fractionation of products from the fluidized catalytic cracker and gas oil desulfurizer. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | H K | 273-269-7 | 68955-33-9 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-168-00-2 | Gases (petroleum), crude distn. and catalytic crackingRefinery gas[A complex combination produced by crude distillation and catalytic cracking processes. It consists of hydrogen, hydrogen sulfide, nitrogen, carbon monoxide and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 273-563-5 | 68989-88-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-169-00-8 | Gases (petroleum), gas oil diethanolamine scrubber offRefinery gas[A complex combination produced by desulfurization of gas oils with diethanolamine. It consists predominantly of hydrogen sulfide, hydrogen and aliphatic hydrocarbons having carbon numbers in the range of C1 through C5.] | H K | 295-397-2 | 92045-15-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-170-00-3 | Gases (petroleum), gas oil hydrodesulfurization effluentRefinery gas[A complex combination obtained by separation of the liquid phase from the effluent from the hydrogenation reaction. It consists predominantly of hydrogen, hydrogen sulfide and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C3.] | H K | 295-398-8 | 92045-16-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-171-00-9 | Gases (petroleum), gas oil hydrodesulfurization purgeRefinery gas[A complex combination of gases obtained from the reformer and from the purges from the hydrogenation reactor. It consists predominantly of hydrogen and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | H K | 295-399-3 | 92045-17-5 | Carc.Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-172-00-4 | Gases (petroleum), hydrogenator effluent flash drum offRefinery gas[A complex combination of gases obtained from flash of the effluents after the hydrogenation reaction. It consists predominantly of hydrogen and aliphatic hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 295400-7 | 92045-18-6 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
| | | | | | | | |
649-173-00-X | Gases (petroleum), naphtha steam cracking high-pressure residualRefinery gas[A complex combination obtained as a mixture of the non-condensable portions from the product of a naphtha steam cracking process as well as residual gases obtained during the preparation of subsequent products. It consists predominantly of hydrogen and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C5 with which natural gas may also be mixed.] | H K | 295-401-2 | 92045-19-7 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-174-00-5 | Gases (petroleum), residue visbaking offRefinery gas[A complex combination obtained from viscosity reduction of residues in a furnace. It consists predominantly of hydrogen sulfide and paraffinic and olefinic hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 295-402-8 | 92045-20-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-177-00-1 | Gases (petroleum), C3-4Petroleum gas[A complex combination of hydrocarbons produced by distillation of products from the cracking of crude oil. It consists of hydrocarbons having carbon numbers in the range of C3 through C4, predominantly of propane and propylene, and boiling in the range of approximately -51oC to -1oC (-60 oF to 30 oF.)] | H K | 268-629-5 | 68131-75-9 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-178-00-7 | Tail gas (petroleum), catalytic cracked distillate and catalytic cracked naphtha fractionation absorberPetroleum gas[The complex combination of hydrocarbons from the distillation of the products from catalytic cracked distillates and catalytic cracked naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4.] | H K | 269-617-2 | 68307-98-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-179-00-2 | Tail gas (petroleum), catalytic polymn. naphtha fractionation stabilizerPetroleum gas[A complex combination of hydrocarbons from the fractionation stabilization products from polymerization of naphtha. It consists predominantly of hydrocarbons having carbon numbers in the range of C1 through C4.] | H K | 269-618-8 | 68307-99-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-180-00-8 | Tail gas (petroleum), catalytic reformed naphtha fractionation stabilizer, hydrogen sulfide-freePetroleum gas[A complex combination of hydrocarbons obtained from fractionation stabilization of catalytic reformed naphtha and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | H K | 269-619-3 | 68308-00-9 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-181-00-3 | Tail gas (petroleum), cracked distillate hydrotreater stripperPetroleum gas[A complex combination of hydrocarbons obtained by treating thermal cracked distillates with hydrogen in the presence of a catalyst. It consists predominantly of saturated hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 269-620-9 | 68308-01-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
| | | | | | | | |
649-182-00-9 | Tail gas (petroleum), straight-run distillate hydrodesulfurizer, hydrogen sulfide-freePetroleum gas[A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of straight run distillates and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | H K | 269-630-3 | 68308-10-1 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-183-00-4 | Tail gas (petroleum), gas oil catalytic cracking absorberPetroleum gas[A complex combination of hydrocarbons obtained from the distillation of products from the catalytic cracking of gas oil. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 269-623-5 | 68308-03-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-184-00-X | Tail gas (petroleum), gas recovery plantPetroleum gas[A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 269-624-0 | 68308-04-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-185-00-5 | Tail gas (petroleum), gas recovery plant deethanizerPetroleum gas[A complex combination of hydrocarbons from the distillation of products from miscellaneous hydrocarbon streams. It consists of hydrocarbon having carbon numbers predominantly in the range of C1 through C4.] | H K | 269-625-6 | 68308-05-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
| | | | | | | | |
649-186-00-0 | Tail gas (petroleum), hydrodesulfurized distillate and hydrodesulfurized naphtha fractionator, acid-freePetroleum gas[A complex combination of hydrocarbons obtained from fractionation of hydrodesulfurized naphtha and distillate hydrocarbon streams and treated to remove acidic impurities. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 269-626-1 | 68308-06-5 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-187-00-6 | Tail gas (petroleum), hydrodesulfurized vacuum gas oil stripper, hydrogen sulfide-freePetroleum gas[A complex combination of hydrocarbons obtained from stripping stabilization of catalytic hydrodesulfurized vacuum gas oil and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 269-627-7 | 68308-07-6 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-188-00-1 | Tail gas (petroleum), light straight-run naphtha stabilizer, hydrogen sulfide-freepetroleum gas[A complex combination of hydrocarbons obtained from fractionation stabilization of light straight run naphtha and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C5.] | H K | 269-629-8 | 68308-09-8 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-189-00-7 | Tail gas (petroleum), propane-propylene alkylation feed prep deethanizerPetroleum gas[A complex combination of hydrocarbons obtained from the distillation of the reaction products of propane with propylene. It consists of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.) | H K | 269-631-9 | 68308-11-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-190-00-2 | Tail gas (petroleum), vacuum gas oil hydrodesulfurizer, hydrogen sulfide-freePetroleum gas[A complex combination of hydrocarbons obtained from catalytic hydrodesulfurization of vacuum gas oil and from which hydrogen sulfide has been removed by amine treatment. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C6.] | H K | 269-632-4 | 68308-12-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-191-00-8 | Gases (petroleum), catalytic cracked overheadsPetroleum gas[A complex combination of hydrocarbons produced by the distillation of products from the catalytic cracking process. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C5 and boiling in the range of approximately -48oC to 32oC (-54oF to 90oF).] | H K | 270-071-2 | 68409-99-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-193-00-9 | Alkanes, C1-2Petroleum gas | H K | 270-651-5 | 68475-57-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-194-00-4 | Alkanes, C2-3Petroleum gas | H K | 270-652-0 | 68475-58-1 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-195-00-X | Alkanes, C3-4petroleum gas | H K | 270-653-6 | 68475-59-2 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-196-00-5 | Alkanes, C4-5Petroleum gas | H K | 270-654-1 | 68475-60-5 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-197-00-0 | Fuel gasesPetroleum gas[A combination of light gases. It consists predominantly of hydrogen and/or low molecular weight hydrocarbons.] | H K | 270-667-2 | 68476-26-6 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-198-00-6 | Fuel gases, crude oil of distillatesPetroleum gas[A complex combination of light gases produced by distillation of crude oil and by catalytic reforming of naphtha. It consists of hydrogen and hydrocarbons having carbon numbers predominantly in the range of C1 through C4 and boiling in the range of approximately -217oC to -12 oC(-423 oF to 10 oF).] | H K | 270-670-9 | 68476-29-9 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-199-00-1 | Hydrocarbons, C3-4Petroleum gas | H K | 270-681-9 | 68476-40-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-200-00-5 | Hydrocarbons, C4-5Petroleum gas | H K | 270-682-4 | 68476-42-6 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-201-00-0 | Hydrocarbons, C2-4, C3-richPetroleum gas | H K | 270-689-2 | 68476-49-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-202-00-6 | Petroleum gases, liquefiedPetroleum gas[A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C7 and boiling in the range of approximately -40 oC to 80 oC (-40 oF to 176 oF).] | HKS | 270-704-2 | 68476-85-7 | F+; R12Carc. Cat. 1; R45Muta. Cat. 2; R46 | F+; TR: 12-45-46S: 53-45 | | |
649-203-00-1 | Petroleum gases, liquefied, sweetenedPetroleum gas[A complex combination of hydrocarbons obtained by subjecting liquefied petroleum gas mix to a sweetening process to convert mercaptans or to remove acidic impurities. It consists of hydrocarbons having carbon numbers predominantly in the range of C3 through C7 and boiling in the range of approximately -40 oC to 80 oC (-40oFtol76oF).] | HKS | 270-705-8 | 68476-86-8 | F+; R12Carc. Cat. 1; R45Muta. Cat. 2; R46 | F+; TR: 12-45-46S: 45-53 | | |
649-204-00-7 | gases (petroleum), C3-4, isobutane-richPetroleum gas[A complex combination of hydrocarbons from the distillation of saturated and unsaturated hydrocarbons usually ranging in carbon numbers from C3 through C6, predominantly butane and isobutane. It consists of saturated and unsaturated hydrocarbons having carbon numbers in the range of C3 through C4, predominantly isobutane.] | H K | 270-724-1 | 68477-33-8 | Carc. Cat.. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-205-00-2 | Distillates (petroleum), C3-6, piperylene-richPetroleum gas[A complex combination of hydrocarbons from the distillation of saturated and unsaturated aliphatic hydrocarbons usually ranging in the carbon numbers C3 through C6. It consists of saturated and unsaturated hydrocarbons having carbon numbers in the range of C3 through C6, predominantly piperylenes.] | H K | 270-726-2 | 68477-35-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-206-00-8 | Gases (petroleum), butane splitter overheadsPetroleum gas[A complex combination of hydrocarbons obtained from the distillation of the butane stream. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C4.] | H K | 270-750-3 | 68477-69-0 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-207-00-3 | Gases (petroleum), C2.Petroleum gas[A complex combination of hydrocarbons produced by the distillation of products from a catalytic fractionation process. It contains predominantly ethane, ethylene, propane, and propylene.] | H K | 270-751-9 | 68477-70-3 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-208-00-9 | Gases (petroleum), catalytic-cracked gas oil depropanizer bottoms, C4-rich acid-freePetroleum gas[A complex combination of hydrocarbons obtained from fractionation of catalytic cracked gas oil hydrocarbon stream and treated to remove hydrogen sulfide and other acidic components. It consists of hydrocarbons having carbon numbers in the range of C3 through C5, predominantly C4.] | H K | 270-752-4 | 68477-71-4 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-209-00-4 | Gases (petroleum), catalytic-cracked naphtha debutanizer bottoms, C3-5-richPetroleum gas[A complex combination of hydrocarbons obtained from the stabilization of catalytic cracked naphtha. It consists of aliphatic hydrocarbons having carbon numbers predominantly in the range of C3 through C5.] | H K | 270-754-5 | 68477-72-5 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-210-00-X | Tail gas (petroleum), isomerized naphtha fractionation stabilizerPetroleum gas[A complex combination of hydrocarbons obtained from the fractionation stabilization products from isomerized naphtha. It consists predominantly of hydrocarbons having carbon numbers predominantly in the range of C1 through C4.] | H K | 269-628-2 | 68308-08-7 | Carc. Cat. 1; R45Muta. Cat. 2; R46 | TR: 45-46S: 53-45 | | |
649-224-00-6 | Fuels, dieselGasoil - unspecified[A complex combination of hydrocarbons produced by the distillation of crude oil. It consists of hydrocarbons having carbon numbers predominantly in the range of C9 through C20 and boiling in the range of approximately 163oC to 357oC (325 oF to 675 oF).] | H N | 269-822-7 | 68334-30-5 | Carc. Cat. 3; R40 | XnR: 40S: (2-)36/37 | | |
| | | | | | | | |
005-009-00-3 | tetrabutylammoniumbutyltriphenylborate | | 418-080-4 | 120307-06-4 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-56-61 | | |
005-010-00-9 | N,N-dimethylaniliniumtetrakis(pentafluorophenyl)borate | | 422-050-6 | 118612-00-3 | Carc.Cat.3; R40Xn; R22Xi; R38-41 | XnR: 22-38-40-41S: (2-)22-26-36/37/39 | | |
005-012-00-X | diethyl{4-[1,5,5-tris(4-diethylaminophenyl)penta-2,4-dienylidene]cyclohexa-2,5-dienylidene} ammonium butyltriphenylborate | | 418-070-1 | 141714-54-7 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 | | |
011-007-00-3 | propoxycarbazone-sodium | | - | - | N; R50-53 | NR: 50/53S: 60-61 | C ≥ 2,5 %: N; R50/530,25 % ≤ C < 2,5 %: N; R51/530,025 ≤ C < 0,25 %: R52/53 | |
013-009-00-X | sodium((n-butyl)x(ethyl)y-1,5-dihydro)aluminate) x = 0.5 y = 1.5 | | 418-720-2 | - | F; R11R14/15R 17Xn; R20C; R35 | F; CR: 11-14/15-17-20-35S: (1/2-)6-16-26-30-36/37/39-43-45 | | |
014-026-00-5 | dichloro-(3-(3-chloro-4-fluorophenyl)propyl)methylsilane | | 407-180-3 | - | C; R35 | CR:35S: (1/2-)26-36/37/39-45 | | |
014-027-00-0 | chloro(3-(3-chloro-4-fluorophenyl)propyl)dimethylsilane | | 410-270-5 | - | C; R35 | CR:35S: (1/2-)8-26-28-36/37/39-45 | | |
014-028-00-6 | α-[3-(1-oxoprop-2-eny)l-1-oxypropyl]dimethoxysilyloxy-ω-[3(1-oxoprop-2-enyl)-1-oxypropyl]dimethoxysilyl poly(dimetliylsiloxane) | | 415-290-8 | - | R 43 | XiR:43S: (2-)24-37 | | |
014-029-00-1 | O,O'-(ethenylmethylsilylene)di[(4-methylpentan-2-one)oxime] | | 421-870-1 | - | Repr. Cat. 3; R62Xn; R22-48/22 | XnR: 22-48/22-62S: (2-)36/37 | | |
014-030-00-7 | [(dimethylsilylene)bis((1,2,3,3a,7a-η)-1H-inden-1-ylidene)dimethyl]hafnium | | 422-060-0 | 137390-08-0 | T+; R28 | T+R: 28S: (1/2-)6-22-28-36/37-45 | | |
014-031-00-2 | bis(1-methylethyl)-dimethoxysilane | | 421-540-7 | 18230-61-0 | R10Xi; R38R43R 52-53 | XiR: 10-38-43-52/53S: (2-)24-37-61 | | |
| | | | | | | | |
014-032-00-8 | dicyclopentyldimethoxysilane | | 404-370-8 | 126990-35-0 | Xi; R38-41N; R50-53 | Xi; NR: 38-41-50/53S: (2-)26-37/3,9-60-61 | | |
015-180-00-6 | [R-(R*,S*)]-[[2-methyl-1-(1-oxopropoxy)propoxyl-(4-phenylbutyl)phosphinyll acetic acid, (-)-cinchonidine (1:1) salt | | 415-820-8 | 137590-32-0 | Xi; R41R 43R 52-53 | XiR: 41-43-52/53S: (2-)24-26-37/39-61 | | |
015-181-00-1 | phosphine | | 232-260-8 | 7803-51-2 | F+; R12R17T+; R26C; R34N; R50 | F+; T+; NR: 12-17-26-34-50S: (1/2-)28-36/37-45-61-63 | | |
015-184-00-8 | Salts of glyphosate, with the exception of those specified elsewhere in this Annex | | - | - | N; R51-53 | NR: 51/53S: 61 | | |
015-186-00-9 | chlorpyrifos-methyl | | 227-011-5 | 5598-13-0 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)36/37-60-61 | C ≥ 1 %: N; R43-50-530,0025 % ≤C < 1 %: N; R5O-530,00025 % ≤C < 0,0025 %: N; R51-530,000025 % ≤C < 0,00025 %: R52-53 | |
015-187-00-4 | A mixture of: tetrasodium(((2-hydroxyethyl)i mino)bis(methylen e))bisphosphonate, N-oxide; trisodium ((tetrahydro-2-hydroxy-4H-1,4,2-oxazaphosphorin-4-yl)-methyl)phosphonate, N-oxide, P-oxide | | 417-540-1 | - | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 | | |
015-189-00-5 | phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide | | 423-340-5 | 162881-26-7 | R43R53 | XiR: 43-53S: (2-)22-24-37-61 | | |
016-086-00-8 | tetrasodium 10-amino-6,13-dichloro-3-(3-(4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate | | 402-590-9 | 109125-56-6 | Xi; R41 | XiR:41S: (2-)22-26-39 | | |
016-087-00-3 | A mixture of: thiobis(4,1-phenylene)-S,S,S',S'-tetraphenyldisulfoniumbishexafluorophosphate diphenyl(4-phenylthiophenyl)sulfoniumhexafluorophosphatepropylene carbonate | | 403-490-8 | 74227-35-3 | Xi; R36R43N; R50-53 | Xi; NR: 36-43-50/53S: (2-)24-26-37-60-61 | | |
016-088-00-9 | 4-(bis(4-(diethylamino)phenyl)methyl)benzene-1,2-dimethanesulfonic acid | | 407-280-7 | 71297-11-5 | R 52-53 | R: 52/53S: 61 | | |
016-089-00-4 | A mixture of esters of 5,5',6,6',7,7'-hexahydroxy-3,3,3',3'-tetramethyl-1,1'-spirobiindan and 2-diazo-1,2-dihydro-1-oxo-5-sulfonaphthalene | | 413-840-1 | - | E; R2F; R11R 53 | ER: 2-11-53S: (2-)33-35-40-61 | | |
016-090-00-X | 4-methyl-N-(methylsulfonyl)benzenesulfonamide | | 415-040-8 | 14653-91-9 | Xn; R22Xi; R37-41 | XnR: 22-37-41S: (2-)26-39 | | |
016-091-00-5 | C12-14-tert-alkyl ammonium 1-amino-9,10-dihydro-9,10-dioxo-4-(2,4,6-trimethylanilino)-anthracen-2-sulfonate | | 414-110-5 | - | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)26-39-60-61 | | |
016-093-00-6 | A 2:1 mixture of: 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinol-4-yl-tris(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate) 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinolbis(6-diazo-5,6-dihydro- 5-oxonaphthalen-1-sulfonate) | | 414-770-4 | 140698-96-0 | F; R11Carc. Cat. 3; R40 | F; XnR: 11-40S: (2-)7-36/37 | | |
016-095-00-7 | A mixture of: reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:2) Reaction product of 4,4'-methylenebis [2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:3) | | 417-980-4 | - | F; R11Carc.Cat.3; R40 | F; XnR: 11-40S: (2-)7-36/37 | | |
016-096-00-2 | thifensulfuron-methyl | | - | 79277-27-3 | N; R50-53 | NR: 50/53S: 60-61 | | |
017-015-00-3 | (2-(aminomethyl)phenyl)acetylchloride hydrochloride | | 417-410-4 | 61807-67-8 | Xn; R22C; R35R43 | CR: 22-35-43S: (1/2-)26-36/37/39-45 | | |
017-016-00-9 | methyltriphenylphosphoniumchloride | | 418-400-2 | 1031-15-8 | Xn; R21/22Xi; R38-41N; R51-53 | Xn; NR: 21/22-38-41-51/53S: (2-)22-26-36/37/39-61 | | |
017-017-00-4 | (Z)-13-docosenyl-N,N-bis(2-hydroxyethyl)-N-methyl-ammonium-chloride | | 426-210-6 | 120086-58-0 | C; R34N; R50-53 | C; NR: 34-50/53S: (2-)26-36/37/39-45-60-61 | | |
017-018-00-X | N,N,N-trimethyl-2,3-bis(stearoyloxy)propylammonium chloride | | 405-660-7 | - | N;R51-53 | NR: 51/53S: 61 | | |
017-019-00-5 | (R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-veratrylisoquinoline hydrochloride | | 415-110-8 | 54417-53-7 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)22-61 | | |
017-020-00-0 | ethyl propoxy aluminium chloride | | 421-790-7 | - | C; R35F; R14/15 | C; FR: 14/15-35S: (1/2-)16-23-26-30-36/37/39-43-45 | | |
017-021-00-6 | behenamidopropyl-dimethyl-(dihydroxypropyl) ammonium chloride | | 423-420-1 | 136920-10-0 | Xi; R41R43N; R50-53 | Xi; NR: 41-43-50/53S: (2-)26-36/37/39-60-61 | | |
020-003-00-0 | A mixture of: dicalcium (bis(2-hydroxy-5-tetra-propenylphenylmethyl) methylami ne)dihydroxidetri-calcium (tris(2-hydroxy-5-tetra-propenylphenylmethyl)methylami ne)tri-hydroxidepoly[calcium ((2-hydroxy-5-tetra-propenyl-phenylmethyl)methylamine)hydr oxide] | | 420-470-4 | - | Xi; R36/38R43 | XiR: 36/38-43S: (2-)24-26-37 | | |
024-019-00-9 | Main component: acetoacetic acid anilide/3-amino-1-hydroxybenzene (ATAN-MAP): trisodium {6-[(2 or 3 or 4)-amino-(4 or 5 or 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato}-{6"-[1-(phenylcarbamoyl)ethylazo]-5"'-(phenylsulfamoyl)-3"-sulfonatonaphthalene-2"-azobenzene-1",2"'-diolato ] chromate (III)by-product 1: acetoacetic acid anilide /acetoacetic acid anilide (ATAN-ATAN): trisodium bis {6-[1-(phenylcarbamoyl)ethylazo]-5'-(phenylsulfonyl)-3 -sulfonatonaphthalene-2-azobenzene-1,2'-diolatojchromate (III)by-product 2: 3-amino-1-hydroxybenzene /3-amino-1-hydroxybenzene (MAP-MAP): trisodium bis {6-[(2 or 3 or 4)-amino-(4 or 5 or 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato} chromate (III) | | 419-230-1 | - | R 43R52-53 | XiR: 43-52/53S: (2-)22-24-37-61 | | |
024-020-00-4 | trisodium bis[(3'-nitro-5'-sulfonato(6-amino-2-[4-(2-hydroxy-1-naphtylazo)phenylsulfonylamino] pyrimidin-5-azo)benzene-2',4-diolato)]chromate(III) | | 418-220-4 | - | R43R52-53 | XiR: 43-52/53S: (2-)22-24-37-61 | | |
025-005-00-5 | A mixture of: tri-sodium [29H,31H-phthalocyanine-C,C,C-trisulfonato (6-)-N29,N30,N31,N32] manganate (3-)tetrasodium [29H,31H-phthalocyanine-C,C,C,C-tetrasulfonato (6-)-N29,N30,N31,N32], manganate (3-)pentasodium [29H,31H-phthalocyanine-C,C,C,C,C-pentasulfonato (6-)-N29,N30,N31,N32] manganate (3-) | | 417-660-4 | - | N; R50-53 | NR: 50/53S: 60-61 | | |
029-012-00-4 | sodium ((N-(3-trimethylammoniopropyl)sulfamoyl)methylsulfonatophthalocyaninato)copper(II) | | 407-340-2 | 124719-24-0 | Xi; R41 | XiR: 41S: (2-)26-39 | | |
029-013-00-X | trisodium(2-(α-(3-(4-chloro-6-(2-(2-(vinylsulfonyl)ethoxy)ethylamino )-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)benzylidenehydrazino)-4-sulfonatobenzoato)copper(Il) | | 407-580-8 | 130201-51-3 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)24-37-61 | | |
030-011-00-6 | trizinc bis(orthophosphate) | | 231-944-3 | 7779-90-0 | N; R50-53 | NR: 50/53S: 60-61 | | |
030-013-00-7 | zinc oxide | | 215-222-5 | 1314-13-2 | N; R50-53 | NR: 50/53S: 60-61 | | |
034-003-00-3 | sodium selenite | | 233-267-9 | 10102-18-8 | T+; R28T; R23R31R43N; R51-53 | T+; NR: 23-28-31-43-51/53S: (1/2-)28-36/37-45-61 | | |
053-005-00-5 | (4-(1-methylethyl)phenyl)-(4-methylphenyl)iodoniumtetrakis(pentafluorophenyl)borate (1-) | | 422-960-3 | 178233-72-2 | Xn; R21/22-48/22N; R50-53 | Xn; NR: 21/22-48/22-50/53S: (2-)22-36/37-60-61 | | |
601-056-00-4 | A mixture of isomers of:methyldiphenylmethanedimethyldiphenylmethane | | 405-470-4 | - | Xi; R38N; R50-53 | Xi; NR: 38-50/53S: (2-)37-60-61 | | |
601-057-00-X | N-dodecyl-[3-(4-dimethylamino)benzamido)-propyl]dimethylammonium tosylate | | 421-130-8 | 156679-41-3 | Xi; R41R43N; R50-53 | Xi; NR: 41-43-50/53S: (2-)24-26-37/39-60-61 | | |
601-058-00-5 | di-L-para-menthene | | 417-870-6 | - | Xi; R38R 43N; R50-53 | Xi; NR: 38-43-50/53S: (2-)23-24-37-60-61 | | |
601-059-00-0 | methyl 2-benzylidene-3-oxobutyrate | | 420-940-9 | 15768-07-7 | Xi; R36/38N; R51-53 | Xi; NR: 36/38-51/53S: (2-)26-37/39-61 | | |
601-060-00-6 | 1,2-bis[4-fluoro-6-{4-sulfo-5-(2-(4-sulfonaphtalene-3-ylazo)-1-hydroxy-3,6-disulfo-8-aminonaphthalene-7-ylazo)phenylamino}-1,3,5-triazin-2ylaminolethane;x-sodium, y-potassium salts x = 7,755 y = 0,245 | | 417-610-1 | 155522-09-1 | R 43 | XiR:43S: (2-)22-24-37 | | |
601-061-00-1 | (ethyl-1,2-ethanediyl)[-2-[[[(2-hydroxyethyl)methylamino]acetyl]-propyl]ω-(nonylphenoxy)poly]oxy-(methyl-1,2-ethanediyl) | | 418-960-8 | - | C; R34R 43N; R51-53 | C; NR: 34-43-51/53S: (1/2-)26-28-36/37/39-45-61 | | |
601-062-00-7 | A mixture of: branched triacontanebranched dotriacontanebranched tetratriacontanebranched hexatriacontane | | 417-030-9 | 151006-59-6 | R 53 | R: 53S: 61 | | |
601-063-00-2 | A mixture of isomers of branched tetracosane | | 417-060-2 | 151006-61-0 | Xn; R20R53 | XnR: 20-53S: (2-)61 | | |
601-064-00-8 | branched hexatriacontane | | 417-070-7 | 151006-62-1 | R53 | R: 53S: 61 | | |
601-065-00-3 | A mixture of: (1'-α,3',6'-α-2,2,3',7',7'-pentamethylspiro(1,3-dioxane-5,2'-norcarane) (1'α,3'β,6'α)-2,2,3',7',7'-pentamethylspiro( 1,3-dioxane-5,2'-norcarane) | | 416-930-9 | - | Xn; R48/22Xi; R41N; R51-53 | Xn; NR: 41-48/22-51/53S: (2-)22-26-37/39-61 | | |
601-066-00-9 | 1-(4-(trans-4-heptylcyclohexyl)phenyl)ethane | | 426-820-2 | 78531-60-9 | R43R53 | XiR: 43-53S: (2-)24-37-61 | | |
601-067-00-4 | triethyl arsenate | | 427-700-2 | 15606-95-8 | Carc. Cat. 1; R45T; R23/25N; R50-53 | T; NR: 45-23/25-50/53S: 53-45-60-61 | | |
601-068-00-X | 1,2-diacetoxybut-3-ene | | 421-720-5 | 18085-02-4 | Xn; R22 | XnR: 22S: (2-) | | |
601-069-00-5 | 2-ethyl-1-(2-(1,3-dioxanyl)ethyl)-pyridinium bromide | | 422-680-1 | - | R52-53 | R: 52/53S: 61 | | |
601-071-00-6 | 1-dimethoxymethyl-2-nitrobenzene | | 423-830-9 | 20627-73-0 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 | | |
601-073-00-7 | 1-bromo-3,5-difluorobenzene | | 416-710-2 | 461-96-1 | R10Xn; R22-48/22Xi; R38R43N; R50-53 | Xn; NR: 10-22-38-43-48/22-50/53S: (2-)24-36/37-60-61 | | |
601-074-00-2 | A mixture of: 4-(2,2,3-trimethylcyclopent-3-en-1-yl)-1-methyl-2-oxabicyclo[2.2.2]octane 1-(2,2,3-trimethylcyclopent-3-en-1-yl)-5-methyl-6-oxabicyclo[3.2.1]octane spiro[cyclohex-3-en-1-yl-[(4,5,6,6a-tetrahydro-3,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]cyclopenta[b]furan] spiro[cyclohex-3-en-1-yl-[4,5,6,6a-tetrahydro-4,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]cyclopenta[b]]furan] | | 422-040-1 | - | Xi; R36/38N; R51-53 | Xi; NR: 36/38-51/53S: (2-)26-37-61 | | |
602-093-00-9 | α,α,α4-tetrachlorotoluenep-chlorobenzotrichloride | E | 226-009-1 | 5216-25-1 | Carc. Cat. 2; R45Repr. Cat. 3; R62T; R48/23Xn; R21/22Xi; R37/38 | TR: 45-21/22-37/38-48/23-62S: 53-45 | | |
602-094-00-4 | diphenylether; octabromo derivate | | 251-087-9 | 32536-52-0 | Repr. Cat. 2; R61Repr. Cat. 3; R62 | TR: 61-62S: 53-45 | | |
602-096-00-5 | malachite green hydrochloride[1]malachite green oxalate[2] | | 209-322-8[1]219-441-7[2] | 569-64-2 [1]18015-76-4 [2] | Xn; R22Xi; R41Repr. Cat. 3; R63N; R50-53 | Xn; NR: 22-41-63-50/53S: (2-)26-36/37-39-46-60-61 | | |
602-097-00-0 | 1-bromo-9-(4,4,5,5,5-pentafluoropentylthio)nonane | | 422-850-5 | 148757-89-5 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 | | |
603-167-00-3 | 3,3',5,5'-tetra-tert-butylbiphenyl-2,2'-diol | | 407-920-5 | 6390-69-8 | R 53 | R: 53S: 61 | | |
603-168-00-9 | 3-(2-ethylhexyloxy)propane-1,2-diol | | 408-080-2 | 70445-33-9 | Xi; R41R 52-53 | XiR: 41-52/53S: (2-)26-39-61 | | |
603-169-00-4 | (+/-)-trans-4-(4-fluorophenyl)-3-hydroxymethyl-N-methylpiperidine | | 415-550-0 | 109887-53-8 | Xn; R22Xi; R41N; R51-53 | Xn; NR: 22-41-51/53S: (2-)22-26-39-61 | | |
603-170-00-X | A mixture of: 2-methyl-1-(6-methylbicyclo[2.2.1] hept-5-en-2-yl)pent-1-en-3-ol2-methyl-1-(1-methylbicycloL2.2.1]hept-5-en-2-yl)-pent-1-en-3-ol2-methyl-1-(5-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol | | 415-990-3 | 67739-11-1 | Xi; R36N; R51-53 | Xi; NR: 36-51/53S: (2-)26-61 | | |
603-171-00-5 | 5-thiazolylmethanol | | 414-780-9 | 38585-74-9 | Xi; R41R 52-53 | XiR: 41-52/53S: (2-)26-39-61 | | |
603-172-00-0 | mono-2-[2-(4-dibenzo[b,f][1,4]thiazepin-11-yl)piperazinium-1-yl]ethoxy)ethanol trans-butenedioate | | 415-180-1 | - | Xn; R22Xi; R41N; R51-53 | Xn; NR: 22-41-51/53S: (2-)22-26-39-61 | | |
603-173-00-6 | 4,4-dimethyl-3,5,8-trioxabicyclo[5.1.0] octane | | 421-750-9 | 57280-22-5 | Xi; R36R 43 | XiR: 36-43S: (2-)26-36/37 | | |
603-174-00-1 | 4-cyclohexyl-2-methyl-2-butanol | | 420-630-3 | 83926-73-2 | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 | | |
603-175-00-7 | 2-(2-hexyloxyethoxy)ethanolDEGHEdiethylene glycol monohexylether3,6-dioxa-1-dodecanol hexyl carbitol3,6-dioxadodecan-1-ol | | 203-988-3 | 112-59-4 | Xn; R21Xi; R41 | XnR: 21-41S: (2-)26-36/37-46 | | |
603-176-00-2 | 1,2-bis(2-methoxyethoxy)ethaneTEGDMEtriethylene glycol dimethyl ether triglyme | | 203-977-3 | 112-49-2 | R19Repr. Cat.2; R61Repr. Cat.3; R62 | TR: 61-19-62S: 53-45 | | |
603-177-00-8 | 1-ethoxypropan-2-ol2PG1EE1-ethoxy-2-propanolpropylene glycol monoethyl ether[1]2-ethoxy-1-methylethyl acetate2PG1EEA[2] | | 216-374-5[1]259-370-9[2] | 1569-02-4 [1]54839-24-6 [2] | R10R67 | R: 10-67S: (2-)24 | | |
603-178-00-3 | 2-hexyloxyethanol ethylene glycol monohexyl ether n-hexylglycol | | 203-951-1 | 112-25-4 | XnR21/22C; R34 | CR: 21/22-34S: (1/2-)26-36/37/39-45 | | |
603-179-00-9 | ergocalciferolVitamin D2 | 200-014-9 | 50-14-6 | T+; R26T; R24/25-48/25 | T+R: 24/25-26-48/25S: (1/2-)28-36/37-45 | | |
603-180-00-4 | colecalciferolVitamin D3 | | 200-673-2 | 67-97-0 | T+; R26T; R24/25-48/25 | T+R: 24/25-26-48/25S: (1/2-)28-36/37-45 | | |
603-181-00-X | tert- butyl methyl etherMTBE2-methoxy-2-methylpropane | | 216-653-1 | 1634-04-4 | F; R11Xi; R38 | F; XiR: 11-38S: (2-)9-16-24 | | |
603-183-00-0 | 2-[2-(2-butoxyethoxy)ethoxy]ethanolTEGBEtriethylene glycol monobutyl etherbutoxytriethylene glycol | | 205-592-6 | 143-22-6 | Xi; R41 | XiR: 41S: (2-)26-39-46 | C ≥ 30 %:Xi; R4120 % ≤ C < 30 %: Xi; R36 | |
603-184-00-6 | 2-(hydroxymethyl)-2-[[2-hydroxy-3-(isooctadecyloxy)propoxy]methyl ]-1,3-propanediol | | 416-380-1 | 146925-83-9 | N; R50-53 | NR: 50/53S: 60-61 | | |
603-185-00-1 | 2,4-dichloro-3-ethyl-6-nitrophenol | | 420-740-1 | 99817-36-4 | T; R25Xi; R41R43N; R50-53 | T; NR: 25-41-43-50/53S: (1/2-)26-36/37/39-45-60-61 | | |
603-186-00-7 | trans-(5RS,6SR)-6-amino-2,2-dimethyl-1,3-dioxepan-5-ol | | 419-050-3 | 79944-37-9 | R 43 | XiR: 43S: (2-)22-24/25-26-37 | | |
603-187-00-2 | 2-((4,6-bis(4-(2-(1-methylpyridinium-4-yl)vinyl)phenylamino)-1,3j5-triazin-2-yl)(2-hydroxyethyl)amino)ethanol dichloride | | 419-360-9 | 163661-77-6 | N; R50-53 | NR: 50/53S: 60-61 | | |
603-189-00-3 | A mixture of complexes of:titanium, 2,2'-oxydiethanol, ammonium lactate, nitrilotris(2-propanol) and ethylene glycol | | 405-250-8 | - | N; R51-53 | NR: 51/53S: 61 | | |
603-191-00-4 | 2-(4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-5-(3-((2-ethylhexyl)oxy)-2-hydroxypropoxy)phenol | | 419-740-4 | 137658-79-8 | R53 | R: 53S: 61 | | |
603-195-00-6 | 2-[4-(4-methoxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]-phenol | | 430-810-3 | 154825-62-4 | R52-53 | R: 52/53S: 61 | | |
603-196-00-1 | 2-(7-ethyl-1H-indol-3-yl)ethanol | | 431-020-1 | 41340-36-7 | Xn; 22-48/22N; R51-53 | Xn; NR: 22-48/22-51/53S: (2-)36/37/39-61 | | |
603-197-00-7 | 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol | | 403-640-2 | 107534-96-3 | Repr.Cat.3; R63Xn; R22N; R51-53 | Xn; NR: 22-51/53-63S: (2-)22-36/37-61 | | |
603-199-00-8 | etoxazol | | - | 153233-91-1 | N; R50-53 | NR: 50/53S: 60-61 | C ≥ 0.25 %: N; R50/530.025 % ≤ C < 0.25 %:N; R51/530.0025 % ≤ C < 0.025 %: R52/53 | |
604-065-00-1 | 4,4',4"-(1-methylpropan-1-yl-3-ylidene)tris(2-cyclohexyl-5-methylphenol) | | 407-460-5 | 111850-25-0 | N; R51-53 | NR: 51/53S: 61 | | |
604-066-00-7 | A mixture of: phenol, 6-(1,1-dimethylethyl)-4-tetrapropyl-2-[(2-hydroxy-5-tetra-propylphenyl)methyl (C41-compound) and methane, 2,2'-bis[6-(1,1-dimethyl-ethyl)-1-hydroxy-4-tetrapropyl-phenyl)]-(C45-compound)2,6-bis(1,1-dimethylethyl)-4-tetra-propyl-phenol and 2-(1,1-dimethylethyl)-4-tetrapropyl-phenol2,6-bis[(6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol and 2-[(6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenylmethyl]-6-[1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol | | 414-550-8 | - | N; R50-53 | NR: 50/53S: 60-61 | | |
604-067-00-2 | A mixture of: 2,2'-[[-(2-hydroxyethyl)imino]bis(methylene)bis[4-dodecylphenol]formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 2)formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 3, 4 and higher) | | 414-520-4 | - | Xi; R38-41N; R50-53 | Xi; NR: 38-41-50/53S: (2-)26-37/39-60-61 | | |
604-068-00-8 | (+/-)-4-[2-[[3-(4-hydroxyphenyl)-1-methylpropy 1]amino]-1-hydroxyethyl]phenol hydrochloride | | 415-170-5 | 99095-19-9 | Xn; R20/22R 43 | XnR: 20/22-43S: (2-)24-26-37 | | |
604-069-00-3 | 2-(1-methylpropyl)-4-tert-butylphenol | | 421-740-4 | 51390-14-8 | C; R34N; R51-53 | C; NR: 34-51/53S: (1/2-)26-36/37/39-45-61 | | |
604-070-00-9 | triclosan2,4,4'-trichloro-2'-hydroxy-diphenyl-ether5-chloro-2-(2,4-dichlorophenoxy)phenol | | 222-182-2 | 3380-34-5 | Xi; R36/38N; R50-53 | Xi; NR: 36/38-50/53S: 26-39-46-60-61 | C ≥ 20%: Xi, N; R36/38-50/530,25 % ≤ C < 20 %: N; R50/530,025 % ≤ C < 0,25 %:N; R51/530,0025 % ≤ C < 0,025 %: R52/53 | |
605-031-00-9 | A mixture of: 2,2-dimethoxyethanal (this component is considered to be anhydrous in terms of identity, structure and composition.However, 2,2-dimethoxyethanal will exist in a hydrated form. 60% anhydrous is equivalent to 70.4% hydrate) water(Including free water and water in hydrated 2,2-dimethoxyethanal) | | 421-890-0 | - | R43 | XiR: 43S: (2-)24-37 | | |
606-062-00-0 | tetrahydrothiopyran-3-carboxaldehyde | | 407-330-8 | 61571-06-0 | Repr.Cat.2; R61Xi; R41R 52-53 | TR: 61-41-52/53S: 53-45-61 | | |
606-063-00-6 | (E)-3-(2-chlorophenyl)-2-(4-fluorophenyl)propenal | | 410-980-5 | 112704-51-5 | Xi; R36R 43 | XiR: 36-43S: (2-)24-26-37 | | |
606-064-00-1 | pregn-5-ene-3,20-dione bis(ethylene ketal) | | 407-450-0 | 7093-55-2 | R 53 | R: 53S: 61 | | |
606-065-00-7 | 1-(4-morpholinophenyl)butan-1-one | | 413-790-0 | - | N; R51-53 | NR: 51/53S: 61 | | |
606-066-00-2 | (E)-5[(4-chlorophenyl)methylene]-2,2-dimethylcyclopentanone | | 410-440-9 | 131984-21-9 | N; R51-53 | NR: 51/53S:61 | | |
606-067-00-8 | A mixture of: 1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-4-yl)ethanone1-(2,3,5,6,7,8-hexahydro-1,1-dimethyl-1H-benz(f)inden-4-yl)ethanone1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-5-yl)ethanone1-(2,3,6,7,8,9-hexahydro-3,3-dimethyl-1H-benz(g)inden-5-yl)ethanone | | 414-870-8 | 96792-67-5 | N; R50-53 | NR: 50/53S: 60-61 | | |
606-068-00-3 | 2,7,11-trimethyl-13-(2,6,6-trimethylcyclohex-1-en-1-yl)tridecahexaen-2,4,6,8,10,12-al | | 415-770-7 | 1638-05-7 | Xn; R48/22R 43R 52-53 | XnR: 43-48/22-52/53S: (2-)22-36/37-61 | | |
606-069-00-9 | spiro[1,3-dioxolane-2,5'-(4',4',8',8'-tetramethyl-hexahydro-3',9'-methanonaphthalene)] | | 415-460-1 | 154171-77-4 | N; R51-53 | NR: 51/53S: 24-61 | | |
606-070-00-4 | 5-(3-butyryl-2,4,6-trimethylphenyl)-2-[1-(ethoxyimino)propyl]-3-hydroxycyclohex-2-en-1-one | | 414-790-3 | 138164-12-2 | Repr.Cat.3; R62-63Xn; R22Xi; R38N; R50-53 | Xn; NR: 22-38-62-63-50/53S: (2-)22-36/37-60-61 | | |
606-071-00-X | 17-spiro(5,5-dimethyl-1,3-dioxan-2-yl)androsta-1,4-diene-3-one | | 421-050-3 | 13258-43-0 | N; R50-53 | NR: 50/53S: 22-60-61 | | |
606-072-00-5 | 3-acetyl-1-phenyl-pyrrolidine-2,4-dione | | 421-600-2 | 719-86-8 | Xn; R48/22N; R51-53 | Xn; NR: 48/22-51/53S: (2-)22-36/37-61 | | |
606-073-00-0 | 4,4'-bis(dimethylamino)benzophenone Michler's ketone | | 202-027-5 | 90-94-8 | Carc.Cat.2; R45Muta.Cat.3; R68Xi; R41 | TR: 45-41-68S: 53-45 | | |
606-075-00-1 | 1-benzyl-5-ethoxyimidazolidine-2,4-dione | | 417-340-4 | 65855-02-9 | Xn; R22 | XnR: 22S: (2-)22 | | |
606-076-00-7 | 1-((2-quinolinyl-carbonyl)oxy)-2,5-pyrrolidinedione | | 418-630-3 | 136465-99-1 | Xi; R41R43 | XiR: 41-43S: (2-)24-26-37/39 | | |
606-077-00-2 | (3S,4S)-3-hexyl-4-[(R)-2-hydroxytridecyl]-2-oxetanone | | 418-650-2 | 104872-06-2 | N; R50-53 | NR: 50/53S: 60-61 | | |
606-078-00-8 | 1-octylazepin-2-one | | 420-040-6 | 59227-88-2 | C; R34R 43N; R51-53 | C; NR: 34-43-51/53S: (1/2-)26-36/37/39-45-61 | | |
606-079-00-3 | 2-n-butyl-benzo[d]isothiazol-3-one | | 420-590-7 | - | C; R34R43N; R50-53 | C; NR: 34-43-50/53S: (1/2-)26-36/37/39-45-60-61 | | |
606-080-00-9 | Reaction product of: 3-hydroxy-5,7-di-tert-butylbenzofuran-2-one with o-xylene | | 417-100-9 | - | R 53 | R: 53S: 61 | | |
606-081-00-4 | (3β, 5α, 6β)-3-(acetyloxy)-5-bromo-6-hydroxy-androstan-17-one | | 419-790-7 | 4229-69-0 | R43R52-53 | XiR: 43-52/53S: (2-)22-36/37-61 | | |
606-082-00-X- | A mixture of: butan-2-one oxime syn-O,O'-di(butan-2-one oxime)diethoxysilane | | 406-930-7 | 96-29-7 | T; R48/22R43R52-53 | TR: 43-48/25-52/53S: (1/2-)25-36/37-45- 61 | | |
606-083-00-5 | 2-chloro-5-sec-hexadecylhydroquinone | | 407-750-1 | - | Xi; R36/38R43R52-53 | XiR: 36/38-43-52/53S: (2-)24-26-37-61 | | |
606-084-00-0 | 1-(4-methoxy-5-benzofuranyl)-3-phenyl-1,3-propanedione | | 414-540-3 | 484-33-3 | N; R50-53 | NR: 50/53S: 60-61 | | |
606-085-00-6 | (1R,4S)-2-azabicyclo[2.2.1 ] hept-5-en-3-one | | 418-530-1 | 79200-56-9 | Xn; R22Xi; R41R43 | XnR: 22-41-43S: (2-)24-26-37/39 | | |
606-086-00-1 | 1-(3,3-dimethylcyclohexyl)pent-4-en-1-one | | 422-330-8 | 56973-87-6 | N; R51-53 | NR: 51/53S: 61 | | |
606-087-00-7 | 6-ethyl-5-fluoro-4(3H)-pyrimidone | | 422-460-5 | 137234-87-8 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)60-61 | | |
606-088-00-2 | 2,4,4,7-tetramethyl-6-octen-3-one | | 422-520-0 | 74338-72-0 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)37-61 | | |
606-089-00-8 | A mixture of: 1,4-diamino-2-chloro-3-phenoxyanthraquinone 1,4-diamino-2,3-bis-phenoxyanthraquinone | | 423-220-2 | 12223-77-7 | R53 | R: 53S: 61 | | |
606-091-00-9 | 6-chloro-5-(2-chloroethyl)-1,3-dihydroindol-2-one | | 421-320-0 | 118289-55-7 | N; R50-53 | NR: 50/53S: 60-61 | | |
606-092-00-4 | A mixture of: (E)-oxacyclohexadec-12-en-2-one(E)-oxacyclohexadec-13-en-2-onea) (Z)-oxacyclohexadec-(12)-en-2-one and b) (Z)-oxacyclohexadec-(13)-en-2-one | | 422-320-3 | 111879-80-2 | N; R50-53 | NR: 50/53S: 60-61 | | |
| | | | | | | | |
607-379-00-7 | A mixture of: 2-[N-(2-hydroxyethyl)stearamido]ethyl stearatesodium [bis(2-(stearoyloxy)ethyl]amino] methylsulfonatesodium [bis(2-hydroxyethyl)amino]methylsulfonateN,N-bis(2-hydroxyethyl)stearamide | | 401-230-8 | 55349-70-7 | R52-53 | R: 52/53S: 61 | | |
607-380-00-2 | A mixture of: ammonium-1,2-bis(hexyloxycarbonyl)ethanesulfonateammonium-1-hexyloxycarbonyl-2-octyloxycarbonylethanesirlfonateammonium-2-hexyloxycarbonyl-1-octyloxycarbonylethanesulfonate | | 407-320-3 | - | Xi; R38-41R 52-53 | XiR: 38-41-52/53S: (2-)26-37/39-61 | | |
607-381-00-8 | mixed triesters of 2,2-bis(hydroxymethyl)butanol with C7-alkanoic acids and 2-ethylhexanoic acid | | 413-710-4 | - | R 53 | R:53S: 61 | | |
607-382-00-3 | 2-((4-amino-2-nitrophenyl)amino)benzoic acid | | 411-260-3 | 117907-43-4 | Xi; R41R 43R 52-53 | XiR: 41-43-52/53S: (2-)24-26-37/39-61 | | |
607-383-00-9 | A mixture of: 2,2,6,6-tetramethylpiperidin-4-yl-hexadecanoate2,2,6,6-tetramethylpiperidin-4-yl-octadecanoate | | 415-430-8 | 86403-32-9 | Xi; R41R 43N; R50-53 | Xi; NR: 41-43-50/53S: (2-)24-26-37/39-60-61 | | |
607-384-00-4 | A mixture of: esters of C14-C15 branched alcohols with 3,5-di-t-butyl-4-hydroxyphenyl propionic acidC15 branched and linear alkyl 3,5-bis( 1,1-dimethylethyl)-4-hydroxybenzenepropanoateC13 branched and linear alkyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoatem | | 413-750-2 | 171090-93-0 | R 53 | R: 53S: 61 | | |
607-385-00-X | Copolymer of vinyl-alcohol and vinyl acetate partially acetilized with 4-(2-(4-formylphenyl)ethenyl)-1-methylpyridinium methylsulfate | | 414-590-6 | 125229-74-5 | N; R51-53 | NR: 51/53S: 61 | | |
607-386-00-5 | A mixture of: tetradecanoic acid (42.5-47.5%)poly(1-7)lactate esters of tetradecanoic acid (52.5-57.5%) | | 412-580-6 | 174591-51-6 | Xi; R38-41R 43N; R50-53 | Xi; NR: 38-41-43-50/53S: (2-)24-26-37/39-60-61 | | |
607-387-00-0 | A mixture of: dodecanoic acid (35-40%)poly(1-7)lactate esters of dodecanoic acid (60-65%) | | 412-590-0 | 58856-63-6 | Xi; R38-41R 43N; R50-53 | Xi; NR: 38-41-43-50/53S: (2-)24-26-37/39-60-61 | | |
607-388-00-6 | 4-ethylamino-3-nitrobenzoic acid | | 412-090-2 | 2788-74-1 | Xn; R22R 43R 52-53 | XnR: 22-43-52/53S: (2-)22-24-37-61 | | |
607-389-00-1 | trisodium N,N-bis(carboxymethyl)-3-amino-2-hydroxypropionate | | 414-130-4 | 119710-96-2 | Xn; R22 | XnR: 22S: (2-)22 | | |
607-390-00-7 | 1,2,3,4-tetrahydro-6-nitro-quinoxaline | | 414-270-6 | 41959-35-7 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)22-61 | | |
607-391-00-2 | dimethylcyclopropane-1,1-dicarboxylate | | 414-240-2 | 6914-71-2 | R 52-53 | R: 52/53S: 61 | | |
607-392-00-8 | 2-phenoxyethyl 4-((5-cyano-1,6-dihydro-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)azo)benzoate | | 414-260-1 | 88938-37-8 | R 53 | R: 53S: 61 | | |
607-393-00-3 | 3-(cis-1-propenyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | | 415-750-8 | 106447-44-3 | R 43 | XiR: 43S: (2-)22-24-37 | | |
607-394-00-9 | 5-methylpyrazine-2-carboxylic acid | | 413-260-9 | 5521-55-1 | Xi; R41 | XiR: 41S: (2-)26-39 | | |
607-395-00-4 | A mixture of: sodium 1-tridecyl-4-allyl-(2 or 3)-sulfobutanedioatesodium 1-dodecyl-4allyl-(2 or 3)-sulfobutanedioate | | 410-230-7 | - | C; R34R 43N; R51-53 | C; NR: 34-43-51/53S: (1/2-)26-36/37/39-45-61 | | |
607-396-00-X | bis( 1,2,2,6,6-pentamethyl-4-piperidinyl) 2-(4-methoxybenzylidene)malonate | | 414-840-4 | 147783-69-5 | N; R50-53 | NR:50/53S: 22-60-61 | | |
607-397-00-5 | A mixture of: Ca salicylates (branched C 10-14 and C18-30 alkylated)Ca phenates (branched C10-14 and C18-30 alkylated)Ca sulfurized phenates (branched C10-14 and C18-30 alkylated) | | 415-930-6 | - | R 43 | XiR: 43S: (2-)36/37 | | |
607-398-00-0 | ethyl N-(5-chloro-3-(4-(diethylamino)-2-methylphenylimino)-4-methyl-6-oxo-1,4-cyclohexadienyl)carbamate | | 414-820-5 | 125630-94-6 | N; R50-53 | NR: 50/53S: 60-61 | | |
607-399-00-6 | 2,2-dimethyl 3-methyl-3-butenyl propanoate | | 415-610-6 | 104468-21-5 | Xi; R38R52-53 | XiR: 38-52/53S: (2-)37-61 | | |
607-400-00-X | methyl 3-[[(dibutylamino)thioxomethyl]thio]propanoate | | 414-400-1 | 32750-89-3 | N; R50-53 | NR: 50/53S: 60-61 | | |
607-401-00-5 | ethyl 3-hydroxy-5-oxo-3-cyclohexene-1-carboxylate | | 414-450-4 | 88805-65-6 | Xi; R38-41R 43 | XiR: 38-41-43S: (2-)24-26-37/39 | | |
607-402-00-0 | methyl N-(phenoxycarbonyl)-L-valinate | | 414-500-5 | 153441-77-1 | R 52-53 | R: 52/53S: 61 | | |
607-403-00-6 | A mixture of: bis(1S,2S,4S)-(1-benzyl-4-tert-butoxycarboxamido-2-hydroxy-5-phenyl)pentylammonuium succinate isopropyl alcohol | | 414-810-0 | - | Xn; R48/22Xi; R41N; R50-53 | Xn; NR: 41-48/22-50/53S: (2-)22-26-36/39-60-61 | | |
607-404-00-1 | A mixture of: ((Z)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropanoic aciddi-((E)-3,7-dimethyl-2,6-octadienyl) butandioatedi-((Z)-3,7-dimethyl-2,6-octadienyl) butandioate(Z)-3,7-dimethyl-2,6-octadienyl butandioate((E)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropanoic acid | | 415-190-4 | - | R 43 | XiR: 43S: (2-)24-37 | | |
| | | | | | | | |
607-405-00-7 | 2-hexyldecyl p-hydroxybenzoate | | 415-380-7 | 148348-12-3 | N; R51-53 | NR: 51/53S: 61 | | |
607-406-00-2 | potassium 2,5-dichlorobenzoate | | 415-700-5 | - | Xn; R22Xi; R41 | XnR: 22-41S: (2-)26-39 | | |
607-407-00-8 | ethyl 2-carboxy-3-(2-thienyl)propionate | | 415-680-8 | 143468-96-6 | Xi; R38-41R 43 | XiR: 38-41-43S: (2-)24-26-37/39 | | |
607-408-00-3 | potassium N-(4-fluorophenyl)glycinate | | 415-710-1 | - | Xn; R48/22Xi; R41R 43R 52-53 | XnR: 41-43-48/22-52/53S: (2-)22-26-36/37/39-61 | | |
607-409-00-9 | A mixture of: (3R)-[1S-(1α,2α,6β-((2S)-2-methyl-1-oxo-butoxy)-8a.gamma.)hexahydro-2,6-dimethyl-1-naphthalene]-3,5-dihydroxyheptanoic acid inert biomass from Aspergillus terreus | | 415-840-7 | - | R 43R 52-53 | XiR: 43-52/53S: (2-)36/37-61 | | |
607-410-00-4 | mono[2-(dimethylamino)ethyl]monohydrogen-2-(hexadec-2-enyl)butanedioate and/or mono[2-(dimethylamino)ethyl]monohydrogen-3-(hexadec-2-enyl)butanedioate | | 415-880-5 | - | Xi; R38-41R 43N; R50-53 | Xi; NR: 38-41-43-50/53S: (2-)24-26-37/39-60-61 | | |
607-411-00-X | oxiranemethanol, 4-methylbenzene-sulfonate, (S) | | 417-210-7 | 70987-78-9 | Carc.Cat.2; R45Muta.Cat.3; R68Xi; R41R43N; R51-53 | T; NR: 45-41-43-51/53S: 53-45-61 | | |
607-412-00-5 | ethyl 2-(1-cyanocyclohexyl)acetate | | 415-970-4 | 133481-10-4 | Xn; R22-48/22R 52-53 | XnR: 22-48/22-52/53S: (2-)36/37-61 | | |
607-413-00-0 | trans-4-phenyl-L-proline | | 416-020-1 | 96314-26-0 | Repr.Cat.3; R62R 43 | XnR: 43-62S: (2-)22-36/37 | | |
607-414-00-6 | tris(2-ethylhexyl)-4,4',4"-(1,3,5-triazine-2,4,6-triyltriimino)tribenzoate | | 402-070-1 | 88122-99-0 | R53 | R: 53S: 61 | | |
607-415-00-1 | poly-(methyl methacrylate)-co-(butylmethacrylate)-co-(4-acryloxybutyl-isopropenyl-.alpha.,.alpha.-dimethylbenzyl carbamate)-co-(maleicanhydride) | | 419-590-1 | - | F; R11R 43 | F; XiR: 11-43S: (2-)24-37-43 | | |
607-416-00-7 | 4-(2-carboxymethylthio)ethoxy-1-hydroxy-5-isobutyloxycarbonylamino-N-(3-dodecyloxypropyl)-2-naphthamide | | 420-730-7 | - | N; R50-53 | NR: 50/53S: 60-61 | | |
607-418-00-8 | 2-ethylhexyl 4-aminobenzoate | | 420-170-3 | 26218-04-2 | N; R50-53 | NR: 50/53S: 60-61 | | |
607-419-00-3 | (3'-carboxymethyl-5-(2-(3-ethyl-3H-benzothiazol-2-ylidene)-1-methyl-ethylidene)-4,4'-dioxo-2'-thioxo-(2,5')bithiazolidinyliden-3-yl)-acetic acid | | 422-240-9 | 166596-68-5 | Xi; R41R 43 | XiR: 41-43S: (2-)26-36/37/39 | | |
607-420-00-9 | 2,2-bis(hydroxymethyll)butanoic acid | | 424-090-1 | 10097-02-6 | Xi; R41R52-53 | XiR: 41-52/53S: (2-)26-39-61 | | |
607-421-00-4 | cypermethrin cis/trans +/- 40/60 (RS)-α-cyano-3-phenoxybenzyl (1RS,3RS;1RS,3SR)-3-(2,2- dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | | 257-842-9 | 52315-07-8 | Xn; R20/22Xi; R37N; R50-53 | Xn; NR: 20/22-37-50/53S: (2-)24-36/37/39-60-61 | | |
607-422-00-X | α-cypermethrin | | 257-842-9 | 67375-30-8 | T; R25Xn; R48/22Xi; R37N; R50-53 | T; NR: 25-37-48/22-50/53S: (2-)36/37/39-45-60-61 | | |
607-423-00-5 | esters of mecoprop and of mecoprop-P | | - | - | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)13-36/37-60-61 | | |
607-424-00-0 | trifloxystrobin (ISO)(E,E)-α-methoxyimino-{2-[[[[l-[3-(trifluoromethyl)phenyl]ethyliden e]amino]oxy] methyl]benzeneacetic acid methyl ester | | - | 141517-21-7 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-46-60-61 | | |
607-425-00-6 | metalaxyl (ISO)methyl-N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-DL-alaninate | | 260-979-7 | 57837-19-1 | Xn; R22R43R52-53 | XnR: 22-43-52/53S: (2-)13-24-37-46-61 | | |
607-426-00-1 | 1,2-benzenedicarboxylic acid,dipentylester, branched and linear[1]n-pentyl-isopentylphthalate[2]di-n-pentyl phthalate[3]diisopentylphthalate[4] | | 284-032-2[1]-[2]205-017-9[3]210-088-4[4] | 84777-06-0[1]-[2]131-18-0 [3]605-50-5 [4] | Repr.Cat.2; R60-61N; R50 | T; NR: 60-61-50S: 53-45-61 | | |
607-427-00-7 | bromoxynil heptanoate (ISO)2,6-dibromo-4-cyanophenyl heptanoate | | 260-300-4 | 56634-95-8 | Repr.Cat3; R63Xn; R20/22R43N; R50-53 | Xn; NR: 20/22-43-63-50/53S: (2-)36/37-46-60-61 | | |
607-430-00-3 | BBPbenzyl butyl phtalate | | 201-622-7 | 85-68-7 | Repr.Cat.2; R61Repr.Cat.3; R62N; R50-53 | T; NR: 61-62-50/53S: 53-45-60-61 | | |
607-431-00-9 | prallethrinETOC2-methyl-4-oxo-3-(prop-2-ynyl)cyclopent-2-en-1-y1 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate | | 245-387-9 | 23031-36-9 | T; R23Xn; R22N; R50-53 | T; NR: 22-23-50/53S: (1/2-)45-60-61 | | |
607-432-00-4 | S-metolachlormixture of (S)-2-chloro-N-2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamide (80-100%)[1]S-metolachlor(R)-2-chloro-N-(2-ethyl-6-methyl-phenyl)-N-(2-methoxy-1-methyl-ethyl)-acetamide (0-20%)[2] | | -[1]-[2] | 87392-12-9 [1]178961-20-1 [2] | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 | | |
607-433-00-X | cypermethrin cis/trans +/- 80/20 (RS)-α-cyano-3-phenoxybenzyl ( 1RS; 3RS; 1RS, 3SR)-3-(2,2- dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | | 257-842-9 | 52315-07-8 | Xn; R22Xi; R37/38R43N; R50-53 | Xn; NR: 22-37/38-43-50/53S: (2-)36/37/39-60-61 | | |
607-434-00-5 | mecoprop-P [1] and its salts (R)-2-(4-chloro-2-methylphenoxy)propionic acid | | 240-539-0 | 16484-77-8 | Xn; R22Xi; R41N; R51-53 | Xn; NR: 22-41-51/53S: (2-)13-26-37/39-46-61 | | |
607-435-00-0 | 2S-isopropyl-5R- methyl-1R-cyclohexyl 2,2-dihydroxyacetate | | 416-810-6 | 111969-64-3 | Xn; R48/22Xi; R41N; R51-53 | Xn; NR: 41-48/22-51/53S: (2-)22-26-36/39-61 | | |
607-436-00-6 | 2-hydroxy-3-(2-ethyl-4-methylimidazoyl)propyl neodecanoate | | 417-350-9 | - | Xi; R38-41N; R50-53 | Xi; NR: 38-41-50/53S: (2-)26-28-37/39-60-61 | | |
607-437-00-1 | 3-(4-aminophenyl)-2-cyano-2-propenoic acid | | 417-480-6 | - | R43 | XiR: 43S: (2-)22-24-37 | | |
607-438-00-7 | methyl-2-[(aminosulfonyl)methyl]benzoate | | 419-010-5 | - | Xn; R22Xi; R36 | XnR: 22-36S: (2-)22-26 | | |
607-439-00-2 | methyl tetrahydro-2-furancarboxylate | | 420-670-1 | 37443-42-8 | Xi; R41 | XiR: 41S: (2-)26-39 | | |
607-440-00-8 | methyl 2-aminosulfonyl-6-(trifluoromethyl)pyridine-3-carboxylate | | 421-220-7 | 144740-59-0 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)22-24-37-61 | | |
607-441-00-3 | 3-[3-(2-dodecyloxy-5-methylphenylcarbamoyl)-4-hydroxy-1-naphthylthiojpropionic acid | | 421-490-6 | 167684-63-1 | R53 | R: 53S: 57-61 | | |
607-442-00-9 | benzyl [hydroxy-(4-phenylbutyl)phosphinyl] acetate | | 416-050-5 | 87460-09-1 | Xi; R41 | XiR: 41S: (2-)26-36/39 | | |
607-443-00-4 | bis(2,4-di-tert-butyl-6-methylphenyl)ethyl phosphate | | 416-140-4 | 145650-60-8 | R 53 | R: 53S: 61 | | |
607-444-00-X | A mixture of: cis-1,4-dimethylcyclohexyl dibenzoatetrans-1,4-dimethylcyclohexyl dibenzoate | | 416-230-3 | 35541-81-2 | R 53 | R: 53S: 61 | | |
607-445-00-5 | Iron (III) tris(4-methylbenzenesulfonate) | | 420-960-8 | 77214-82-5 | Xi; R41 | XiR: 41S: (2-)24-26-39 | | |
607-446-00-0 | methyl 2-[4-(2-chloro-4-nitrophenylazo)-3-(1-oxopropyl)amino]phenylaminopropionate | | 416-240-8 | 155522-12-6 | R 43R 53 | XiR: 43-53S: (2-)22-24-37-61 | | |
607-447-00-6 | sodium 4-[4-(4-hydroxyphenylazo)phenylamino]-3-nitrobenzenesulfonate | | 416-370-5 | 156738-27-1 | R 43R52-53 | XiR: 43-52/53S: (2-)22-24-37-61 | | |
607-448-00-1 | 2,3,5,6-tetrafluorobenzoic acid | | 416-800-1 | 652-18-6 | Xi; R38-41 | XiR: 38-41S: (2-)22-26-37/39 | | |
607-449-00-7 | A mixture of: 4,4',4"-[(2,4,6-trioxo-1,3,5(2H,4H,6H)-triazine-1,3,5-triyl)tris[methylene(3,5,5-trimethyl-3,1-cyclohexanediyl)iminocarbonyloxy-2,1-ethanediyl(ethyl)amino]]trisbenzenediazoniumtri[bis(2-methylpropyl)naphthalenesulfonate] 4,4',4",4'"-[[5,5'-[carbonylbis[imino(1,5,5-trimethyl-3,1-cyclohexanediyl)methylene]]-2,4,6-trioxo-1,3,5(2H,4H,6H)-triazine-1,1',3,3'-tetray1]tetrakis[methylene(3,5,5-trimethyl-3,1-cyclohexanediyl)iminocarbonyloxy-2,1-ethanediyl(ethyl)amino]]tetrakisbenzenediazoniumtetra[bis(2-methylpropyl)naphthalenesulfonate] | | 417-080-1 | - | E; R2R43N; R50-53 | E; Xi; NR: 2-43-50/53S: (2-)24-35-37-60-61 | | |
607-450-00-2 | 2-mercaptobenzothiazolyl-(Z)-(2-aminothiazol-4-yl)-2-(tert-butoxycarbonyl) isopropoxyiminoacetate | | 419-040-9 | 89604-92-2 | R 53 | R: 53S: 61 | | |
607-451-00-8 | 4-[4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazo]-6-[3-(4-amino-5-hydroxy-3-(4-(2-sulfoxyethylsulfonyl)phenylazo)-2,7-disulfonapht-6-ylazojphenylcarbonylaminojbenz enesulfonic acid, sodium salt | | 417-640-5 | 161935-19-9 | Xi; R41R43 | XiR: 41-43S: (2-)22-24-26-37/39 | | |
607-453-00-9 | 4-benzyl-2,6-dihydroxy-4-aza-heptylene bis(2,2-dimethyloctanoate) | | 418-100-1 | 172964-15-7 | R 43R 53 | XiR: 43-53S: (2-)24-37-61 | | |
607-454-00-4 | A mixture of: trans-2-(1-methylethyl)-1,3-dioxane-5-carboxylic acid;cis-2-(1-methylethyl)-1,3-dioxane-5-carboxylic acid | | 418-170-3 | - | Xi; R41R52-53 | XiR: 41-52/53S: (2-)25-26-39-61 | | |
607-455-00-X | 1-amino-4-(3-[4-chloro-6-(2,5-disulfophenylamino)-1,3,5-triazin-2-ylamino]-2,2-dimethyl-propylamino)-anthraquinone-2-sulfonic acid, na/li salt | | 419-520-8 | 172890-93-6 | R 43 | XiR: 43S: (2-)22-24-37 | | |
607-456-00-5 | 3-amino-4-chlorobenzoic acid, hexadecyl ester | | 419-700-6 | 143269-74-3 | N; R51-53 | NR: 51/53S: 61 | | |
607-457-00-0 | tetrasodium dihydrogen 1,1"-dihydroxy-8,8"-[p-phenylbis(imino-{6-[4-(2-aminoethyl)piperazin-1-yl]}-1,3,5-triazine-4,2-diyl-imino)]bis(2,2'-azonaphthalene-1',3,6-trisulfonate) | | 420-350-1 | 172277-97-3 | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 | | |
607-458-00-6 | A mixture of: 2-ethyl-[2,6-dibromo-4-[1-[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]-1-methylethyl]phenoxy]propenoate2,2'-diethyl-[4,4'-bis(2,6-dibromophenoxy)-1-methylethylidene] dipropenoate2,2'-[(1-methylethylidene)bis[[2,6-dibromo-4,1-phenylene)oxy]ethanol]] | | 420-850-1 | - | N; R51-53 | NR: 51/53S: 61 | | |
607-459-00-1 | isopentyl 4-{2-[5-cyano-1,2,3,6-tetrahydro-1-(2-isopropoxyethoxy-carbonylmethyl)-4-methyl-2,6-dioxo-3-pyridylidene]hydrazino}benzoate | | 418-930-4 | - | R 53 | R: 53S: 61 | | |
607-460-00-7 | 3-tridecyloxy-propyl-ammonium9-octadecenoate | | 418-990-1 | - | Xn; R48/22Xi; R36/38N; R50-53 | Xn; NR: 36/38-48/22-50/53S: (2-)23-26-37/39-60-61 | | |
607-461-00-2 | A mixture of: pentasodium 2-{4-{3-methyl-4-[6-sulfonato-4-(2-sulfonato-phenylazo)-naphthalen-1-ylazo]-phenylamino}-6-[3-(2-sulfato-ethanesulfonyl)-phenylamino]-1,3,5-triazin-2-ylamino}-benzene-1,4-disulfonatepentasodium 2-{4-{3-methyl-4-[7-sulfonato-4-(2-sulfonato-phenylazo)-naphthalen-1-ylazo]-phenylamino}-6-[3-(2-sulfato-ethanesulfonyl)-phenylamino]-1,3,5-triazin-2-ylamino]-benzene-1,4-disulfonate | | 421-160-1 | - | R 52-53 | R: 52/53S: 61 | | |
607-462-00-8 | A mixture of: 1-hexyl acetate2-methyl-1-pentyl acetate3-methyl-1-pentyl acetate;4-methyl-1-pentyl acetateother mixed linear and branched C6-alkyl acetates | | 421-230-1 | 88230-35-7 | N; R51-53 | NR: 51/53S: 61 | | |
607-463-00-3 | 3-(phenothiazin-10-yl)propionic acid | | 421-260-5 | 362-03-8 | N; R51-53 | NR: 51/53S: 24/25-61 | | |
607-464-00-9 | A mixture of: 7-chloro-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid5-chloro-1-ethyl-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid | | 421-280-4 | 68077-26-9 | R 52-53 | R: 52/53S: 61 | | |
607-465-00-4 | tris(2-hydroxyethyl)ammonium 7-{4-[4-(2-cyanoamino-4-hydroxy-6-oxidopyrimidin-5-ylazo)benzamido]-2-ethoxy-phenylazo}naphthalene-1,3-disulfonate | | 421-440-3 | - | R 52-53 | R: 52/53S: 61 | | |
607-466-00-X | A mixture of: phenyl 1-(1-[2-chloro-5-(hexadecyloxycarbonyl)phenylcaramoyl]-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylatephenyl 2-(1-(2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl)-3,3-dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylatephenyl 3-(1-(2-chloro-5-(hexadecyloxycarbonyl)phenylcarbamoyl)-3,3 -dimethyl-2-oxobutyl)-1H-2,3,3a,7a-tetrahydrobenzotriazole-5-carboxylate | | 421-480-1 | - | N; R51-53 | NR: 51/53S: 37/39-61 | | |
| | | | | | | | |
607-467-00-5 | 1,1,3,3-tetrabutyl-1,3-ditinoxydicaprylate | | 419-430-9 | 56533-00-7 | Xn; R21/22-48/22C; R34N; R50-53 | C; NR: 21/22-34-48/22-50/53S: (1/2-)26-36/37/39-45-60-61 | | |
607-468-00-0 | A mixture of: monosodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonatedisodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonatetrisodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonatetetrasodium 4-((4-(5-sulfonato-2-methoxyphenylamino)-6-chloro-1,3,5-triazine-2-yl)amino)-2-((1,4-dimethyl-6-oxido-2-oxo-5-sulfonatomethyl-1,2-dihydropyridine-3-yl)azo)benzenesulfonate | | 419-450-8 | - | R43 | XiR: 43S: (2-)22-24-37 | | |
607-469-00-6 | disodium 7-((4,6-bis(3-diethylaminopropylamino)-1,3,5-triazine-2-yl)amino)-4-hydroxy-3-(4-(4-sulfonatophenylazo)phenylazo)-2-naphthalene sulfonate | | 419-460-2 | 120029-06-3 | R52-53 | R: 52/53S: 61 | | |
607-470-00-1 | potassium sodium 6,13-dichloro-3,10-bis{2-[4-[3-(2-hydroxysulphonyloxyethanesulfonyl)phenylamino]-6-(2,5-disulfonatophenylamino)-1,3,5-triazin-2-ylamino]ethylamino}benzo[5,6][1,4]oxazino[2,3-b]phenoxazine-4,11-disulfonate | | 414-100-0 | - | Xi; R41R52-53 | XiR: 41-52/53S: (2-)39-22-26-61 | | |
607-472-00-2 | ammonium iron(III)trimethylenediaminetetraacetate hemihydrate | | 400-660-3 | 111687-36-6 | N; R51-53 | NR: 51/53S: 61 | | |
607-474-00-3 | (4-(4-(4-dimethylaminobenzyliden-1-yl)-3-methyl-5-oxo-2-pyrazolin-1-yl)benzoic acid | | 410-430-4 | 117573-89-4 | R53 | R: 53S: 61 | | |
607-475-00-9 | A mixture (50/50) of: tetrasodium 7-(4-[4-chloro-6-[methyl-(3-sulfonatophenyl)amino] -1,3,5-triazin-2-ylamino]-2-ureidophenylazo)naphthalene-1,3,6-trisulfonatetetrasodium 7-(4-[4-chloro-6-[methyl-(4-sulfonatophenyl)amino]-1,3,5-triazin-2-ylamino]-2-ureidophenylazo)naphthalene-1,3,6-trisulfonate | | 412-940-2 | 148878-18-6 | R43 | XiR: 43S: (2-)22-24-37 | | |
607-476-00-4 | trisodium N,N-bis(carboxymethyl)-β-alanine | | 414-070-9 | 129050-62-0 | C; R34R52-53 | CR: 34-52/53S:(1/2-)26-36/37/39-45-61 | | |
607-478-00-5 | tetramethylammonium hydrogen phthalate | | 416-900-5 | 79723-02-7 | T; R25Xn; R48/22N; R50 | T; NR: 25-48/22-50S: (1/2-)25-36-45-61 | | |
607-479-00-0 | hexadecyl 4-chloro-3-[2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxopentamido]benzoate | | 418-550-9 | 168689-49-4 | R53 | R: 53S: 61 | | |
607-480-00-6 | 1,2-benzenedicarboxylic acid di-C7-11-branched and linear alkylesters | | 271-084-6 | 68515-42-4 | Repr. Cat. 2; R61Repr. Cat. 3; R62 | TR: 61-62S: 53-45 | | |
607-487-00-4 | A mixture of: disodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonatetrisodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazo1-1-yl)benzenesulfonate | | 402-660-9 | - | Repr.Cat.2; R61R52-53 | TR: 61-52/53S: 53-45-61 | | |
607-488-00-X | ethyl (2-acetylamino-5-fluoro-4-isothiocyanatophenoxy)acetate | | 414-210-9 | 147379-38-2 | N; R50-53 | NR: 50/53S: 60-61 | | |
607-489-00-5 | A mixture of: 2-ethylhexyl linolenate, linoleate and oleate2-ethylhexyl epoxyoleate2-ethylhexyl diepoxylinoleate2-ethylhexyl triepoxylinolenate | | 414-890-7 | 71302-79-9 | R43 | XiR: 43S: (2-)24-37 | | |
607-490-00-0 | N-[2-hydroxy-3-(C 12-16-alkyloxy)propyl]-N-methyl glycinate | | 415-060-7 | - | Xi; R41R43 | XiR: 41-43S: (2-)24-26-37/39 | | |
607-492-00-1 | 2-(1-(3',3'-dimethyl-1'-cyclohexyl)ethoxy)-2-methyl propyl propanoate | | 415-490-5 | 141773-73-1 | N; R51-53 | NR: 51/53S: 61 | | |
607-493-00-7 | methyl (3aR,4R,7aR)-2-methyl-4-(1S,2R,3-triacetoxypropyl)-3a,7a-dihydro-4H-pyrano[3,4-d]oxazole-6-carboxylate | | 415-670-3 | 78850-37-0 | Xi; R41 | XiR: 41S: (2-)26-39 | | |
607-494-00-2 | bis(2-ethylhexyl)octylphosphonate | | 417-170-0 | 52894-02-7 | N; R50-53 | NR: 50/53S: 60-61 | | |
607-495-00-8 | sodium 4-sulfophenyl-6-((1-oxononyl)amino)hexanoate | | 417-550-6 | 168151-92-6 | R43 | XiR: 43S: (2-)24-37 | | |
607-496-00-3 | 2,2'-methylenebis(4,6-di-tert-butyl-phenyl)-2-ethylhexyl phosphite | | 418-310-3 | 126050-54-2 | R53 | R:53S: 61 | | |
607-497-00-9 | cerium oxide isostearate | | 419-760-3 | - | R53 | R: 53S: 61 | | |
607-498-00-4 | (E)-3,7-dimethyl-2,6-octadienylhexadecanoate | | 421-370-3 | 3681-73-0 | Xi; R38R53 | XiR: 38-53S: (2-)37-61 | | |
607-499-00-X | bis(dimethyl-(2-hydroxyethyl)ammonium) 1,2-ethanediyl-bis(2-hexadecenylsuccinate) | | 421-660-1 | - | Xi; R41R43N; R51-53 | Xi; NR: 41-43-51/53S: (2-)24-26-37/39-61 | | |
| | | | | | | | |
607-500-00-3 | calcium 2,2,bis[(5-tetrapropylene-2-hydroxy)phenyl]ethanoate | | 421-670-4 | - | Xi; R38N; R50-53 | Xi; NR: 38-50/53S: (2-)37-60-61 | | |
607-501-00-9 | A mixture of:triphenylthiophosphate and tertiary butylated phenyl derivatives | | 421-820-9 | - | R53 | R: 53S: 61 | | |
607-502-00-4 | (N-benzyl-N,N,N-tributyl)ammonium 4-dodecylbenzenesulfonate | | 422-200-0 | - | C; R34Xn; R22N; R51-53 | C; NR: 22-34-51/53S: (1/2-)26-36/37/39-45-61 | | |
607-503-00-X | 2,4,6-tri-n-propyl-2,4,6-trioxo-1,3,5,2,4,6-trioxatriphosphorinane | | 422-210-5 | 68957-94-8 | C; R34 | CR: 34S: (1/2-)26-36/37/39-45 | | |
607-505-00-0 | pentasodium 7-(4-(4-(5-amino-4-sulfonato-2-(4-((2-(sulfonato-ethoxy)sulfonyl)phenylazo)phenylamino)-6-chloro-1,3,5-triazin-2-yl)amino-2-ureidophenylazo)naphtalene-1,3,6-trisulfonate | | 422-930-1 | 171599-84-1 | R52-53 | R: 52/53S: 22-61 | | |
607-506-00-6 | A mixture of: strontium (4-chloro-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzenesulfonate disodium (4-chloro-2-((4,5-dihydro-3-methyl-5-oxo-1-(3-sulfonatophenyl)-1H-pyrazol-4-yl)azo)-5-methyl)benzenesulfonate | | 422-970-8 | 136248-04-9 | N; R51-53 | NR:51/53S: 22-61 | | |
607-507-00-1 | potassium,sodium 2,4-diamino-3-[4-(2-sulfonatoethoxysulfonyl)phenylazo]-5-[4-(2-sulfonatoethoxysulfonyl)-2-sulfonatophenylazo]-benzenesulfonate | | 422-980-2 | 187026-95-5 | Xi; R41 | XiR: 41S: (2-)22-26-39 | | |
607-508-00-7 | disodium 3,3'-[iminobistsulfonyl-4,1-phenylene-(5-hydroxy-3-methylpyrazole-1,4-diyl)azo-4,1-phenylenesulfonylimino-(4-amino-6-hydroxypyrimidine-2,5-diyl)azo-4,1-phenylenesulfonylimino(4-amino-6-hydroxypyrimidine-2,5-diyl)azo]bis(benzenesulfonate)] | | 423-110-4 | - | Xi; R41 | XiR: 41S: (2-)22-26-39 | | |
607-512-00-9 | trisodium 2,4-diamino-3,5-bis-[4-(2-sulfonatoethoxy)sulfonyl)phenylazo]benzenesulfonate | | 423-970-0 | 182926-43-8 | R52-53 | R: 52/53S: 22-61 | | |
607-513-00-4 | A mixture of: Trisodium 4-benzoylamino-6-(6-ethenesulfonyl-1 -sulfato-naphthalen-2-ylazo)-5-hydroxynaphthalene-2,7-disulfonate5-(benzoylamino)-4-hydroxy-3-((1-sulfo-6-((2-(sulfooxy)ethyl)sulfonyl)-2-naphtyl)azo)naphthalene-2,7-disulfonic acid sodium salt5-(benzoylamino)-4-hydroxy-3-((1-sulfo-6-((2-(sulfooxy)ethyl)sulfonyl)-2-naphtyl)azo)naphthalene-2,7-disulfonic acid | | 423-200-3 | - | Xi; R41R43R52-53 | XiR: 41-43-52/53S: 22-26-36/37/39-61 | | |
607-515-00-5 | A mixture of: disodium hexyldiphenyl ether disulphonate disodium dihexyldiphenyl ether disulphonate | | 429-650-7 | 147732-60-3 | Xi; R36N; R51-53 | Xi; NR: 36-51/53S: (2-)26-61 | | |
607-516-00-0 | N,N'-bis(trifluoroacetyl)-S,S'-bis-L-homocysteine | | 429-670-6 | 105996-54-1 | Xi; R41R43 | XiR: 41-43S: (2-)24-26-37/39 | | |
607-517-00-6 | (S)-α-(acetylthio)benzenepropanoic acid | | 430-300-0 | 76932-17-7 | Xn; R22Xi; R41R43 | XnR: 22-41-43S: (2-)22-26-36/37/39 | | |
607-526-00-5 | cartap1,3-bis(carbamoylthio)-2-(dimethylamino)propane | | - | 15263-53-3 | N; R50-53 | NR: 50/53S: 60-61 | | |
607-527-00-0 | A mixture of: 1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1"H,1"H,2"H,2"H-tridecafluorooctyl)dodecanedioate1-(1'H.1'H.2'H.2'H-tridecafluorooctyl)-12-(1"H,1"H,2"H,2"H-heptdecafluorodecyl)dodecanedioate1-(1'H,1'H,2'H,2'H-tridecafluorooctyl)-12-(1"H,1"H,2"H,2"H-heneicosafluorododecyl)dodecanedioate1-(1'H,1H,2'H,2'H-tridecafluorooctyl)-12-(1"H,1"H,2"H,2"H-pentacosafluorotetradecyl)dodecanedioate1-(1'H,1'H,2'H,2'H-heptadecafluorodecyl)-12-(1"H,1'H,2"H,2"H-heptadecafluorodecyl)dodecanedioate1-(1'H,1H,2'H,2'H-heptadecafluorodecyl)-12-(1"H,1"H,2"H,2"H-heneicosafluorododecyl)dodecanedioate | | 423-180-6 | - | Xn; R48/22 | XnR: 48/22S: (2-)36 | | |
608-031-00-7 | 2-benzyl-2-methyl-3-butenitrile | | 407-870-4 | 97384-48-0 | Xn; R22R 52-53 | XnR: 22-52/53S: (2-)61 | | |
608-033-00-8 | N-butyl-3-(2-chloro-4-nitrophenylhydrazono)-1-cyano-2-methylprop-1-ene-1,3-dicarboximide | | 407-970-8 | 75511-91-0 | R 43R 52-53 | XiR: 43-52/53S: (2-)24-37-61 | | |
608-034-00-3 | chlorfenapyr4-bromo-2-(4-chlorophenyl)-1-ethoxymethyl-5-trifluoromethylpyrrole-3-carbonitrile | | - | 122453-73-0 | T; R23Xn; R22N; R50-53 | T; NR: 22-23-50/53S: (1/2-)13-36/37-45-60-61 | | |
608-035-00-9 | (+/-)-α-[(2-acetyl-5-methylphenyl)-amino]-2,6-dichlorobenzene-aceto-nitrile | | 419-290-9 | - | R43R53 | XiR: 43-53S: (2-)24-37-61 | | |
608-036-00-4 | 3-(2-{4-[2-(4-cyanophenyl)vinyl]phenyl}vinyl)benzonitrile | | 419-060-8 | 79026-02-1 | R 53 | R: 53S: 61 | | |
608-037-00-X | A mixture of: (E)-2,12-tridecadiennitrile(E)-3,12-tridecadiennitrile(Z)-3,12-tridecadiennitrile | | 422-190-8 | 124071-40-5 | N; R50-53 | NR:50/53S: 60-61 | | |
608-038-00-5 | 2,2,4-trimethyl-4-phenyl-butane-nitrile | | 422-580-8 | 75490-39-0 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 | | |
608-039-00-0 | 2-phenylhexanenitrile | | 423-460-8 | 3508-98-3 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)23-60-61 | | |
608-040-00-6 | 4,4'-dithiobis(5-amino-1-(2,6-dichloro-4-(trifluoromethyl)phenyl)-1H-pyrazole-3-carbonitrile) | | 423-490-1 | 130755-46-3 | N; R50-53 | NR: 50/53S: 60-61 | | |
608-041-00-1 | 4'-((2-butyl-4-oxo-1,3-diazaspiro[4,4]non-1-ene-3-y 1)methyl)(1,1'-biphenyl)-2-carbonitrile | | 423-500-4 | 138401-24-8 | N; R50-53 | NR: 50/53S: 60-61 | | |
608-043-00-2 | 3-(cis-3-hexenyloxy)propanenitril | | 415-220-6 | 142653-61-0 | T; R23Xn; R22N; R50-53 | T; NR: 22-23-50/53S: (1/2-)13-36/37-45-60-61 | | |
609-064-00-X | mesotrione2-[4-(methylsulfonyl)-2-nitrobenzoyl]-1,3-cyclohexanedione | | - | 104206-82-8 | N; R50-53 | NR: 50/53S: 60-61 | | |
609-066-00-0 | lithium sodium 3-amino-10-[4-(10-amino-6,13-dichloro-4,11-disulfonatobenzo[5,6][1,4]oxazino[2,3-b]phenoxazine-3-ylamino)-6-[methyl(2-sulfonato-ethyl)amino]-1,3,5-triazin-2-ylamino]-6,13-dichlorobenzo[5,6][1,4]oxazino[2,3-b]phenoxazine-4,11-disulfonate | | 418-870-9 | 154212-58-5 | Xn; R20/21/22-68/20/21/22 | XnR: 20/21/22-68/20/21/22S: (2-)36/37 | | |
609-067-00-6 | sodium and potassium 4-(3-aminopropylamino)-2,6-bis[3-(4-methoxy-2-sulfophenylazo)-4-hydroxy-2-sulfo-7-naphthylamino]-1,3,5-triazine | | 416-280-6 | 156769-97-0 | R 43 | XiR: 43S: (2-)22-24-37 | | |
609-068-00-1 | musk xylene5-tert-butyl-2,4,6-trinitro-m-xylene | | 201-329-4 | 81-15-2 | Carc. Cat. 3; R40E; R2N; R50-53 | E; Xn; NR: 2-40-50/53S: (2-)36/37-46-60-61 | | |
609-070-00-2 | 1,4-dichloro-2-(1,1,2,3,3,3-hexafluoropropoxy)-5-nitrobenzene | | 415-580-4 | 130841-23-5 | Xn; R22R 43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)36/37/39-60-61 | | |
609-071-00-8 | A mixture of: 2-methylsulfanyl-4,6-bis-(2-hydroxy-4-methoxy-phenyl)-1,3,5-triazine 2-(4,6-bis-methylsulfanyl-1,3,5-triazin-2-yl)-5-methoxy-phenol | | 423-520-3 | 156137-33-6 | R43 | XiR: 43S: (2-)22-24-37 | | |
611-099-00-0 | (methylenebis(4,1-phenylenazo(1-(3-(dimethylamino)propyl)-1,2-dihydro-6-hydroxy-4-methyl-2-oxopyridine-5,3-diyl)))-1,1'-dipyridinium dichloride dihydrochloride | | 401-500-5 | - | Carc.Cat.2; R45N; R51-53 | T; NR: 45-51/53S: 53-45-61 | | |
611-100-00-4 | potassium sodium 3,3'-(3(or4)-methyl-1,2-phenylenebis(imino(6-chloro)-1,3,5-triazirie-4,2-diylimino(2-acetamido-5-methoxy)-4,1-phenylenazo)dinaphthalene-1,5-disulfonate | | 403-810-6 | 140876-13-7 | Xi; R41 | XiR: 41S: (2-)26-39 | | |
611-101-00-X | 2'-(4-chloro-3-cyano-5-formyl-2-thienyl)azo-5'-diethylaminoacetanilide | | 405-200-5 | 104366-25-8 | R43 | XiR: 43S: (2-)22-24-37 | | |
611-103-00-0 | trisodium (1-(3-carboxylato-2-oxido-5-sulfonatophenylazo)-5-hydroxy-7-sulfonatonaphthalen-2-amido)nickel(II) | | 407-110-1 | - | Xi; R41R 43N; R51-53 | Xi; NR: 41-43-51/53S: (2-)24-26-37/39-61 | | |
611-104-00-6 | A mixture of: trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2or 6)-(4-(4-nitro-2-sulfonatoanilino)phenylazo)phenolato)ferrate(1-)trisodium bis(2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)ferrate(1-)trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4 or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2 or 6)-(4-nitro-2-sulfonatophenylazo)phenolato)ferrate(1-)trisodium (2,4(or 2,6 or 4,6)-bis(3,5-dinitro-2-oxidophenylazo)-5-hydroxyphenolato)(2(or 4 or 6)-(3,5-dinitro-2-oxidophenylazo)-5-hydroxy-4(or 2 or 6)-(3-sulfonatophenylazo)phenolato)ferrate(1-)disodium 3,3'-(2,4-dihydroxy-1,3(or 1,5 or 3,5)-phenylenediazo)dibenzenesulfonate | | 406-870-1 | - | R 43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 | | |
611-105-00-1 | sodium 4-(4-chloro-6-(N-ethylanilino)-1,3,5-triazin-2-ylamino)-2-(1-(2-chlorophenyl)-5-hydroxy-3-methyl-1H-pyrazol-4-ylazo)benzenesulfonate | | 407-800-2 | 136213-75-7 | R 43N; R51-53 | Xi; NR: 43-51/53S: (2-)22-24-37-61 | | |
611-106-00-7 | hexasodium 4,4'-dihydroxy-3,3'-bis[2-sulfonato-4-(4-sulfonatophenylazo)phenylazo]-7,7'tp-phenylenebis[imino(6-chloro-1,3,5-triazine-4,2-diyl)imino]]dinaphthalene-2-sulfonate | | 410-180-6 | - | Xi; R41 | XiR: 41S: (2-)26-39 | | |
611-107-00-2 | potassium sodium 4-(4-chloro-6-(3,6-disulfonato-7-(5,8-disulfonato-naphthalen-2-ylazo)-8-hydroxy-naphthalen-1-ylamino)-1,3,5-triazin-2-ylamino)-5-hydroxy-6-(4-(2-sulfatoethanesulfonyl)-phenylazo)-naphthalene-1,7-disulfonate | | 412-490-7 | - | R 43 | XiR: 43S: (2-)22-24-37 | | |
611-108-00-8 | disodium 5-((4-((4-chloro-3-sulfonatophenyl)azo)-1-naphthyl)azo)-8-(phenylamino)-1-naphthalenesulfonate | | 413-600-6 | 6527-62-4 | R 52-53 | R: 52/53S: 61 | | |
611-109-00-3 | Reaction products of: copper(II) sulfate and tetrasodium 2,4-bis[6-(2-methoxy-5-sulfonatophenylazo)-5-hydroxy-7-sulfonato-2-naphthylaminol-6-(2-hydroxyethylamino)-1,3,5-triazine(2:1) | | 407-710-3 | - | N; R51-53 | NR: 51/53S: 61 | | |
611-110-00-9 | tetra-sodium/lithium 4,4'-bis-(8-amino-3,6-disulfonato-1-naphthol-2-ylazo)-3-methylazobenzene | | 408-210-8 | 124605-82-9 | R 43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-28-37-61 | | |
611-111-00-4 | disodium 2-[[4-(2-chloroethylsulfonyl)phenyl]-[(2-hydrox y-5-sulfo-3-[3-[2-(2-(sulfooxy)ethylsulfonyl)ethylazo]-4-sulfobenzoato(3-)cuprate(1-) | | 414-230-8 | - | R 43 | XiR: 43S: (2-)22-24-37 | | |
611-112-00-X | tetrasodium 4-hydroxy-5-[4-[3-(2-sulfatoethanesulfonyl)phenylamino]-6-morpholin-4-yl-1,3,5-triazin-2-ylamino]-3-(1-sulfonatonaphthalen-2-ylazo)naphthalene-2,7-disulfonate | | 413-070-6 | - | R 43 | XiR: 43S: (2-)22-24-37 | | |
611-113-00-5 | lithium sodium (2-(((5-((2,5-dichlorophenyl)azo)-2-hydroxyphenyl)methylene)amino)benzoato(2-))(2-((4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo)-5-sulfobenzoato(3-)) chromate(2-) | | 414-28,0-0 | 149626-00-6 | N; R51-53 | NR: 51/53S: 24/25-61 | | |
611-114-00-0 | lithium sodium (4-((5-chloro-2-hydroxyphenyl)azo)-2,4-dihydro-5-methyl-3H-pyrazol-3-onato(2-))(3-((4,5-dihydro-3-methyl-1-(4-methylphenyl)-5-oxo-1H-pyrazol-4-yl)azo)-4-hydroxy-5-nitrobenzenesulfonato(3 -)) chromate(2-) | | 414-250-7 | 149564-66-9 | Xn; R22Xi; R41R 52-53 | XnR: 22-41-52/53S: (2-)22-26-39-61 | | |
611-115-00-6 | trilithium bis(4-((4-(diethylamino)-2-hydroxyphenyl)azo)-3-hydroxy-1-naphthalenesulfonato(3-))chromate(3-) | | 414-290-5 | 149564-65-8 | Xn; R22R 52-53 | XnR: 22-52/53S: (2-)22-61 | | |
| | | | | | | | |
611-116-00-1 | A mixture of: trisodium 5-(4-chloro-6-[2-(2,6-dichloro-5-cyanopyrimidin-4-ylamino)-propylamino]-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(1-sulfonatpnaphthalene-2-ylazo)-naphthalene-2,7-disulfonatetrisodium 5-{4-chloro-6-L2-(2,6-dichloro-5-cyanopyrimidin-4-ylamino)-1-methyl-ethylamino]-1,3,5-triazin-2-ylamino]-4-hydroxy-3-(1-sulfonatonaphthalene-2-ylazo)-naphthalene-2,7-disulfonatetrisodium 5-{4-chloro-6-[2-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-propylaminoj-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonatonaphthalen-2-ylazo)-naphthalene 2,7-disulfonatetrisodium 5-{4-chloro-6-[2-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-1-methyl-ethylamino]-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(1-sulfonatonaphthalen-2-ylazo)-naphthalene-2,7-disulfonate | | 414-620-8 | - | Xi; R41R 43 | XiR: 41-43S: (2-)22-24-26-37/39 | | |
611-117-00-7 | 1,3-bis {6-fluoro-4-[ 1,5-disulfo-4-(3-aminocarbonyl-1-ethyl-6-hydroxy-4-methyl-pyrid-2-on-5-ylazo)-phenyl-2-ylamino]-1,3,5-triazin-2-ylamino) propane lithium-, sodium salt | | 415-100-3 | 149850-29-3 | R 43 | XiR: 43S: (2-)22-24-37 | | |
611-118-00-2 | sodium 1,2-bis[4-[4-(4-(4-sulfophenylazo)-2-sulfophenylazo}-2-ureido-phenyl-amino]-6-fluoro-1,3,5-triazin-2-ylamino]-propane, sodium salt | | 413-990-8 | 149850-31-7 | R 43 | XiR: 43S: (2-)22-24-37 | | |
611-119-00-8 | tetrasodium 4-[4-chloro-6-(4-methyl-2-sulfophenylamino)-1,3,5-triazin-2-ylamino]-6-(4,5-dimethyl-2-sulfophenylazo)-5-hydroxynaphthalene-2,7-disulfonate | | 415-400-4 | 148878-22-2 | Xi; R41R 43 | XiR: 41-43S: (2-)22-24-26-37/39 | | |
611-120-00-3 | 5-{4-[5-amino-2-[4-(2-sulfoxyethylsulfonyOphenylazo]-4-sulfo-phenylamino]-6-chloro-1,3,5-triazin-2-ylamino}-4-hydroxy-3-(1-sulfonaphthalen-2-ylazo)-naphthalene-2,7-disulfonicacid sodium salt | | 418-340-7 | 157707-94-3 | Xi; R41R 52-53 | XiR: 41-52/53S: (2-)22-26-39-61 | | |
611-121-00-9 | Main component 6 (isomer): asym. 1:2 Cr(III)-complex of: A: 3-hydroxy-4-(2-hydroxy-naphthalene-1-ylazo)naphthalene-1-sulfonic acid, Na-salt and B: 1-[2-hydroxy-5 -(4- methoxy-phenylazo)phenylazo] naphthalene-2-olMain component 8 (isomer): asym. 1:2 Cr-complex of: A: 3-hydrox y-4-(2-hydroxy-naphthalene-1-ylazo)-naphthalene-1-sulfonic acid, Na-salt and B: 1-[2-hydroxy-5-(4-methoxy-phenylazo)-phenylazo]-naphthalene-2-ol | | 417-280-9 | 30785-74-1 | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)26-39-60-61 | | |
611-122-00-4 | hexasodium (di[N-(3-(4-[5-(5-amino-3-methyl-1 -phenylpyrazol-4-yl-azo)-2,4-disulfo-anilino]-6-chloro-1,3,5-triazin-2-ylamino)phenyl)-sulfamoyl](di-sulfo)-phthalocyaninato)nickel | | 417-250-5 | 151436-99-6 | Xi; R41R 43 | XiR: 41-43S: (2-)22-24-26-37/39 | | |
611-123-00-X | 3-(2,4-bis(4-((5-(4,6-bis(2-aminopropylamino)-1,3,5-triazin-2-ylamino)-4-hydroxy-2,7-disulfonaphthalen-3-yl)azo)phenylamino)-1,34-triazin-6-ylamino)propyldiethylammonium lactate | | 424-310-4 | 178452-66-9 | Xi; R41 | XiR: 41S: (2-)26-39 | | |
611-124-00-5 | A mixture of: pentasodium 5-amino-3-(5- (4-chloro-6- [4-(2-sulfoxyethoxysulfonato)phenylamino]-1,3,5-triazin-2-ylamino) -2-sulfonatophenylazo)-6-[5-(2,3-dibromopropionylamino)-2-sulfonatophenylazo]-4-hydrox ynaphthalene-2,7-disulfonatepentasodium 5-amino-6-[5-(2-bromoacryloylamino)-2-sulfonatophenylazo]-3-(5-{4-chloro-6-[4-(2-sulfoxyethoxysulfonato)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo)-4-hydroxynaphthalene-2,7-disulfonatetetrasodium 5-amino-3-[5-{4-chloro-6-[4-(vinylsulfonyl)phenylamino]-1,3,5-triazin-2-ylamino}-2-sulfonatophenylazo]-6-[5-(2,3-dibromopropionylamino)-2-sulfonatophenylazo]-4-hydroxynaphthalene-2,7-disulfonate | | 424-320-9 | 180778-23-8 | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 | | |
611-125-00-0 | A mixture of: Disodium 6-[3-carboxy-4,5-dihydro-5-oxo-4-sulfonatophenyl)pyrazolin-4-yl-azo]-3-[2-oxido-4-(ethensulfonyl)-5-methoxyphenylazo]-4-oxidonaphthalene-2-sulfonate copper (II) complexDisodium 6-[3-carboxy-4,5-dihydro-5-oxo-4-sulfonatophenyl)pyrazolin-4-yl-azo]-3-[2-oxido-4-(2-hydroxyethylsulfonyl)-5-methoxyphenylazo]-4-oxidonaphthalene-2-sulfonate copper (II) complex; | | 423-940-7 | - | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 | | |
611-126-00-6 | 2,6-bis-(2-(4-(4-amino-phenylamino)-phenylazo)-1,3-dimethyl-3H-imidazolium)-4-dimethylamino-1,3,5-triazine, dichloride | | 424-120-1 | 174514-06-8 | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)26-39-60-61 | | |
611-127-00-1 | pentasodium 4-amino-6-(5-(4-(2-ethyl-phenylamino)-6-(2-sulfatoethanesulfonyl)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(2-sulfatoethanesulfonyl)phenylazo) naphthalene-2,7-disulfonate | | 423-790-2 | - | R5Xi; R41R 43R 52-53 | XiR: 5-41-43-52/53S: (2-)22-26-36/37/39-41-61 | | |
| | | | | | | | |
611-128-00-7 | N,N'-bis{6-chloro-4-{6-(4-vinylsulfonylphenylazo)-2,7-disulfonicacid-5-hydroxynapht-4-ylamino]-1,3,5-triazin-2-yl)-N-(2-hydroxyethyl)ethane-1,2-diamine, sodium salt | | 419-500-9 | 171599-85-2 | Xi; R41R 43 | XiR: 41-43S: (2-)22-24-26-37/39 | | |
611-129-00-2 | A mixture of: 5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-2-[(3-phosphonophenyl)azo]benzoic acid5-[(4-[(7-amino-1-hydroxy-3-sulfo-2-naphthyl)azo]-2,5-diethoxyphenyl)azo]-3-[(3-phosphonophenyl)azo]benzoic acid | | 418-230-9 | 163879-69-4 | E; R2Repr.Cat.3; R62Xn; R48/22R 43N; R51-53 | E; Xn; NR: 2-43-48/22-62-51/53S: (2-)26-35-36/37-61 | | |
611-130-00-8 | tetra-ammonium 2-[6-[7-(2-carboxylato-phenylazo)-8-hydroxy-3,6-disulfonato-1-naphthylamino]-4-hydroxy-1,3,5-triazin-2-ylamino]benzoate | | 418-520-5 | 183130-96-3 | Xi; R36N; R50-53 | Xi; NR: 36-50/53S: (2-)26-39-60-61 | | |
611-131-00-3 | 2-[2-hydroxy-3-(2-chlorophenyl)carbamoyl-1-naphthylazo]-7-[2-hydroxy-3-(3-methylphenyl)carbamoyl-1-naphthylazo]fluoren-9-one | | 420-580-2 | - | Repr.Cat.2; R61R 53 | TR: 61-53S: 53-45-61 | | |
611-132-00-9 | pentasodium bis{7-[4-(1-butyl-5-cyano-1,2-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)phenylsulfonylamino]-5'-nitro-3,3'-disulfonatonaphthalene-2-azobenzene-1,2'-diolato] chromate (III) | | 419-210-2 | - | Xi; R41R 52-53 | XiR: 41-52/53S: (2-)26-39-61 | | |
611-133-00-4 | Product by process iron complex of azo dyestuffs obtained by coupling a mixture of diazotized 2-amino-1 -hydroxybenzene-4-sulfanilide and 2-amino-1-hydroxybenzene-4-sulfonamide with resorcin, the obtained mixture being subsequently submitted to a second coupling reaction with a mixture of diazotized 3-aminobenzene-1-sulfonic acid (metanilic acid) and 4'-amino-4-nitro-1,1'-diphenylamine-2-sulfonic acid and metallization with ferric chloride, sodium salt | | 419-260-5 | - | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)26-39-61 | | |
611-134-00-X | trisodium 2-{α[2-hydroxy-3-[4-chloro-6-[4-(2,3-dibromopropionylamino)-2-sulfonatophenylamino]-1,3,5-triazin-2-ylamino]-5-sulfonatophenylazo]-benzylidenehydrazino)-4-sulfonatobenzoate, copper complex | | 423-770-3 | - | Xi; R41N; R51-53 | Xi; NR: 41-51/53S: (2-)22-26-39-61 | | |
611-135-00-5 | Reaction product of: 2-[[4-amino-2-ureidophenylazol-5-[(2-(sulfooxy)ethyl)sulfonyl]]benzenesulfonic acid with 2,4,6-trifluoropyrimidine and partial hydrolysis to the corresponding vinylsulfonyl derivative,mixed potassium/sodium salt | | 424-250-9 | - | Xi; R41R52-53 | XiR: 41-52/53S: (2-)26-39-61 | | |
611-136-00-0 | 2-{4-(2-ammoniopropylamino)-6-[4-hydroxy-3-(5-methyl-2-methoxy-4-sulfamoylphenylazo)-2-sulfonatonaphth-7-ylamino]-1,3,5-triazin-2-ylamino}-2-aminopropyl formate | | 424-260-3 | - | Repr.Cat.3; R62Xi; R41N; R51-53 | Xn; NR: 41-62-51/53S: (2-)22-26-36/37/39-61 | | |
611-137-00-6 | 6-tert-butyl-7-chloro-3-tridecyl-7,7a-dihydro-1H-pyrazolo[5,1-c]-1,2,4-triazole | | 419-870-1 | 159038-16-1 | R 53 | R: 53S: 61 | | |
611-138-00-1 | 2-(4-aminophenyl)-6-tert-butyl-1H-pyrazolo[1,5-b][1,2,4]triazole | | 415-910-7 | 152828-25-6 | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)22-24-37-61 | | |
611-140-00-2 | azafenidin | | - | 68049-83-2 | T; R48/22Repr. Cat. 2; R61Repr. Cat. 3; R62N; R50-53 | T; NR: 61-48/22-62-50/53S: 53-45-60-61 | C ≥ 0.025 %: N; R50/530.0025 % ≤ C < 0.025 %: N; R51/530.00025 % ≤ C < 0.0025 %: R52/53 | |
612-184-00-5 | 6'-(dibutylamino)-3'-methyl-2'-(phenylamino)spiro[isobenzofura n-1 (3H),9-(9H)-xanthenl-3-one | | 403-830-5 | 89331-94-2 | R 52-53 | R:52/53S: 61 | | |
612-185-00-0 | 1-3-[4-((heptadecafluorononyl)oxy)-benzamido]propyl]-N,N,N-trimethylammonium iodide | | 407-400-8 | 59493-72-0 | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)26-39-60-61 | | |
612-186-00-6 | bis(N-(7-hydroxy-8- methyl-5-phenylphenazin-3-ylidene)dimethylammonium) sulfate | | 406-770-8 | 149057-64-7 | Xn; R48/22Xi; R41R 43N; R50-53 | Xn; NR: 41-43-48/22-50/53S: (2-)22-26-36/37/39-60-61 | | |
612-187-00-1 | 2,3,4-trifluoroaniline | | 407-170-9 | 3862-73-5 | Xn; R21/22-48/22Xi; R38-41N; R51-53 | Xn; NR: 21/22-38-41-48/22-51/53S: (2-)23-26-36/37/39-61 | | |
612-188-00-7 | 4,4'-(9H-fluoren-9-ylidene)bis(2-chloroaniline) | | 407-560-9 | 107934-68-9 | N; R51-53 | NR: 51/53S: 61 | | |
612-189-00-2 | 4-amino-2-(aminomethyl)phenol dihydrochloride | | 412-510-4 | 135043-64-0 | Xn; R22R 43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)22-24-37-60-61 | | |
612-190-00-8 | 4,4'-methylenebis(2-isopropyl-6-methylaniline) | | 415-150-6 | 16298-38-7 | Xn; R48/22N; R51-53 | Xn; NR: 48/22-51/53S: (2-)36-61 | | |
612-191-00-3 | Polymer of allylamine hydrochloride | | 415-050-2 | 71550-12-4 | Xn; R22R 43 | XnR: 22-43S: (2-)36/37 | | |
612-192-00-9 | 2-isopropyl-4-(N-methyl)aminomethylthiazole | | 414-800-6 | 154212-60-9 | Xn; R21/22Xi; R38-41N; R51-53 | Xn; NR: 21/22-38-41-51/53S: (2-)26-36/37/39-61 | | |
612-193-00-4 | 3-methylaminomethylphenylamine | | 414-570-7 | 18759-96-1 | Xn; R21/22C; R34R 43N; R50-53 | C; NR: 21/22-34-43-50/53S: (1/2-)26-36/37/39-45-60-61 | | |
612-194-00-X | 2-hydroxy-3-[(2-hydroxyethyl)-[2-(1-oxotetradecyl)amino]ethyl]amino ]-N,N,N-trimethyl-1-propanammonium chloride | | 414-670-0 | 141890-30-4 | Xn; R22Xi; R41N; R50-53 | Xn; NR: 22-41-50/53S: (2-)26-39-60-61 | | |
612-195-00-5 | bis[tributyl 4-(methylbenzyl)ammonium] 1,5-naphthalenedisulfonate | | 415-210-1 | - | Xn; R20/22Xi; R41N; R50-53 | Xn; NR: 20/22-41-50/53S: (2-)26-36/39-60-61 | | |
612-196-00-0 | 4-chloro-o-toluidine[1]4-chloro-o-toluidinehydrochloride[2] | E | 202-441-6[1]221-627-8[2| | 95-69-2 [1]3165-93-3 [2] | Carc.Cat.2; R45Muta.Cat.3; R68T; R23/24/25N; R50-53 | T; NR: 45-23/24/25-68-50/53S: 53-45-60-61 | | |
612-197-00-6 | 2,4,5-trimethylaniline[1]2,4,5-trimethylaniline hydrochloride[2] | E | 205-282-0[1]-[2] | 137-17-7 [1]21436-97-5 [2] | Carc.Cat.2; R45T; R23/24/25N; R51-53 | T; NR: 45-23/24/25-51/53S: 53-45-61 | | |
612-198-00-1 | 4,4'-thiodianiline and its salts | E | 205-370-9 | 139-65-1 | Carc.Cat.2; R45Xn; R22N; R51-53 | T; NR: 45-22-51/53S: 53-45-61 | | |
612-199-00-7 | 4,4'-oxydianiline and its saltsp-aminophenyl ether | E | 202-977-0 | 101-80-4 | Carc.Cat.2; R45Muta.Cat.2; R46Repr.Cat.3; R62T; R23/24/25N; R51-53 | T; NR: 45-46-23/24/25-62-51/53S: 53-45-61 | | |
612-200-00-0 | 2,4-diaminoanisole4-methoxy-m-phenylenediamine[1]2,4-diaminoanisole sulphate[2] | | 210-406-1[1]254-323-9[2] | 615-05-4 [1]39156-41-7 [2] | Carc.Cat.2; R45Muta.Cat.3; R68Xn; R22N; R51-53 | T; NR: 45-22-68-51/53S: 53-45-61 | | |
612-201-00-6 | N,N,N',N'-tetramethyl-4,4'-methylendianiline | | 202-959-2 | 101-61-1 | Carc.Cat.2; R45N; R50-53 | T; NR: 45-50/53S: 53-45-60-61 | | |
612-202-00-1 | 3,4-dichloroaniline | | 202-448-4 | 95-76-1 | T; R23/24/25Xi; R41R43N; R50-53 | T; NR: 23/24/25-41-43-50/53S: (1/2-)26-36/37/39-45-60-61 | | |
612-204-00-2 | C.I. Basic Violet 34-[4,4'-bis(dimethylamino) benzhydrylidene]cyclohexa-2,5-dien-1-ylidenejdimethylammonium chloride | | 208-953-6 | 548-62-9 | Carc.Cat.3; R40Xn; R22Xi; R41N; R50-53 | Xn; NR: 22-40-41-50/53S: (2-)26-36/37/39-46-60-61 | | |
612-205-00-8 | C.I. Basic Violet 3 with ≥ 0.1% of Michler's ketone (EC no. 202-027-5) | E | 208-953-6 | 548-62-9 | Carc.Cat.2; R45Xn; R22Xi; R41N; R50-53 | T; NR: 45-22-41-50/53S: 53-45-60-61 | | |
612-206-00-3 | famoxadone3-anilino-5-methyl-5-(4-phenoxyphenyl)-1,3-oxazolidine-2,4-dione | | - | 131807-57-3 | Xn; R48/22N; R50-53 | Xn; NR: 48/22-50/53S: (2-)46-60-61 | | |
| | | | | | | | |
612-209-00-X | 6-methoxy-m-toluidine p-cresidine | E | 204-419-1 | 120-71-8 | Carc.Cat.2; R45Xn; R22 | TR: 45-22S: 53-45 | | |
612-210-00-5 | 5-nitro-o-toluidine[1]5-nitro-o-toluidine hydrochloride[2] | | 202-765-8[1]256-960-8[2] | 99-55-8 [1]51085-52-0 [2] | Carc.Cat.3; R40T; R23/24/25R52-53 | TR: 23/24/25-40-52/53S: (1/2-)36/3 7-45-61 | | |
612-211-00-0 | N-[(benzotriazole-1-yl)methyl)]-4-carboxybenzenesulfonamide | | 416-470-9 | - | Xi; R36N; R51-53 | Xi; NR: 36-51/53,S: (2-)26-61 | | |
612-212-00-6 | 2,6-dichloro-4-trifluoromethylaniline | | 416-430-0 | 24279-39-8 | Xn; R20/22Xi; R38R43N; R50-53 | Xn; NR: 20/22-38-43-50/53S: (2-)24-37-60-61 | | |
612-213-00-1 | isobutylidene-(2-(2-isopropyl-4,4-dimethyloxazolidine-3-yl)-1,1-dimethylethyl)amine | | 419-850-2 | 148348-13-4 | C; R34R52-53 | CR: 34-52/53S: (1/2-)23-26-36/37/39-45-61 | | |
612-214-00-7 | 4-(2,2-diphenylethenyl)-N,N-di-phenylbenzenamine | | 421-390-2 | 89114-90-9 | R 53 | R: 53S: 61 | | |
612-215-00-2 | 3-chloro-2-(isopropylthio)aniline | | 421-700-6 | 179104-32-6 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)37-61 | | |
612-217-00-3 | 1-methoxy-2-propylamine | | 422-550-4 | 37143-54-7 | F; R11C; R34Xn; R22R52-53 | F; CR: 11-22-34-52/53S: (1/2-)9-26-36/37/39-45-61 | | |
613-181-00-1 | 5,5-dimethyl-perhydro-pyrimidin-2-one a-(4-trifluoromethylstyryl)-α-(4-trifluoromethyl)cinnamylidenehydrazone | | 405-090-9 | 67485-29-4 | T; R48/25Xn; R22Xi; R36N; R50-53 | T; NR: 22-36-48/25-50/53S: (1/2-)22-26-36/37-45-60-61 | | |
613-182-00-7 | 1-(1-naphthylmethyl)quinolinium chloride | | 406-220-7 | 65322-65-8 | Carc.Cat.3; R40Muta.Cat.3; R68Xn; R22Xi; R38-41R 52-53 | XnR: 22-38-40-41-52/53-68S: (2-)22-26-36/37/39-61 | | |
613-183-00-2 | A mixture of: 5-(N-methylperfluorooctylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-one5-(N-methylperfluoroheptylsulfonamido)methyl-3-octadecyl-1,3-oxazolidin-2-one | | 413-640-4 | - | Xn; R48/22N; R50-53 | Xn; NR: 48/22-50/53S: (2-)36-60-61 | | |
613-184-00-8 | nitrilotriethyleneammoniopropane-2-ol 2-ethylhexanoate | | 413-670-8 | - | Xi; R36R 43 | XiR: 36-43S: (2-)24-26-37 | | |
613-185-00-3 | 2,3,5,6-tetrahydro-2-methyl-2H-cyclopenta[d]-1,2-thiazol-3-one | | 407-630-9 | 82633-79-2 | T; R25Xi; R41R 43N; R50-53 | T; NR: 25-41-43-50/53S: (1/2-)22-26-36/37/39-45-60-61 | | |
613-186-00-9 | (2R,3R)-3-((R)-1-(tert-butyldimethylsiloxy)ethyl)-4-oxoazetidin-2-yl acetate | | 408-050-9 | 76855-69-1 | Xi; R36R 43N; R51-53 | Xi; NR: 36-43-51/53S: (2-)24-26-37-61 | | |
613-188-00-X | 1-(3-(4-fluorophetioxy)propyl)-3-methoxy-4-piperidinone | | 411-500-7 | 116256-11-2 | Xn; R22Xi; R41R 43N; R51-53 | Xn; NR: 22-41-43-51/53S: (2-)22-24-26-37/39-61 | | |
613-189-00-5 | 1,4,7,10-tetrakis(p-toluensulfonyl)-1,4,7,10-tetraazacyclododecane | | 414-030-0 | 52667-88-6 | R 43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 | | |
613-190-00-0 | disodium 1-amino-4-(2-(5-chloro-6-fluoro-pyrimidin-4-ylamino-methyl)-4-methyl-6-sulfo phenylamino)-9,10-dioxo-9,10-dihydro-anthracene-2-sulfonate | | 414-040-5 | 149530-93-8 | Xn; R22R 43 | XnR: 22-43S: (2-)22-24-37 | | |
613-191-00-6 | 3-ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine | | 421-150-7 | 143860-04-2 | Repr.Cat.2; R60C: R34N; R50-53 | T; NR: 60-34-50/53S: 53-45-60-61 | | |
613-193-00-7 | pentakis[3-(dimethylammonio)propylsulfamoyl]-[(6-hydroxy-4,4,8,8-tetramethyl-4,8-diazoniaiindecane-1,11-diyldisulfamoyl)di[phthalocyaninecopper(II)]] heptalactate | | 414-930-3 | - | N; R51-53 | NR: 51/53S: 61 | | |
613-194-00-2 | 6,13-dichloro-3,10-bis{2-[4-fluoro-6-(2-sulfophenylamino)-1,3,5-triazin-2-ylaminojpropylamino}benzo[5,6][1,4]oxazino[2,3-b.]phenoxazine-4,11-disulphonic acid, lithium-, sodium salt. | | 418-000-8 | 163062-28-0 | Xi; R41 | XiR: 41S: (2-)22-26-39 | | |
613-195-00-8 | 2,2-(1,4-phenylene)bis((4H-3,1-benzoxazine-4-one) | | 418-280-1 | 18600-59-4 | R 43R 53 | XiR: 43-53S: (2-)24-37-61 | | |
613-196-00-3 | 5-[[4-chloro-6-[[2-[[4-fluoro-6-[[5-hydroxy-6-[(4-methoxy-2-sulfophenyl)azo]-7-sulfo-2-naphthalenyl]amino]-1,3,5-triazin-2-yl]amino]-1-methylethyl]amino]-1,3,5-triazin-2-yl]amino]-3-[[4-(ethenylsulfonyl)phenyl]azo]-4-hydroxy-naphtalene-2,7-disulfonic acid, sodium salt | | 418-380-5 | 168113-78-8 | Xi; R41 | XiR: 41S: (2-)26-39 | | |
613-197-00-9 | A mixture of: 2,4,6-tri(butylcarbamoyl)-1,3,5-triazine2,4,6-tri(methylcarbamoyl)-1,3,5-triazine[(2-butyl-4,6-dimethyl)tricarbamoyl]-1,3,5-triazine[(2,4-dibutyl-6-methyl)tricarbamoyl]-1,3,5-triazine | | 420-390-1 | 187547-46-2 | R 43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 | | |
613-199-00-X | A mixture of: 1,3,5-tris(3-aminomethylphenyl)-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione a mixture of oligomers of 3,5-bis(3-aminomethylphenyl)-1-poly[3,5-bis(3-aminomethylphenyl)-2,4,6-trioxo-1,3,5-(1H,3H,5H)-triazin-1-yl]-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione | | 421-550-1 | - | Carc.Cat.2; R45Repr.Cat.2; R61R 43R 52-53 | TR: 45-61-43-52/53S: 53-45-61 | | |
613-200-00-3 | Reaction product of: copper, (29H,31H-phthalocyaninato(2-)-N29,N30,N31,N32)-, chlorosulfuric acid and 3-(2-sulfooxyethylsulfony 1)aniline, sodium salts | | 420-980-7 | - | Xi; R41 | XiR: 41S: (2-)22-26-39 | | |
613-201-00-9 | (R)-5-bromo-3-(1-methyl-2-pyrrolidinyl methyl)-1H-indole | | 422-390-5 | 143322-57-0 | Repr.Cat.3; R62T; R39-48/25Xn; R20/22Xi; R41R 43N; R50-53 | T; NR: 20/22-39-41-43-48/25-62-50/53S: (1/2-)53-45-60-61 | | |
613-202-00-4 | pymetrozine (ISO)(E)-4,5-dihydro-6-methyl-4-(3-pyridylmethyleneamino)-1,2,4-triazin-3(2H)-one | | - | 123312-89-0 | Carc.Cat3; R40R52-53 | XnR: 40-52/53S: (2-)36/37-61 | | |
613-203-00-X | pyraflufen-ethyl[1]pyraflufen[2] | | -[1]-[2] | 129630-19-9[1]129630-17-7[2] | N; R50-53 | NR: 50/53S: 60-61 | | |
613-204-00-5 | oxadiargyl (ISO)3-[2,4-dichloro-5-(2-propynyloxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one5-tert-butyl-3-[2,4-dichloro-5-(prop-2-ynyloxy)phenyl]-1,3,4-oxadiazol-2(3H)-one | | 254-637-6 | 39807-15-3 | Repr.Cat 3; R63Xn; R48/22N; R50-53 | Xn; NR: 48/22-63-50/53S: (2-)36/37-46-60-61 | | |
613-205-00-0 | propiconazole(+)-1-[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-ylmethyl]-1H-1,2,4-triazole | | 262-104-4 | 60207-90-1 | Xn; R22R43N; R50-53 | Xn; NR: 22-43-50/53S: (2-)36/37-46-60-61 | | |
613-206-00-6 | fenamidone (ISO)(S)-5-methyl-2-methylthio-5-phenyl-3-phenylamino-3,5-dihydroimidazol-4-one | | - | 161326-34-7 | N; R50-53 | NR: 50/53S: 60-61 | | |
613-207-00-1 | imazalil sulphate, aqueous solution1-[2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate(±)-1- [2-(allyloxy)ethyl-2-(2,4-dichlorophenyl)]-1H-imidazolium hydrogen sulphate | | 261-351-5281-291-3 | 58594-72-283918-57-4 | Xn; R22C; R34R43N; R50-53 | C; NR: 22-34-43-50/53S: (2-)26-36/37/39-45-60-61 | C > 50 %: C, Xn, N; R22-34-43-50-5330 % < C ≤ 50 %: Xn, N; R22-38-41-43-50-5325 % ≤ C ≤ 30 %: Xn, N; R22-41-43-50-5315 % < C < 25 %: Xi, N; R41-43-51-535 % ≤ C ≤ 15 %: Xi, N; R36-43-51-532,5 % ≤ C < 5 %: Xi, N; R43-51-531 % ≤ C < 2,5 %: Xi; R43-52-530,25 % ≤ C < 1 %: R52-53 | |
613-208-00-7 | imazamox | | - | 114311-32-9 | N; R50-53 | NR: 50/53S: 60-61 | | |
613-209-00-2 | cis-1-(3-chloropropyl)-2,6-dimethyl-piperidin hydrochloride | | 417-430-3 | 63645-17-0 | T; R25Xn; R48/22R43N; R51-53 | T; NR: 25-43-48/22-51/53S: (1/2-)22-36/37-45-61 | | |
613-210-00-8 | 2-(3-chloropropyl)-2,5,5-trimethyl-1,3-dioxane | | 417-650-1 | 88128-57-8 | Xn; R48/22R52-53 | XnR: 48/22-52/53S: (2-)23-25-36-61 | | |
613-211-00-3 | N-methyl-4-(p-formylstyryl)pyridinium methylsulfate | | 418-240-3 | 74401-04-0 | R43R52-53 | XiR: 43-52/53S: (2-)22-24-37-61 | | |
613-212-00-9 | 4-[4-(2-ethylhexyloxy)phenyl] (1,4-thiazinane-1,1-dioxide) | | 418-320-8 | 133467-41-1 | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)22-60-61 | | |
613-213-00-4 | cis-1-benzoyl-4-[(4-methylsulfonyl)oxy]-L-proline | | 416-040-0 | 120807-02-5 | R 52-53 | R: 52/53S: 61 | | |
613-214-00-X | N,N-di-n-butyl-2-(1,2-dihydro-3-hydroxy-6-isopropyl-2-quinolylidene)-1,3-dioxoindan-5-carboxamide | | 416-260-7 | 147613-95-4 | R53 | R: 53S: 61 | | |
613-215-00-5 | 2-chloromethyl-3,4-dimethoxypyridinium chloride | | 416-440-5 | 72830-09-2 | Xn; R21/22-48/22Xi; R38-41R43N; R51-53 | Xn; NR: 21/22-38-41-43-48/22-51/53S: (2-)26-36/37/39-61 | | |
613-216-00-0 | 6-tert-butyl-7-(6-diethylamino-2-methyl-3-pyridylimino)-3-(3-methylphenyl)pyrazolo[3,2-c][1,2,4]triazole | | 416-490-8 | - | N; R50-53 | NR: 50/53S: 60-61 | | |
613-217-00-6 | 4-[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionyloxy]-1-[2-[3-(3,5-di-tert-butyl-4-hydrophenyl)propionyloxy]ethyl] -2,2,6,6-tetramethylpiperidine | | 416-770-1 | 73754-27-5 | R 53 | R: 53S: 61 | | |
613-218-00-1 | 6-hydroxyindole | | 417-020-4 | 2380-86-1 | Xn; R22Xi; R41R43N; R51-53 | Xn; NR: 22-41-43-51/53S: (2-)24-26-37/39-61 | | |
613-219-00-7 | 7a-ethyl-3,5-bis(1-methylethyl)-2,3,4,5-tetrahydrooxazolo[3,4-c]-2,3,4,5-tetrahydrooxazole | | 417-140-7 | 79185-77-6 | Xi; R38N; R51-53 | Xi; NR: 38-51/53S: (2-)37-61 | | |
613-220-00-2 | trans-(4S,6S)-5,6-dihydro-6-methyl-4H-thieno[2,3-b]thiopyran-4-ol, 7,7-dioxide | | 417-290-3 | 147086-81-5 | Xn; R22 | XnR: 22S: (2-)36 | | |
613-221-00-8 | 2-chloro-5-methyl-pyridine | | 418-050-0 | 18368-64-4 | Xn; R21/22Xi; R38R52-53 | XnR: 21/22-38-52/53S: (2-)23-25-36/37-61 | | |
613-222-00-3 | 4-(1-oxo-2-propenyl)-morpholine | | 418-140-1 | 5117-12-4 | Xn; R22-48/22Xi; R41R43 | XnR: 22-41-43-48/22S: (2-)23-26-36/37/39 | | |
613-223-00-9 | N-isopropyl-3-(4-fluorophenyl)-1H-indole | | 418-790-4 | 93957-49-4 | R 53 | R: 53S: 61 | | |
613-224-00-4 | 2,5-dimercaptomethyl-1,4-dithiane | | 419-770-8 | 136122-15-1 | Xn; R22C; R34R43N; R50-53 | C; NR: 22-34-43-50/53S: (1/2-)26-36/37/39-45-60-61 | | |
613-225-00-X | A mixture of:[2-(anthraquinon-1-ylamino)-6-[(5-benzoylamino)-anthraquinone-1-ylamino]-4-phenyl]-1,3,5-triazine 2,6-bis-[(5-benzoylamino)-anthraquinon-1-ylamino]-4-phenyl-1,3,5-triazine. | | 421-290-9 | - | Xn; R48/22R53 | XnR: 48/22-53S: (2-)22-36-61 | | |
613-226-00-5 | 1-(2-(ethyl(4-(4-(4-(4-(ethyl(2-pyridinoethyl)amino)-2-methylphenylazo)benzoylamino)-phenylazo)-3-methylphenyl)amino)ethyl-pyridinium dichloride | | 420-950-3 | 163831-67-2 | Xi; R41N; R50-53 | Xi; NR: 41-50/53S: (2-)26-39-60-61 | | |
613-227-00-0 | (+/-)-[(R*,R*)and(R*,S*)]-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran | | 419-600-2 | - | R 43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-28-36/37-61 | | |
613-228-00-6 | (+/-)-(R*,S*)-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran | | 419-630-6 | - | N; R51-53 | NR: 51/53S: 24-61 | | |
613-230-00-7 | florasulam (ISO)2',6',8-trifluoro-5-methoxy-5-triazolo[1,5-c]pyrimidine-2-sulfonanilide | | - | 145701-23-1 | N; R50-53 | NR: 50/53S: 60-61 | | |
| | | | | | | | |
613-233-00-3 | 4,4'-(oxy-(bismethylene))-bis-1,3-dioxolane | | 423-230-7 | 56552-15-9 | Xi; R41 | XiR: 41S: (2-)26-39 | | |
614-028-00-1 | A mixture of: 2-ethylhexyl mono-D-glucopyranoside2-ethylhexyl di-D-glucopyranoside | | 414-420-0 | - | Xi; R41 | XiR: 41S: (2-)26-39 | | |
614-029-00-7 | Constitutional isomers of penta-O-allyl-β-D-fructofuranosyl-α-D-glucopyranosideConstitutional isomers of hexa-O-allyl-β-D-fructofuranosyl-α-D-glucopyranosideConstitutional isomers of hepta-O-allyl-β-D-fructofuransoyl-α-D-glucopyranoside | | 419-640-0 | 68784-14-5 | Xn; R22 | XnR: 22S: (2-) | | |
615-030-00-5 | alkali salts, alkali earth salts and other salts of thiocyanic acid not mentioned elsewhere in this Annex | A | - | - | Xn; R20/21/22R32R52-53 | XnR: 20/21/22-32-52/53S: (2-)13-61 | | |
615-031-00-0 | thallium salt of thiocyanic acid | A | 222-571-7 | 3535-84-0 | Xn; R20/21/22R32N; R51-53 | Xn; NR: 20/21/22-32-51/53S: (2-)13-61 | | |
615-032-00-6 | metal salts of thiocyanic acid not mentioned elsewhere in this Annex | A | - | - | Xn; R20/21/22R32N; R50-53 | Xn; NR: 20/21/22-32-50/53S: (2-)13-60-61 | | |
616-092-00-6 | Polymeric reaction product of bicyclo[2.2.1]hepta-2,5-diene, ethene, 1,4-hexadiene, 1-propene with N,N-di-2-propenylformamide | | 404-035-6 | - | R 43R 53 | XiR: 43-53S: (2-)24-37-61 | | |
616-093-00-1 | Reaction products of: aniline-terephthalaldehyde-o-toluidine condensate with maleic anhydride | | 406-620-1 | 129217-90-9 | R 43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 | | |
616-094-00-7 | 3,3'-dicyclohexyl-1,1'-methylenebis(4,1-phenylene)diurea | | 406-370-3 | 58890-25-8 | R 43R 53 | XiR: 43-53S: (2-)24-37-61 | | |
616-095-00-2 | 3,3'-dioctadecyl-1,1'-methylenebis(4,1-phenylene)diurea | | 406-690-3 | 43136-14-7 | R 53 | R: 53S: 61 | | |
| | | | | | | | |
616-096-00-8 | N-(3-hexadecyloxy-2-hydroxyprop-1-yl)-N-(2-hydroxyethyl)palmitamide | | 408-110-4 | 110483-07-3 | R 53 | R: 53S: 61 | | |
616-097-00-3 | N,N'-1,4-phenylenebis(2-((2-methoxy-4-nitrophenyl)azo)-3-oxobutanamide | | 411-840-6 | 83372-55-8 | R 53 | R: 53S: 61 | | |
616-098-00-9 | 1-[4-chloro-3-((2,2,3,3,3-pentafluoropropoxy)methyl)phenyl]-5-phenyl-1H-1,2,4-triazole-3-carboxamide | | 411-750-7 | 119126-15-7 | N; R51-53 | NR: 51/53S: 61 | | |
616-099-00-4 | 2-[4-[(4-hydroxyphenyl)sulfonyl]phenoxy]-4,4-dimethyl-N-[5-[(methylsulfonyl)amino]-2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]phenyl ]-3-oxopentanamide | | 414-170-2 | 135937-20-1 | R 53 | R: 53S: 61 | | |
616-100-00-8 | 1,3-dimethyl-1,3-bis(trimethylsilyl)urea | | 414-180-7 | 10218-17-4 | Xn; R22Xi; R38 | XnR: 22-38S: (2-)36/37 | | |
616-101-00-3 | (S)-N-tert-butyl-1,2,3,4-tetrahydro-3-isoquinolinecarboxamide | | 414-600-9 | 149182-72-9 | Xn; R22R 52-53 | XnR: 22-52/53S:(2-)61 | | |
616-102-00-9 | A mixture of: α-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyl]-ω-[3-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyloxy]-poly-(oxyethylene-co-oxypropylene)1,2-(or 1,3-)bis[α-(3-mercaptopropanoxycarbonylamino)methylphenylaminocarbonyl)-ω-oxy-poly(oxyethylene-co-oxypropylene)]-3-(or 2-)propanol1,2,3-tris[α-(3-mercaptopropanoxycarbonyl-amino)methylphenylaminocarbonyl)-ω-oxy-poly-(oxyethylene-co-oxypropylene)]propane] | | 415-870-0 | - | R 43N; R51-53 | Xi; NR: 43-51/53S: (2-)36/37-61 | | |
616-103-00-4 | (S,S)-trans-4-(acetylamino)-5,6-dihydro-6-methyl-7,7-dioxo-4H-thieno[2,3-b]thiopyran-2-sulfonamide | | 415-030-3 | 120298-38-6 | R43N; R50-53 | Xi; NR: 43-50/53S: (2-)24-37-60-61 | | |
616-104-00-X | benalaxylmethyl N-(2,6-dimethylphenyl)-N-(phenylacetyl)-DL-alaninate | | 275-728-7 | 71626-11-4 | N; R50-53 | NR: 50/53S: 60-61 | | |
616-105-00-5 | chlorotoluron3-(3-chloro-p-tolyl)-1,1-dimethylurea | | 239-592-2 | 15545-48-9 | Carc. Cat. 3; R40Repr. Cat. 3; R63N; R50-53 | Xn; NR: 40-63-50/53S: (2-)36/37-26-46-60-61 | | |
616-106-00-0 | phenmediphammethyl 3-(3-methylcarbaniloyloxy)carbanilate(ISO) | | 237-199-0 | 13684-63-4 | N; R50-53 | NR: 50/53S: 60-61 | | |
616-108-00-1 | iodosulfuron-methyl-sodium | | - | 144550-36-7 | N; R50-53 | NR: 50/53S: 60-61 | | |
616-109-00-7 | sulfosulfuron1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea | | - | 141776-32-1 | N; R50-53 | NR: 50/53S: 60-61 | | |
616-110-00-2 | cyclanilide1-(2,4-dichloroanilinocarbonyl)cyclopropanecarboxylic acid | | 419-150-7 | 113136-77-9 | Xn; R22N; R51-53 | Xn; NR: 22-51/53S: (2-)61 | | |
616-111-00-8 | fenhexamidN-(2,3-dichlor-4-hydroxyphenyl)-1-methylcyclohexancarboxamid | | 422-530-5 | 126833-17-8 | N; R51-53 | NR: 51/53S: 61 | | |
616-112-00-3 | oxasulfuronoxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)-carbamoylsulfamoyl]benzoate | | - | 144651-06-9 | Xn; R48/22N; R50-53 | Xn; NR: 48/22-50/53S: (2-)46-60-61 | | |
616-113-00-9 | desmediphamethyl 3-phenylcarbamoyloxyphenylcarba mate | | 237-198-5 | 13684-56-5 | N; R50-53 | NR: 50/53S: 60-61 | C ≥ 2,5 < %: N; R50/530,25 % ≤ C < 2,5 %: N; R51/530,025 % ≤ C < 0,25 %: R52/53 | |
616-114-00-4 | dodecanamide, N,N'-(9,9', 10,10'-tetrahydro-9,9',10,10'-tetraoxo(1,1'-bianthracene)-4,4'-diyl)bis- | | 418-010-2 | 136897-58-0 | R53 | R: 53S: 22-61 | | |
616-115-00-X | N-(3-acetyl-2-hydroxyphenyl)-4-(4-phenylbutoxy)benzamide | | 416-150-9 | 136450-06-1 | R 53 | R: 53S: 61 | | |
616-116-00-5 | N-(4-dimethylaminopyridinium)-3-methoxy-4-(1-methyl-5-nitroindol-3-ylmethyl)-N-(o-tolylsulfonyl)benzamidate | | 416-790-9 | - | R 53 | R: 53S: 61 | | |
616-117-00-0 | N-[2-(3-acetyl-5-nitrothiophen-2-ylazo)-5-diethylaminophenyl]acetamide | | 416-860-9 | - | Repr.Cat.3; R62R43N; R50-53 | Xn; NR: 43-62-50/53S: (2-)22-36/37-60-61 | | |
616-118-00-6 | N-(2',6'-dimethylphenyl)-2-piperidinecarboxamide hydrochloride | | 417-950-0 | 65797-42-4 | Xn; R22R52-53 | XnR: 22-52/53S: (2-)22-61 | | |
616-119-00-1 | 2-(1-butyl-3,5-dioxo-2-phenyl-(1,2,4)-triazolidin-4-yl)-4,4-dimethyl-3-oxo-N-(2-methoxy-5-(2-(dodecyl-1-sulfonyl))propionylamino)-phenyl)-pentanamide | | 418-060-5 | 118020-93-2 | R 53 | R: 53S: 61 | | |
616-120-00-7 | A mixture of: N-(3-dimethylamino-4-methyl-phenyl)-benzamideN-(3-dimethylamino-2-methyl-phenyl)-benzamideN-(3-dimethylamino-3-methyl-phenyl)-benzamide | | 420-600-1 | - | Xn; R48/22N; R51-53 | Xn; NR: 48/22-51/53S: (2-)36/37-61 | | |
616-121-00-2 | 2,4-dihydroxy-N-(2-methoxyphenyl)benzamide | | 419-090-1 | 129205-19-2 | R 43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 | | |
616-123-00-3 | N-[3-[[4-(diethylamino)-2-methylphenyl]imino]-6-oxo-1,4-cyclohexadienyljacetamide | | 414-740-0 | 96141-86-5 | N; R50-53 | NR: 50/53S: 60-61 | | |
616-124-00-9 | lithiumbis(trifluoromethylsulfonyl)imide | | 415-300-0 | 90076-65-6 | T; R24/25C; R34R 52-53 | TR: 24/25-34-52/53S: (1/2-)22-26-36/37/39-45-61 | | |
616-125-00-4 | 3-cyano-N-(1,1-dimethylethyl)androsta-3,5-diene-17-β-carboxamide | | 415-730-9 | 151338-11-3 | N; R50-53 | NR: 50/53S: 60-61 | | |
616-127-00-5 | A mixture of: N,N'-Ethane-1,2-diylbis(decanamide)12-Hydroxy-N-[2-[1-oxydecyl)amino]ethyl]octadecanamideN,N'-Ethane-1,2-diylbis(12-hydroxyoctadecanamide) | | 430-050-2 | - | R43N; R51-53 | Xi; NR: 43-51/53S: (2-)24-37-61 | | |
616-128-00-0 | N-(2-(1-allyl-4,5-dicyanoimidazol-2-ylazo)-5-(dipropylamino)phenyl)-acetamide | | 417-530-7 | 123590-00-1 | R53 | R: 53S: 61 | | |
616-129-00-6 | N,N'-bis(2,2,6,6-tetramethyl-4-piperidyl)isophthalamide | | 419-710-0 | 42774-15-2 | Xn; R22Xi; R36 | XnR: 22-36S: (2-)22-25-26 | | |
616-130-00-1 | N-(3-(2-(4,4-dimethyl-2,5-dioxo-imidazolin-1-yl)-4,4-dimethyl-3-oxo-pentanoylamino)-4-methoxy-phenyl)-octadecanamide | | 421-780-2 | 150919-56-5 | R53 | R: 53S: 61 | | |
616-132-00-2 | N-[4-(4-cyano-2-furfurylidene-2,5-dihydro-5-oxo-3-furyl)phenyl]butane-1-sulfonamide | | 423-250-6 | 130016-98-7 | N; R50-53 | NR: 50/53S: 60-61 | | |
616-133-00-8 | N-cyclohexyl-S,S-dioxobenzo[b]tiophene-2-carboxamide | | 423-990-1 | 149118-66-1 | Xn; R22Xi; R41N; R50-53 | Xn; NR: 22-41-50/53S: (2-)22-26-39-60-61 | | |
616-134-00-3 | 3,3'-bis(dioctyloxyphosphinothioylthio)-N,N'-oxybis(methylene)dipropionamide | | 401-820-5 | - | R52-53 | R: 52/53S: 61 | | |
616-135-00-9 | (3S,4aS,8aS)-2-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-N-tert-butyldecahydroisoquinoline-3-carboxamide | | 430-230-0 | 136522-17-3 | Xn; R22R52-53 | XnR: 22-52/53S:(2-)22-61 | | |
616-142-00-7 | 1,3-Bis(vinylsulfonylacetamido)propane | | 428-350-3 | 93629-90-4 | Muta.Cat.3; R68Xi; R41R 43R 52-53 | XnR: 41-43-68-52/53S: (2-)22-26-36/37/39-61 | | |
616-143-00-2 | N,N'-dihexadecyl-N,N'-bis(2-hydroxyethyl)propanediamide | | 422-560-9 | 149591-38-8 | Xn; Repr. Cat. 3; R62Xi; R36R53 | XnR: 62-36-53S: (2-)26-36/37-61 | | |
617-018-00-5 | A mixture of: 1-methyl-1-(3-(1-methylethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxide, 63% by weight1-methyl-1-(4-(1-methylethyl)phenyl)ethyl-1-methyl-1-phenylethylperoxide, 31 % by weight | | 410-840-3 | 71566-50-2 | O; R7N; R51-53 | O; NR: 7-51/53S: (2-)3/7-14-36/37/39-61 | | |
617-019-00-0 | 6-(phthalimido)peroxyhexanoic acid | | 410-850-8 | 128275-31-0 | O; R7Xi; R41N; R50 | O; Xi; NR: 7-41-50S: (2-)3/7-14-26-36/37/39-61 | | |
617-020-00-6 | 1,3-di(prop-2,2-diyl)benzene bis(neodecanoylperoxide) | | 420-060-5 | 117663-11-3 | R10O; R7N; R51-53 | O; NR: 7-10-51/53S: (2-)7-14-36/37/39-47-61 | | |
650-042-00-4 | Reaction product of:polyethylene-polyamine-(C 16-C18)-alkylamides with monothio-(C2)-alkyl phosphonates | | 417-450-2 | - | Xi; R36/38R43R52-53 | XiR: 36/38-43-52/53S: (2-)24-26-37-61 | | |
650-043-00-X | Reaction product of: 3,5-bis-tert-butylsalicylicacid and aluminiumsulfate | | 420-310-3 | - | Xn; R22N; R50-53 | Xn; NR: 22-50/53S: (2-)22-56-60-61 | | |
650-044-00-5 | mixed linear and branched C14-15 alcohols ethoxylated, reaction product with epichlorohydrin | | 420-480-9 | 158570-99-1 | Xi; R38R43N; R50-53 | Xi; NR: 38-43-50/53S: (2-)24-37-60-61 | | |
650-045-00-0 | Reaction product of: 1,2,3-propanetricarboxylic acid, 2-hydroxy, diethyl ester, 1-propanol and zirconium tetra-n-propanolate | | 417-110-3 | - | F; R11Xi; R38-41N; R51-53 | F; Xi; NR: 11-38-41-51/53S: (2-)9-16-26-37/39-61 | | |
650-046-00-6 | di(tetramethylammonium)(29H,31H-phthalocyanin-N29,N30,N31,N32)disulfonamide disulfonate, cuprate(2-)complex, derivates | | 416-180-2 | - | Xn; R22-48/22N; R51-53 | Xn; NR: 22-48/22-51/53S: (2-)22-36-61 | | |
650-047-00-1 | dibenzylphenylsulfonium hexafluoroantimonate | | 417-760-8 | 134164-24-2 | T; R48/25Xn; R22Xi; R41R43N; R51-53 | T; NR: 22-41-43-48/25-51/53S:(1/2-)22-26-36/37/39-45-61 | | |
650-048-00-7 | Reaction product of: borax, hydrogen peroxide, acetic acid anhydride and acetic acid | | 420-070-1 | - | O; R7Xn; R20/21/22C; R35N; R50 | O; C; NR: 7-20/21/22-35-50S: (1/2-)3/7-14-26-36/37/39-45-61 | | |
650-049-00-2 | 2-alkoyloxyethyl hydrogen maleate, where alkoyl represents (by weight) 70 to 85% unsaturated octadecoyl, 0.5 to 10% saturated octadecoyl, and 2 to 18% saturated hexadecoyl | | 417-960-5 | - | Xi; R38-41R43N; R50-53 | Xi; NR: 38-41-43-50/53S: (2-)24-26-37/39-60-61 | | |
650-050-00-8 | A mixture of: 1-methyl-3-hydroxypropyl 3,5-[1,1-dimethylethyl]-4-hydroxydihydro-cinnamate and/or 3-hydroxybutyl3,5-[1,1-dimethylethyl]-4-hydroxydihydrocinnamate 1,3-butanediol bis[3-(3'-(1,1-dimethylethyl)4'-hydroxy-phenyl)propionate] isomers 1,3-butanediol bis[3(3',5'-(1,1-dimethylethyl)-4'-hydroxyphenyl)propionate] isomers | | 423-600-8 | - | N; R51-53 | NR: 51/53S: 61 | | |
650-055-00-5 | silver sodium zirconium hydrogenphosphate | | 422-570-3 | - | N; R50-53 | NR: 50/53S: 60-61 | | |
| | | | | | | | |
048-002-00-0 | cadmium (non-pyrophoric)[1]cadmium oxide (non-pyrophoric)[2] | E | 231-152-8[1]215-146-2[2] | 7440-43-9 [1]1306-19-0 [2] | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62-63T; R48/23/25T+; R26N; R50-53 | T+; NR: 45-26-48/23/25-62-63-68-50/53S: 53-45-60-61 | | |
048-011-00-X | cadmium (pyrophoric) | E | 231-152-8 | 7440-43-9 | Carc. Cat. 2; R45Muta. Cat. 3; R68Repr. Cat. 3; R62-63T; R48/23/25T+; R26F; R17N; R50-53 | F; T+; NR: 45-17-26-48/23/25-62-63-68-50/53S: 53-45-7/8-43-60-61 | | |
609-006-00-3 | 4-nitrotoluene | C | 202-808-0 | 99-99-0 | T; R23/24/25R33N; R51/53 | T; NR: 23/24/25-33-51/53S: (1/2-)28-37-45-61 | | |
609-065-00-5 | 2-nitrotoluene | E | 201-853-3 | 88-72-2 | Carc. Cat. 2; R45Muta. Cat. 2; R46Repr. Cat. 3; R62Xn; R22N; R51-53 | T; NR: 45-46-22-62-51/53S: 53-45-61 | | |
612-039-00-6 | 2-ethoxyanilineo-phenetidine | C | 202-356-4 | 94-70-2 | T; R23/24/25R33 | TR: 23/24/25-33S:(1/2-)28-36/37-45 | | |
612-207-00-9 | 4-ethoxyanilinep-phenetidine | | 205-855-5 | 156-43-4 | Muta. Cat. 3; R68Xn; R20/21/22Xi; R36R43 | XnR: 20/21/22-36-43-68S: (2-)36/37-46 | | |